| Revision as of 06:38, 11 August 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Script assisted update of identifiers for the Chem/Drugbox validation project (updated: 'ChEBI').← Previous edit | Revision as of 06:49, 11 August 2011 edit undoCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'DrugBank_Ref', 'UNII_Ref', 'ChEMBL_Ref', 'ChEBI_Ref') per Chem/Drugbox validation (report [[Wikipedia_talk:WikiProject_ChNext edit → | ||
| Line 1: | Line 1: | ||
| {{chembox | {{chembox | ||
| | verifiedrevid = |
| verifiedrevid = 444216267 | ||
| |ImageFile=Terbuthylazine.png | |ImageFile=Terbuthylazine.png | ||
| |ImageSize= | |ImageSize= | ||
| Line 19: | Line 19: | ||
| | KEGG_Ref = {{keggcite|correct|kegg}} | | KEGG_Ref = {{keggcite|correct|kegg}} | ||
| | KEGG = C18810 | | KEGG = C18810 | ||
| | ChEBI_Ref = {{ebicite|correct|EBI}} | |||
| | |
| ChEBI = 30263 | ||
| | SMILES = Clc1nc(nc(n1)NC(C)(C)C)NCC | | SMILES = Clc1nc(nc(n1)NC(C)(C)C)NCC | ||
| }} | }} | ||
Revision as of 06:49, 11 August 2011
| |
| Names | |
|---|---|
| IUPAC name N-tert-butyl-6-chloro-N'-ethyl-1,3,5-triazine-2,4-diamine | |
| Identifiers | |
| CAS Number | |
| 3D model (JSmol) | |
| ChEBI | |
| ChemSpider | |
| ECHA InfoCard | 100.025.125 
|
| KEGG | |
| PubChem CID | |
| CompTox Dashboard (EPA) | |
InChI
| |
SMILES
| |
| Properties | |
| Chemical formula | C9H16ClN5 |
| Molar mass | 229.710 g/mol |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C , 100 kPa).
 Y verify (what is ?)
Infobox references
| |
Terbuthylazine is a selective herbicide. Chemically, it is a chlorotriazine; compared with atrazine and simazin, it has a tert-butyl group in place of the isopropyl and ethyl groups, respectively.