Misplaced Pages

Amezinium metilsulfate: Difference between revisions

Article snapshot taken from[REDACTED] with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
Browse history interactively← Previous editNext edit →Content deleted Content addedVisualWikitext
Revision as of 16:03, 23 August 2011 editHRoestBot (talk | contribs)53,714 editsm r2.6.5) (robot Adding: de:Ameziniummetilsulfat← Previous edit Revision as of 02:07, 3 September 2011 edit undoBogBot (talk | contribs)Bots53,132 edits populated new fields in {{drugbox}} and reordered per bot approval. Report errors and suggestions to User_talk:BogBotNext edit →
Line 1: Line 1:
{{drugbox {{Drugbox
| Verifiedfields = changed | Verifiedfields = changed
| Watchedfields = changed | Watchedfields = changed
⚫ | UNII_Ref = {{fdacite|changed|FDA}}
⚫ | UNII = 03NR868ICX
| verifiedrevid = 399504585 | verifiedrevid = 399504585
| IUPAC_name = 6-Methoxy-1-phenylpyridazin-1-ium-4-amine; methyl sulfate | IUPAC_name = 6-Methoxy-1-phenylpyridazin-1-ium-4-amine; methyl sulfate
| image = Amezinium metilsulfate.png | image = Amezinium metilsulfate.png

<!--Clinical data-->
| tradename =
| Drugs.com = {{drugs.com|international|amezinium-metilsulfate}}
⚫ | pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
⚫ | pregnancy_US = <!-- A / B / C / D / X -->
⚫ | pregnancy_category =
⚫ | legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
⚫ | legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII -->
⚫ | legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C -->
⚫ | legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
⚫ | legal_status = Rx-only
⚫ | routes_of_administration = Oral

<!--Pharmacokinetic data-->
⚫ | bioavailability =
⚫ | protein_bound =
⚫ | metabolism =
⚫ | elimination_half-life =
⚫ | excretion =

<!--Identifiers-->
⚫ | CAS_number = 30578-37-1
⚫ | ATC_prefix = C01
⚫ | ATC_suffix = CA25
⚫ | ATC_supplemental =
⚫ | PubChem = 71926
⚫ | DrugBank_Ref = {{drugbankcite|correct|drugbank}}
⚫ | DrugBank =
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 64937 | ChemSpiderID = 64937
⚫ | UNII_Ref = {{fdacite|changed|FDA}}
⚫ | UNII = 03NR868ICX
⚫ | KEGG_Ref = {{keggcite|changed|kegg}}
⚫ | KEGG = D01304

<!--Chemical data-->
⚫ | chemical_formula =
⚫ | C=12 | H=15 | N=3 | O=5 | S=1
⚫ | molecular_weight = 313.32 g/mol
⚫ | smiles = COC1=(N=CC(=C1)N)C2=CC=CC=C2.COS(=O)(=O)
| InChI = 1/C11H11N3O.CH4O4S/c1-15-11-7-9(12)8-13-14(11)10-5-3-2-4-6-10;1-5-6(2,3)4/h2-8,12H,1H3;1H3,(H,2,3,4) | InChI = 1/C11H11N3O.CH4O4S/c1-15-11-7-9(12)8-13-14(11)10-5-3-2-4-6-10;1-5-6(2,3)4/h2-8,12H,1H3;1H3,(H,2,3,4)
| InChIKey = ZEASXVYVFFXULL-UHFFFAOYAG | InChIKey = ZEASXVYVFFXULL-UHFFFAOYAG
| smiles1 = S(=O)(=O)OC.O(c1(ncc(N)c1)c2ccccc2)C
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C11H11N3O.CH4O4S/c1-15-11-7-9(12)8-13-14(11)10-5-3-2-4-6-10;1-5-6(2,3)4/h2-8,12H,1H3;1H3,(H,2,3,4) | StdInChI = 1S/C11H11N3O.CH4O4S/c1-15-11-7-9(12)8-13-14(11)10-5-3-2-4-6-10;1-5-6(2,3)4/h2-8,12H,1H3;1H3,(H,2,3,4)
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = ZEASXVYVFFXULL-UHFFFAOYSA-N | StdInChIKey = ZEASXVYVFFXULL-UHFFFAOYSA-N
⚫ | CAS_number = 30578-37-1
| CAS_supplemental =
⚫ | ATC_prefix = C01
⚫ | ATC_suffix = CA25
⚫ | ATC_supplemental =
⚫ | PubChem = 71926
⚫ | DrugBank_Ref = {{drugbankcite|correct|drugbank}}
⚫ | DrugBank =
⚫ | KEGG_Ref = {{keggcite|changed|kegg}}
⚫ | KEGG = D01304
⚫ | chemical_formula =
⚫ | C=12 | H=15 | N=3 | O=5 | S=1
⚫ | molecular_weight = 313.32 g/mol
⚫ | smiles = COC1=(N=CC(=C1)N)C2=CC=CC=C2.COS(=O)(=O)
⚫ | bioavailability =
⚫ | protein_bound =
⚫ | metabolism =
⚫ | elimination_half-life =
⚫ | excretion =
⚫ | pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
⚫ | pregnancy_US = <!-- A / B / C / D / X -->
⚫ | pregnancy_category=
⚫ | legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
⚫ | legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII -->
⚫ | legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C -->
⚫ | legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
⚫ | legal_status = Rx-only
⚫ | routes_of_administration = Oral
}} }}


Revision as of 02:07, 3 September 2011

Pharmaceutical compound
Amezinium metilsulfate
Clinical data
AHFS/Drugs.comInternational Drug Names
Routes of
administration		Oral
ATC code
Legal status
Legal status
  • In general: ℞ (Prescription only)
Identifiers
IUPAC name
  • 6-Methoxy-1-phenylpyridazin-1-ium-4-amine; methyl sulfate
CAS Number
PubChem CID
ChemSpider
UNII
KEGG
CompTox Dashboard (EPA)
ECHA InfoCard100.045.665 Edit this at Wikidata
Chemical and physical data
FormulaC12H15N3O5S
Molar mass313.32 g/mol g·mol
3D model (JSmol)
SMILES
  • COC1=(N=CC(=C1)N)C2=CC=CC=C2.COS(=O)(=O)
InChI
  • InChI=1S/C11H11N3O.CH4O4S/c1-15-11-7-9(12)8-13-14(11)10-5-3-2-4-6-10;1-5-6(2,3)4/h2-8,12H,1H3;1H3,(H,2,3,4)
  • Key:ZEASXVYVFFXULL-UHFFFAOYSA-N
  (what is this?)  (verify)

Amezinium metilsulfate (INN, trade name Regulton) is a sympathomimetic drug used for the treatment of low blood pressure. It has multiple mechanisms, including stimulation of alpha and beta-1 receptors and inhibition of noradrenaline and tyramine uptake.

References

  1. PMID 6873182
  2. PMID 7197970
Cardiac stimulants excluding cardiac glycosides (C01C)
Adrenergic and
dopaminergic agents
Adrenergic agonists
α
β
mixed
Dopamine agonists
Both
Unknown/ungrouped
Phosphodiesterase inhibitors (PDE3I)
Other cardiac stimulants


Stub icon

This drug article relating to the cardiovascular system is a stub. You can help Misplaced Pages by expanding it.

Categories:
Amezinium metilsulfate: Difference between revisions Add topic