Robenidine: Difference between revisions

Browse history interactively ← Previous edit Next edit →Content deleted Content addedVisual WikitextInline

Revision as of 20:49, 11 August 2011 editCheMoBot (talk \| contribs)Bots141,565 edits Updating {{drugbox}} (no changed fields - added verified revid - updated 'ChemSpiderID_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'KEGG_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEBI_Ref') per [[Misplaced Pages:WikiProject Chemicals/Chembox validation\|Chem/Drugbox← Previous edit		Revision as of 12:19, 3 September 2011 edit undoBogBot (talk \| contribs)Bots53,132 edits populated new fields in {{drugbox}} and reordered per bot approval. Report errors and suggestions to User_talk:BogBot Next edit →
Line 1:		Line 1:
	{{~~drugbox~~		{{Drugbox
⚫	\| UNII_Ref = {{fdacite\|correct\|FDA}}
⚫	\| UNII = 4888ME6C4E
	\| verifiedrevid = 443228922		\| verifiedrevid = 443228922
	\| IUPAC_name = 1,2-Bisguanidine		\| IUPAC_name = 1,2-Bisguanidine
	\| image = Robenidine.png		\| image = Robenidine.png

⚫	\| CAS_number = 25875-51-8
			<!--Clinical data-->
⚫	\| ATCvet = yes
			\| tradename =
⚫	\| ATC_prefix = P51
			\| Drugs.com = {{drugs.com\|international\|robenidine}}
⚫	\| ATC_suffix = AX13
	\| ~~PubChem~~ = ~~9570438~~		\| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
		⚫	\| pregnancy_US = <!-- A / B / C / D / X -->
		⚫	\| pregnancy_category =
		⚫	\| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
		⚫	\| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII -->
		⚫	\| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C -->
		⚫	\| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
		⚫	\| legal_status =
		⚫	\| routes_of_administration =

			<!--Pharmacokinetic data-->
		⚫	\| bioavailability =
		⚫	\| protein_bound =
		⚫	\| metabolism =
		⚫	\| elimination_half-life =
		⚫	\| excretion =

			<!--Identifiers-->
		⚫	\| CAS_number = 25875-51-8
		⚫	\| ATCvet = yes
		⚫	\| ATC_prefix = P51
		⚫	\| ATC_suffix = AX13
			\| PubChem = 9570438
	\| DrugBank_Ref = {{drugbankcite\|correct\|drugbank}}		\| DrugBank_Ref = {{drugbankcite\|correct\|drugbank}}
	\| DrugBank =		\| DrugBank =
		⚫	\| UNII_Ref = {{fdacite\|correct\|FDA}}
⚫	\| chemical_formula =
		⚫	\| UNII = 4888ME6C4E
⚫	\| C=15 \| H=13 \| Cl=2 \| N=5

⚫	\| molecular_weight = 334.20 g/mol
			<!--Chemical data-->
		⚫	\| chemical_formula =
		⚫	\| C=15 \| H=13 \| Cl=2 \| N=5
		⚫	\| molecular_weight = 334.20 g/mol
	\| smiles = C1=CC(=CC=C1C=NNC(=NN=CC2=CC=C(C=C2)Cl)N)Cl		\| smiles = C1=CC(=CC=C1C=NNC(=NN=CC2=CC=C(C=C2)Cl)N)Cl
⚫	\| bioavailability =
⚫	\| protein_bound =
⚫	\| metabolism =
⚫	\| elimination_half-life =
⚫	\| excretion =
	\| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
⚫	\| pregnancy_US = <!-- A / B / C / D / X -->
⚫	\| pregnancy_category=
⚫	\| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
⚫	\| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII -->
⚫	\| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C -->
⚫	\| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
⚫	\| legal_status =
⚫	\| routes_of_administration =
	}}		}}

Revision as of 12:19, 3 September 2011

Pharmaceutical compound

Robenidine
Clinical data

AHFS/Drugs.com	International Drug Names
ATCvet code	QP51AX13 (WHO)
Identifiers
IUPAC name 1,2-Bisguanidine
CAS Number	25875-51-8
PubChem CID	9570438
UNII	4888ME6C4E
CompTox Dashboard (EPA)	DTXSID9046813
ECHA InfoCard	100.042.993
Chemical and physical data
Formula	C₁₅H₁₃Cl₂N₅
Molar mass	334.20 g/mol g·mol
3D model (JSmol)	Interactive image
SMILES C1=CC(=CC=C1C=NNC(=NN=CC2=CC=C(C=C2)Cl)N)Cl
(verify)

Robenidine is a coccidiostat.

This antiinfective drug article is a stub. You can help Misplaced Pages by expanding it.

Categories: