Revision as of 11:22, 17 November 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,083 edits Saving copy of the {{drugbox}} taken from revid 456887022 of page Ertapenem for the Chem/Drugbox validation project (updated: 'KEGG').← Previous edit |
Revision as of 11:25, 17 November 2011 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,083 edits Saving copy of the {{drugbox}} taken from revid 447905159 of page Esketamine for the Chem/Drugbox validation project (updated: 'ChEMBL', 'CAS_number').Next edit → |
Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{drugbox |
|
{{Drugbox |
|
⚫ |
| verifiedrevid = 443835182 |
|
| Verifiedfields = changed |
|
|
|
| IUPAC_name = (''S'')-2-(2-chlorophenyl)-2-(methylamino)cyclohexanone |
⚫ |
| verifiedrevid = 443733636 |
|
|
|
| image = S-ketamine-2D-skeletal.png |
|
| IUPAC_name = (4''R'',5''S'',6''S'')-3-<br>pyrrolidin-3-yl]sulfanyl-6-(1-hydroxyethyl)-4-methyl-7-<br>oxo-1-azabicyclohept-2-ene-2-carboxylic acid |
|
|
| image = Ertapenem.svg |
|
| width = 180 |
|
|
| image2 = S-ketamine-3D-balls.png |
|
|
| drug_name = Ketamine |
|
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
|
| tradename = Invanz |
|
| tradename = |
|
| Drugs.com = {{drugs.com|monograph|invanz}} |
|
| Drugs.com = {{drugs.com|CDI|ketamine}} |
|
| pregnancy_AU = B3 |
|
|
| pregnancy_US = B |
|
|
| legal_status = Rx-only |
|
|
| routes_of_administration = Intramuscular, ] |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
|
| bioavailability = 90% (]) |
|
|
| protein_bound = Inversely proportional to concentration; 85 to 95% |
|
|
| metabolism = Minor ] of ] ring, ] not involved |
|
|
| elimination_half-life = 4 hours |
|
|
| excretion = ] (80%) and fecal (10%) |
|
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
⚫ |
| CAS_number = <!-- blanked - oldvalue: 33643-46-8 --> |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
|
|
| ATC_prefix = N01 |
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
|
|
| ATC_suffix = AX14 |
|
| CAS_number = 153832-46-3 |
|
|
| ATC_prefix = J01 |
|
| ChEMBL = 742 |
|
| ATC_suffix = DH03 |
|
| PubChem = 182137 |
|
⚫ |
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| PubChem = 150610 |
|
|
⚫ |
| DrugBank = DB01221 |
⚫ |
| DrugBank_Ref = {{drugbankcite|changed|drugbank}} |
|
⚫ |
| DrugBank = DB00303 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 132758 |
|
| ChemSpiderID = 3689 |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = G32F6EID2H |
|
| UNII = 50LFG02TXD |
|
| KEGG_Ref = {{keggcite|changed|kegg}} |
|
⚫ |
| KEGG = <!-- blanked - oldvalue: D04049 --> |
|
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
| ChEBI = 404903 |
|
| ChEBI = 6121 |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
|
| ChEMBL = 1359 |
|
|
|
|
|
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| C=22 | H=25 | N=3 | O=7 | S=1 |
|
| C=13 | H=16 | Cl=1 | N=1 | O=1 |
|
| molecular_weight = 475.516 g/mol |
|
| molecular_weight = 237.725 g/mol |
|
|
| smiles = CNC1(CCCCC1=O)c2ccccc2Cl |
|
| smiles = O=C(O)c1cc(ccc1)NC(=O)4NC(S\C3=C(\N2C(=O)((O)C)23C)C(=O)O)C4 |
|
|
| InChI = 1/C22H25N3O7S/c1-9-16-15(10(2)26)20(28)25(16)17(22(31)32)18(9)33-13-7-14(23-8-13)19(27)24-12-5-3-4-11(6-12)21(29)30/h3-6,9-10,13-16,23,26H,7-8H2,1-2H3,(H,24,27)(H,29,30)(H,31,32)/t9-,10-,13+,14+,15-,16-/m1/s1 |
|
| InChI = 1/C13H16ClNO/c1-15-13(9-5-4-8-12(13)16)10-6-2-3-7-11(10)14/h2-3,6-7,15H,4-5,8-9H2,1H3 |
|
|
| InChIKey = YQEZLKZALYSWHR-UHFFFAOYAB |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C22H25N3O7S/c1-9-16-15(10(2)26)20(28)25(16)17(22(31)32)18(9)33-13-7-14(23-8-13)19(27)24-12-5-3-4-11(6-12)21(29)30/h3-6,9-10,13-16,23,26H,7-8H2,1-2H3,(H,24,27)(H,29,30)(H,31,32)/t9-,10-,13+,14+,15-,16-/m1/s1 |
|
| StdInChI = 1S/C13H16ClNO/c1-15-13(9-5-4-8-12(13)16)10-6-2-3-7-11(10)14/h2-3,6-7,15H,4-5,8-9H2,1H3 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = JUZNIMUFDBIJCM-ANEDZVCMSA-N |
|
| StdInChIKey = YQEZLKZALYSWHR-UHFFFAOYSA-N |
|
}} |
|
}} |