Revision as of 11:55, 17 November 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 460556160 of page Etorphine for the Chem/Drugbox validation project (updated: 'ChEMBL', 'CAS_number').← Previous edit |
Revision as of 11:56, 17 November 2011 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 456520109 of page Etoxadrol for the Chem/Drugbox validation project (updated: 'CAS_number').Next edit → |
Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{Drugbox |
|
{{Drugbox |
|
| Verifiedfields = changed |
|
| Verifiedfields = changed |
|
| verifiedrevid = 399925974 |
|
| verifiedrevid = 399926099 |
|
| IUPAC_name = 6,14-endoetheno â 7 a (1-(R)-hydroxy-1 methylbutyl)-tetrahydro-nororipavine |
|
| IUPAC_name = (2S)-2-piperidine |
|
| image = Etorphine.png |
|
| image = Etoxadrol.svg |
|
|
| width = 150 |
|
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
|
| tradename = |
|
| tradename = |
|
|
| legal_status = Legal |
|
| Drugs.com = {{drugs.com|international|etorphine}} |
|
|
|
| routes_of_administration = |
|
| legal_status = List 1 (])<br>Schedule I/II (see text) (]) |
|
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
|
| metabolism = |
|
|
| elimination_half-life = |
|
|
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number = <!-- blanked - oldvalue: 14521-96-1 --> |
|
| CAS_number = <!-- blanked - oldvalue: 28189-85-7 --> |
|
| ATCvet = yes |
|
| ATC_prefix = none |
|
| ATC_prefix = N02 |
|
| PubChem = 19324 |
|
| ATC_suffix = AE90 |
|
|
| PubChem = 644209 |
|
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank = DB01497 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 559231 |
|
| ChemSpiderID = 16735807 |
|
| UNII_Ref = {{fdacite|changed|FDA}} |
|
| UNII_Ref = {{fdacite|changed|FDA}} |
|
| UNII = 42M2Y6NU9O |
|
| UNII = SIQ2UWR01K |
|
| KEGG_Ref = {{keggcite|changed|kegg}} |
|
|
| KEGG = D07937 |
|
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
| ChEMBL = <!-- blanked - oldvalue: 287413 --> |
|
| ChEMBL = 305904 |
|
|
|
⚫ |
| C=25 | H=33 | N=1 | O=4 |
|
|
|
<!--Chemical data--> |
⚫ |
| molecular_weight = 411.53 g/mol |
|
|
⚫ |
| C=16 | H=23 | N=1 | O=2 |
|
| smiles = O(C)(CCC)6C53\C=C/6(OC)4Oc1c2c(ccc1O)C5N(CC234)C |
|
|
⚫ |
| molecular_weight = 261.36 g/mol |
|
| InChI = 1/C25H33NO4/c1-5-8-22(2,28)17-14-23-9-10-25(17,29-4)21-24(23)11-12-26(3)18(23)13-15-6-7-16(27)20(30-21)19(15)24/h6-7,9-10,17-18,21,27-28H,5,8,11-14H2,1-4H3/t17-,18-,21-,22-,23-,24+,25-/m1/s1 |
|
|
|
| smiles = CC1(OC(O1)2NCCCC2)c3ccccc3 |
|
| InChIKey = CAHCBJPUTCKATP-FAWZKKEFBM |
|
|
|
| InChI = 1/C16H23NO2/c1-2-16(13-8-4-3-5-9-13)18-12-15(19-16)14-10-6-7-11-17-14/h3-5,8-9,14-15,17H,2,6-7,10-12H2,1H3/t14-,15+,16-/m0/s1 |
|
|
| InChIKey = INOYCBNLWYEPSB-XHSDSOJGBE |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C25H33NO4/c1-5-8-22(2,28)17-14-23-9-10-25(17,29-4)21-24(23)11-12-26(3)18(23)13-15-6-7-16(27)20(30-21)19(15)24/h6-7,9-10,17-18,21,27-28H,5,8,11-14H2,1-4H3/t17-,18-,21-,22-,23-,24+,25-/m1/s1 |
|
| StdInChI = 1S/C16H23NO2/c1-2-16(13-8-4-3-5-9-13)18-12-15(19-16)14-10-6-7-11-17-14/h3-5,8-9,14-15,17H,2,6-7,10-12H2,1H3/t14-,15+,16-/m0/s1 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = CAHCBJPUTCKATP-FAWZKKEFSA-N |
|
| StdInChIKey = INOYCBNLWYEPSB-XHSDSOJGSA-N |
|
}} |
|
}} |