Revision as of 11:57, 17 November 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 456698198 of page Etretinate for the Chem/Drugbox validation project (updated: 'DrugBank', 'CAS_number').← Previous edit |
Revision as of 12:00, 17 November 2011 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 447430724 of page Exemestane for the Chem/Drugbox validation project (updated: 'DrugBank').Next edit → |
Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{Drugbox |
|
{{Drugbox |
|
⚫ |
| verifiedrevid = 442628655 |
|
| Verifiedfields = changed |
|
|
|
| IUPAC_name = 6-methylideneandrosta-1,4-diene-3,17-dione<ref>[http://www.ebi.ac.uk/chebi/searchId.do?chebiId=4953 ChEBI_Ref = {{ebicite|correct|EBI}} |
⚫ |
| verifiedrevid = 399926532 |
|
|
|
| ChEBI exemestane (CHEBI:4953)]</ref> |
|
| IUPAC_name = ethyl 9-(4-methoxy-2,3,6-trimethyl-phenyl)- 3,7-dimethyl-nona- 2,4,6,8-tetraenoate |
|
|
| image = Etretinate.svg |
|
| image = Exemestane.svg |
|
|
| image2 = Exemestano.png |
|
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
|
| tradename = |
|
| tradename = Aromasin |
|
| Drugs.com = {{drugs.com|CONS|etretinate}} |
|
| Drugs.com = {{drugs.com|monograph|exemestane}} |
|
| MedlinePlus = a601010 |
|
| MedlinePlus = a607006 |
|
| pregnancy_category = |
|
| pregnancy_category = D |
|
| legal_status = |
|
| legal_status = Rx only |
|
| routes_of_administration = Oral |
|
| routes_of_administration = Oral |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
<!--Pharmacokinetic data--> |
|
| bioavailability = |
|
| bioavailability = ~60% |
|
| protein_bound = |
|
| protein_bound = 90% |
|
⚫ |
| elimination_half-life = 27 hours |
|
| metabolism = |
|
⚫ |
| elimination_half-life = 120 days |
|
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CAS_number = <!-- blanked - oldvalue: 54350-48-0 --> |
|
| CAS_number = 107868-30-4 |
|
| ATC_prefix = D05 |
|
| ATC_prefix = L02 |
|
| ATC_suffix = BB01 |
|
| ATC_suffix = BG06 |
|
⚫ |
| PubChem = 60198 |
|
| ATC_supplemental = |
|
⚫ |
| PubChem = 5282375 |
|
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank = DB00926 |
|
| DrugBank = DB00990 |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 4445538 |
|
| ChemSpiderID = 54278 |
|
| UNII_Ref = {{fdacite|changed|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = 65M2UDR9AG |
|
| UNII = NY22HMQ4BX |
|
| KEGG_Ref = {{keggcite|changed|kegg}} |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG = D00316 |
|
| KEGG = D00963 |
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEBI = 4913 |
|
| ChEMBL = 1200374 |
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEMBL = 464 |
|
|
|
|
|
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| C=23 | H=30 | O=3 |
|
| C=20 | H=24 | O=2 |
|
| molecular_weight = 354.483 g/mol |
|
| molecular_weight = 296.403 g/mol |
|
| smiles = O=C(OCC)\C=C(\C=C\C=C(\C=C\c1c(cc(OC)c(c1C)C)C)C)C |
|
| smiles = O=C\1\C=C/3(C(=C/1)/C(=C)C42CCC(=O)2(CC34)C)C |
|
| InChI = 1/C23H30O3/c1-8-26-23(24)14-17(3)11-9-10-16(2)12-13-21-18(4)15-22(25-7)20(6)19(21)5/h9-15H,8H2,1-7H3/b11-9+,13-12+,16-10+,17-14+ |
|
| InChI = 1/C20H24O2/c1-12-10-14-15-4-5-18(22)20(15,3)9-7-16(14)19(2)8-6-13(21)11-17(12)19/h6,8,11,14-16H,1,4-5,7,9-10H2,2-3H3/t14-,15-,16-,19+,20-/m0/s1 |
|
| InChIKey = HQMNCQVAMBCHCO-DJRRULDNBE |
|
| InChIKey = BFYIZQONLCFLEV-DAELLWKTBA |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C23H30O3/c1-8-26-23(24)14-17(3)11-9-10-16(2)12-13-21-18(4)15-22(25-7)20(6)19(21)5/h9-15H,8H2,1-7H3/b11-9+,13-12+,16-10+,17-14+ |
|
| StdInChI = 1S/C20H24O2/c1-12-10-14-15-4-5-18(22)20(15,3)9-7-16(14)19(2)8-6-13(21)11-17(12)19/h6,8,11,14-16H,1,4-5,7,9-10H2,2-3H3/t14-,15-,16-,19+,20-/m0/s1 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = HQMNCQVAMBCHCO-DJRRULDNSA-N |
|
| StdInChIKey = BFYIZQONLCFLEV-DAELLWKTSA-N |
|
}} |
|
}} |