Misplaced Pages

:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions - Misplaced Pages

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
< Misplaced Pages:WikiProject Chemicals | Chembox validation Browse history interactively← Previous editNext edit →Content deleted Content addedVisualWikitext
Revision as of 12:34, 17 November 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 457237104 of page Fluocortolone for the Chem/Drugbox validation project (updated: 'CAS_number').← Previous edit Revision as of 12:35, 17 November 2011 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 455678407 of page Fluoranthene for the Chem/Drugbox validation project (updated: 'KEGG').Next edit →
Line 1: Line 1:
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} {{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}}
{{Drugbox {{chembox
| Verifiedfields = changed | Verifiedfields = changed
| verifiedrevid = 400093885 | verifiedrevid = 415490157
| Name = Fluoranthene
| IUPAC_name = (1''S'',2''R'',8''S'',10''S'',11''S'',13''R'',14''S'',15''S'',17''S'')-8-fluoro-17-hydroxy-14-(2-hydroxyacetyl)-2,13,15-trimethyltetracycloheptadeca-3,6-dien-5-one
| ImageFile1_Ref = {{chemboximage|correct|??}}
| image = Fluocortolone skeletal.svg
| ImageFile1 = Fluoranthene.svg

| ImageSize1 = 154px
<!--Clinical data-->
| ImageName1 = Chemical structure of fluoranthene
| tradename =
| ImageFile2 = Fluoranthene 3D.png
| Drugs.com = {{drugs.com|international|fluocortolone}}
| ImageSize2 = 150px
| pregnancy_category =
| ImageName2 = Ball-and-stick model of fluoranthene
| legal_status =
| IUPACName = Fluoranthene
| routes_of_administration =
| OtherNames = Benzo(j, k)fluorene

| Section1 = {{Chembox Identifiers
<!--Pharmacokinetic data-->
⚫ | UNII_Ref = {{fdacite|changed|FDA}}
| bioavailability =
⚫ | UNII = 360UOL779Z
| metabolism =
⚫ | ChEBI_Ref = {{ebicite|changed|EBI}}
| excretion =
| ChEBI = 33083

| SMILES = c1ccc-2c(c1)-c3cccc4c3c2ccc4
<!--Identifiers-->
| CAS_number_Ref = {{cascite|correct|??}} | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
⚫ | ChemSpiderID = 8800
⚫ | CAS_number = <!-- blanked - oldvalue: 152-97-6 -->
| InChI = 1/C16H10/c1-2-8-13-12(7-1)14-9-3-5-11-6-4-10-15(13)16(11)14/h1-10H
| ATC_prefix = C05
| InChIKey = GVEPBJHOBDJJJI-UHFFFAOYAL
| ATC_suffix = AA08
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ATC_supplemental = {{ATC|D07|AC05}} {{ATC|H02|AB03}}
| PubChem = 9053 | ChEMBL = 355014
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
⚫ | ChemSpiderID = 8701
⚫ | UNII_Ref = {{fdacite|changed|FDA}}
⚫ | UNII = 65VXC1MH0J
⚫ | KEGG_Ref = {{keggcite|changed|kegg}}
| KEGG = D04218
⚫ | ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 251634

<!--Chemical data-->
| C=22 | H=29 | F=1 | O=4
| molecular_weight = 376.462 g/mol
| smiles = O=C\1\C=C/4(/C(=C/1)(F)C24(O)C3((C(=O)CO)(C23)C)C)C
| InChI = 1/C22H29FO4/c1-11-6-14-13-8-16(23)15-7-12(25)4-5-21(15,2)20(13)17(26)9-22(14,3)19(11)18(27)10-24/h4-5,7,11,13-14,16-17,19-20,24,26H,6,8-10H2,1-3H3/t11-,13+,14+,16+,17+,19-,20-,21+,22+/m1/s1
| InChIKey = GAKMQHDJQHZUTJ-ULHLPKEOBR
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C22H29FO4/c1-11-6-14-13-8-16(23)15-7-12(25)4-5-21(15,2)20(13)17(26)9-22(14,3)19(11)18(27)10-24/h4-5,7,11,13-14,16-17,19-20,24,26H,6,8-10H2,1-3H3/t11-,13+,14+,16+,17+,19-,20-,21+,22+/m1/s1 | StdInChI = 1S/C16H10/c1-2-8-13-12(7-1)14-9-3-5-11-6-4-10-15(13)16(11)14/h1-10H
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = GAKMQHDJQHZUTJ-ULHLPKEOSA-N | StdInChIKey = GVEPBJHOBDJJJI-UHFFFAOYSA-N
| CASNo_Ref = {{cascite|correct|CAS}}
| synonyms = <small>(6''S'',8''S'',9''R'',10''S'',11''S'',13''S'',14''S'',16''R'',17''S'')-6-fluoro-11-hydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopentaphenanthren-3-one</small>
| CASNo = 206-44-0
| RTECS =
⚫ | KEGG_Ref = {{keggcite|changed|kegg}}
⚫ | KEGG = <!-- blanked - oldvalue: C19425 -->
}}
| Section2 = {{Chembox Properties
| Formula = C<sub>16</sub>H<sub>10</sub>
| MolarMass = 202.26 g/mol
| Appearance = Yellow to green needles
| Density = 1.252 g/cm³ (0 °C), solid
| Solubility = 265 μg/l (25 °C)
| MeltingPt = 110.8 °C (384.0 K)
| BoilingPt = 375 °C (648 K)
| Viscosity = 0.652 ] at 20 °C
}}
| Section3 = {{Chembox Structure
| MolShape = Planar
| Dipole = 0.34 ]
}}
| Section7 = {{Chembox Hazards
| ExternalMSDS =
| EUClass =
<!-- | RPhrases = {{R21}}, {{R22}} (editor's note: need to be confirmed)
| SPhrases = {{S22}}, {{S23}}, {{S24}}, {{S25}} (editor's note: need to be confirmed) -->
| FlashPt = 210 °C (483 K)
| Autoignition = ? °C (? K)
}}
| Section8 = {{Chembox Related
| Function = ]s
| OtherFunctn =
| OtherCpds =
}}
}} }}

Revision as of 12:35, 17 November 2011

This page contains a copy of the infobox ({{chembox}}) taken from revid 455678407 of page Fluoranthene with values updated to verified values.
Fluoranthene
Chemical structure of fluoranthene
Ball-and-stick model of fluoranthene
Names
IUPAC name Fluoranthene
Other names Benzo(j, k)fluorene
Identifiers
CAS Number
3D model (JSmol)
ChEBI
ChEMBL
ChemSpider
UNII
InChI
  • InChI=1S/C16H10/c1-2-8-13-12(7-1)14-9-3-5-11-6-4-10-15(13)16(11)14/h1-10HKey: GVEPBJHOBDJJJI-UHFFFAOYSA-N
  • InChI=1/C16H10/c1-2-8-13-12(7-1)14-9-3-5-11-6-4-10-15(13)16(11)14/h1-10HKey: GVEPBJHOBDJJJI-UHFFFAOYAL
SMILES
  • c1ccc-2c(c1)-c3cccc4c3c2ccc4
Properties
Chemical formula C16H10
Molar mass 202.26 g/mol
Appearance Yellow to green needles
Density 1.252 g/cm³ (0 °C), solid
Melting point 110.8 °C (384.0 K)
Boiling point 375 °C (648 K)
Solubility in water 265 μg/l (25 °C)
Viscosity 0.652 cP at 20 °C
Structure
Molecular shape Planar
Dipole moment 0.34 D
Hazards
Flash point 210 °C (483 K)
Related compounds
Except where otherwise noted, data are given for materials in their standard state (at 25 °C , 100 kPa). ☒N verify (what is  ?) Infobox references
Tracking categories (test):
Chemical compound