Revision as of 15:39, 17 November 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 443840294 of page Glycocholic_acid for the Chem/Drugbox validation project (updated: 'ChEMBL').← Previous edit |
Revision as of 15:41, 17 November 2011 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 456836385 of page Glycopyrrolate for the Chem/Drugbox validation project (updated: 'DrugBank', 'ChEMBL').Next edit → |
Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{Drugbox |
|
{{Chembox |
|
|
|
| Verifiedfields = changed |
⚫ |
| verifiedrevid = 443839170 |
|
|
|
| Watchedfields = changed |
|
| Name = Glycocholic acid |
|
|
⚫ |
| verifiedrevid = 402140591 |
|
| ImageFile = Glycocholic acid.png |
|
|
|
| IUPAC_name = 3-(2-cyclopentyl-2-hydroxy-2-phenylacetoxy)-1,1-dimethylpyrrolidinium |
|
| ImageSize = 250px |
|
|
|
| image = Glycopyrrolate.svg |
|
| ImageName = Glycocholic acid |
|
|
|
|
|
| IUPACName = Glycocholic acid |
|
|
|
<!--Clinical data--> |
|
| Section1 = {{Chembox Identifiers |
|
|
| ChEMBL = 411070 |
|
| tradename = |
|
|
| Drugs.com = {{drugs.com|monograph|glycopyrrolate}} |
⚫ |
| PubChem = 10140 |
|
|
|
| MedlinePlus = a602014 |
|
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
|
| pregnancy_category = B |
|
|
| legal_AU = <!-- Unscheduled / S2 / S4 / S8 --> |
|
|
| legal_UK = <!-- GSL / P / POM / CD --> |
|
|
| legal_US = <!-- OTC / Rx-only --> |
|
|
| routes_of_administration = oral, IV |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
|
| elimination_half-life = 0.6–1.2 hours |
|
|
| excretion = 85% renal, unknown amount in the bile |
|
|
|
|
|
<!--Identifiers--> |
|
⚫ |
| CASNo_Ref = {{cascite|correct|CAS}} |
|
⚫ |
| CAS_number_Ref = {{cascite|correct|??}} |
|
|
| CAS_number = 596-51-0 |
|
|
| ATC_prefix = A03 |
|
|
| ATC_suffix = AB02 |
|
⚫ |
| PubChem = 3494 |
|
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
|
| DrugBank = DB00986 |
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
⚫ |
| ChemSpiderID = 11201 |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = G59NX3I3RT |
|
| UNII = V92SO9WP2I |
|
|
| KEGG_Ref = {{keggcite|changed|kegg}} |
|
| InChI = 1/C26H43NO6/c1-14(4-7-22(31)27-13-23(32)33)17-5-6-18-24-19(12-21(30)26(17,18)3)25(2)9-8-16(28)10-15(25)11-20(24)29/h14-21,24,28-30H,4-13H2,1-3H3,(H,27,31)(H,32,33)/t14-,15+,16-,17-,18+,19+,20-,21+,24+,25+,26-/m1/s1 |
|
|
|
| KEGG = D00540 |
|
| InChIKey = RFDAIACWWDREDC-FRVQLJSFBG |
|
|
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEMBL = <!-- blanked - oldvalue: 1201335 --> |
|
|
| C=19 | H=28 | N=1 | O=3 | charge = + |
|
|
| molecular_weight = 318.431 g/mol |
|
|
| smiles = .O=C(OC1CC(C)(C)C1)C(O)(c2ccccc2)C3CCCC3 |
|
|
| InChI = 1/C19H28NO3.BrH/c1-20(2)13-12-17(14-20)23-18(21)19(22,16-10-6-7-11-16)15-8-4-3-5-9-15;/h3-5,8-9,16-17,22H,6-7,10-14H2,1-2H3;1H/q+1;/p-1 |
|
|
| InChIKey = VPNYRYCIDCJBOM-REWHXWOFAY |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C26H43NO6/c1-14(4-7-22(31)27-13-23(32)33)17-5-6-18-24-19(12-21(30)26(17,18)3)25(2)9-8-16(28)10-15(25)11-20(24)29/h14-21,24,28-30H,4-13H2,1-3H3,(H,27,31)(H,32,33)/t14-,15+,16-,17-,18+,19+,20-,21+,24+,25+,26-/m1/s1 |
|
| StdInChI = 1S/C19H28NO3.BrH/c1-20(2)13-12-17(14-20)23-18(21)19(22,16-10-6-7-11-16)15-8-4-3-5-9-15;/h3-5,8-9,16-17,22H,6-7,10-14H2,1-2H3;1H/q+1;/p-1 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = RFDAIACWWDREDC-FRVQLJSFSA-N |
|
| StdInChIKey = VPNYRYCIDCJBOM-UHFFFAOYSA-M |
⚫ |
| CASNo_Ref = {{cascite|correct|CAS}} |
|
|
| CASNo = 475-31-0 |
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
⚫ |
| ChemSpiderID = 9734 |
|
⚫ |
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
|
| ChEBI = 17687 |
|
|
| SMILES = C(CCC(=O)NCC(=O)O)1CC21((C32(C43(CC(C4)O)C)O)O)C |
|
|
}} |
|
|
| Section2 = {{Chembox Properties |
|
|
| Formula = C<sub>26</sub>H<sub>43</sub>NO<sub>6</sub> |
|
|
|
|
|
| MolarMass = 465.631 g/mol |
|
|
| Density = |
|
|
| MeltingPt = 130 °C |
|
|
| BoilingPt = }} |
|
|
}} |
|
}} |