Revision as of 10:11, 21 November 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 461587485 of page Nimetazepam for the Chem/Drugbox validation project (updated: 'DrugBank', 'CAS_number').← Previous edit | Revision as of 10:12, 21 November 2011 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 461587796 of page Bombesin for the Chem/Drugbox validation project (updated: 'ChEMBL', 'CASNo').Next edit → | ||
Line 1: | Line 1: | ||
{{ambox | text = This page contains a copy of the infobox ({{tl| |
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} | ||
{{ |
{{Chembox | ||
⚫ | | verifiedrevid = 461586545 | ||
| Verifiedfields = changed | |||
|ImageFile=Bombesin_full.png | |||
⚫ | | verifiedrevid = |
||
|ImageSize=400px | |||
| IUPAC_name = 2-methyl-9-nitro-6-phenyl-<br>2,5-diazabicycloundeca-5,8,10,12-tetraen-3-one | |||
|IUPACName= | |||
| image = Nimetazepam.svg | |||
|OtherNames= Pyr-Gln-Arg-Leu-Gly-Asn-Gln-Trp-Ala-Val-Gly-His-Leu-Met-NH2 | |||
| width = 150 | |||
|Section1= {{Chembox Identifiers | |||
| image2 = Nimetazepam3d.png | |||
⚫ | | CASNo_Ref = {{cascite|correct|??}} | ||
⚫ | | CASNo = <!-- blanked - oldvalue: 31362-50-2 --> | ||
<!--Clinical data--> | |||
⚫ | | PubChem=16133891 | ||
| tradename = | |||
| Drugs.com = {{drugs.com|international|nimetazepam}} | |||
| pregnancy_category = X | |||
| legal_AU = S9 | |||
| legal_US = Schedule IV | |||
| legal_status = ]<small> (])</small> | |||
| routes_of_administration = Oral | |||
<!--Pharmacokinetic data--> | |||
| bioavailability = 95% | |||
| metabolism = ] | |||
| elimination_half-life = 14-30 hours | |||
| excretion = ] | |||
<!--Identifiers--> | |||
⚫ | | |
||
⚫ | | |
||
| ATC_prefix = N05 | |||
⚫ | | PubChem |
||
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} | |||
| DrugBank = <!-- blanked - oldvalue: ? --> | |||
⚫ | | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ||
⚫ | | ChemSpiderID = |
||
| UNII_Ref = {{fdacite|changed|FDA}} | |||
| UNII = 4532264KW6 | |||
| KEGG_Ref = {{keggcite|correct|kegg}} | |||
| KEGG = D01593 | |||
| ChEMBL_Ref = {{ebicite|correct|EBI}} | | ChEMBL_Ref = {{ebicite|correct|EBI}} | ||
| ChEMBL = |
| ChEMBL = <!-- blanked - oldvalue: 437027 --> | ||
| IUPHAR_ligand = 616 | |||
⚫ | | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ||
<!--Chemical data--> | |||
⚫ | | ChemSpiderID = 26286924 | ||
| C=16 | H=13 | N=3 | O=3 | |||
| SMILES = C(C(=O)N(C(C)C)C(=O)NCC(=O)N(Cc1cnc1)C(=O)N(CC(C)C)C(=O)N(CCSC)C(=O)N)NC(=O)(Cc2cc3ccccc32)NC(=O)(CCC(=O)N)NC(=O)(CC(=O)N)NC(=O)CNC(=O)(CC(C)C)NC(=O)(CCCNC(=N)N)NC(=O)(CCC(=O)N)NC(=O)4CCC(=O)N4 | |||
| molecular_weight = 295.3 | |||
| InChI = 1/C71H110N24O18S/c1-34(2)24-47(92-62(105)43(14-11-22-79-71(76)77)89-64(107)45(15-18-52(72)96)90-63(106)44-17-20-55(99)85-44)61(104)80-31-56(100)87-51(29-54(74)98)69(112)91-46(16-19-53(73)97)65(108)94-50(27-39-26-38-12-9-10-13-41(38)84-39)66(109)83-37(7)60(103)95-58(36(5)6)70(113)81-32-57(101)86-49(28-40-30-78-33-82-40)68(111)93-48(25-35(3)4)67(110)88-42(59(75)102)21-23-114-8/h9-10,12-13,26,30,33-37,42-51,58,84H,11,14-25,27-29,31-32H2,1-8H3,(H2,72,96)(H2,73,97)(H2,74,98)(H2,75,102)(H,78,82)(H,80,104)(H,81,113)(H,83,109)(H,85,99)(H,86,101)(H,87,100)(H,88,110)(H,89,107)(H,90,106)(H,91,112)(H,92,105)(H,93,111)(H,94,108)(H,95,103)(H4,76,77,79)/t37-,42-,43-,44-,45-,46-,47-,48-,49-,50-,51-,58-/m0/s1 | |||
| smiles = (=O)c3cc\1c(N(C(=O)C/N=C/1c2ccccc2)C)cc3 | |||
| InChIKey = DNDCVAGJPBKION-DOPDSADYBW | |||
| InChI = 1/C16H13N3O3/c1-18-14-8-7-12(19(21)22)9-13(14)16(17-10-15(18)20)11-5-3-2-4-6-11/h2-9H,10H2,1H3 | |||
⚫ | | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | ||
| InChIKey = GWUSZQUVEVMBPI-UHFFFAOYAS | |||
| StdInChI = 1S/C71H110N24O18S/c1-34(2)24-47(92-62(105)43(14-11-22-79-71(76)77)89-64(107)45(15-18-52(72)96)90-63(106)44-17-20-55(99)85-44)61(104)80-31-56(100)87-51(29-54(74)98)69(112)91-46(16-19-53(73)97)65(108)94-50(27-39-26-38-12-9-10-13-41(38)84-39)66(109)83-37(7)60(103)95-58(36(5)6)70(113)81-32-57(101)86-49(28-40-30-78-33-82-40)68(111)93-48(25-35(3)4)67(110)88-42(59(75)102)21-23-114-8/h9-10,12-13,26,30,33-37,42-51,58,84H,11,14-25,27-29,31-32H2,1-8H3,(H2,72,96)(H2,73,97)(H2,74,98)(H2,75,102)(H,78,82)(H,80,104)(H,81,113)(H,83,109)(H,85,99)(H,86,101)(H,87,100)(H,88,110)(H,89,107)(H,90,106)(H,91,112)(H,92,105)(H,93,111)(H,94,108)(H,95,103)(H4,76,77,79)/t37-,42-,43-,44-,45-,46-,47-,48-,49-,50-,51-,58-/m0/s1 | |||
⚫ | | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | ||
⚫ | | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | ||
| StdInChI = 1S/C16H13N3O3/c1-18-14-8-7-12(19(21)22)9-13(14)16(17-10-15(18)20)11-5-3-2-4-6-11/h2-9H,10H2,1H3 | |||
⚫ | | StdInChIKey = DNDCVAGJPBKION-DOPDSADYSA-N | ||
⚫ | | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | ||
}} | |||
⚫ | | StdInChIKey = |
||
|Section2= {{Chembox Properties | |||
| Formula=C<sub>71</sub>H<sub>110</sub>N<sub>24</sub>O<sub>18</sub>S | |||
| MolarMass=1619.85 | |||
| Appearance= | |||
| Density= | |||
| MeltingPt= | |||
| BoilingPt= | |||
| Solubility= | |||
}} | |||
|Section3= {{Chembox Hazards | |||
| MainHazards= | |||
| FlashPt= | |||
| Autoignition= | |||
}} | |||
}} | }} |
Revision as of 10:12, 21 November 2011
This page contains a copy of the infobox ({{chembox}}) taken from revid 461587796 of page Bombesin with values updated to verified values. |
File:Bombesin full.png | |
Names | |
---|---|
Other names Pyr-Gln-Arg-Leu-Gly-Asn-Gln-Trp-Ala-Val-Gly-His-Leu-Met-NH2 | |
Identifiers | |
3D model (JSmol) | |
ChemSpider | |
IUPHAR/BPS | |
PubChem CID | |
InChI
| |
SMILES
| |
Properties | |
Chemical formula | C71H110N24O18S |
Molar mass | 1619.85 |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C , 100 kPa). Y verify (what is ?) Infobox references |
Chemical compound