Revision as of 12:57, 21 November 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,084 edits Saving copy of the {{drugbox}} taken from revid 461740223 of page Vincristine for the Chem/Drugbox validation project (updated: 'DrugBank', 'ChEMBL', 'StdInChI').← Previous edit |
Revision as of 13:51, 21 November 2011 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,084 edits Saving copy of the {{chembox}} taken from revid 449554015 of page Gyrophoric_acid for the Chem/Drugbox validation project (updated: 'ChEMBL', 'CASNo').Next edit → |
Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{Drugbox |
|
{{chembox |
|
⚫ |
| verifiedrevid = 439364730 |
|
| Verifiedfields = changed |
|
|
|
| Name = Gyrophoric acid |
|
| Watchedfields = changed |
|
|
|
| ImageFile = Gyrophoric acid.PNG |
⚫ |
| verifiedrevid = 402875265 |
|
|
|
| ImageSize = 200px |
|
| IUPAC_name = methyl (1''R'',9''R'',10''S'',11''R'',12''R'',19''R'')- 11-(acetyloxy) |
|
|
|
| ImageName = Chemical structure of gyrophoric acid |
|
| image = Vincristine.svg |
|
|
|
| ImageAlt = Chemical structure of gyrophoric acid |
|
|
|
|
|
| IUPACName = 4-oxy-2-hydroxy-6-methylbenzoic acid |
|
<!--Clinical data--> |
|
|
| tradename = |
|
| OtherNames = <!-- <br> --> |
|
|
|Section1= {{Chembox Identifiers |
|
| Drugs.com = {{drugs.com|monograph|vincristine-sulfate}} |
|
|
⚫ |
| CASNo = <!-- blanked - oldvalue: 548-89-0 --> |
|
| MedlinePlus = a682822 |
|
|
| pregnancy_AU = D |
|
| CASNo_Ref = |
|
| pregnancy_US = D |
|
| CASOther = |
|
| legal_status = Rx-only |
|
| ChEMBL = 470648 |
|
⚫ |
| PubChem = 135728 |
|
| routes_of_administration = '''Exclusively''' ] |
|
|
|
| ChEMBL = 470648 |
|
|
|
|
|
| PubChem = 135728 |
|
<!--Pharmacokinetic data--> |
|
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| bioavailability = n/a |
|
|
| protein_bound = ~75% |
|
| ChemSpiderID = 119550 |
|
|
| SMILES = O=C(Oc1cc(c(C(=O)O)c(O)c1)C)c3c(cc(OC(=O)c2c(cc(O)cc2O)C)cc3O)C |
|
| metabolism = ] |
|
|
⚫ |
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| elimination_half-life = 19 to 155 hours |
|
|
|
| StdInChI=1S/C24H20O10/c1-10-4-13(25)7-16(26)20(10)23(31)34-15-6-12(3)21(18(28)9-15)24(32)33-14-5-11(2)19(22(29)30)17(27)8-14/h4-9,25-28H,1-3H3,(H,29,30) |
|
| excretion = Mostly biliary, 10% in urine |
|
|
|
|
|
<!--Identifiers--> |
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
|
| CAS_number = 57-22-7 |
|
|
| ATC_prefix = L01 |
|
|
| ATC_suffix = CA02 |
|
|
| ATC_supplemental = |
|
⚫ |
| PubChem = 5978 |
|
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
|
| DrugBank = DB00541 |
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
| ChemSpiderID = 5758 |
|
|
| UNII_Ref = {{fdacite|changed|FDA}} |
|
|
| UNII = 5J49Q6B70F |
|
|
| KEGG_Ref = {{keggcite|changed|kegg}} |
|
|
| KEGG = D08679 |
|
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEBI = 28445 |
|
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
⚫ |
| ChEMBL = <!-- blanked - oldvalue: 303560 --> |
|
|
| C=46 | H=56 | N=4 | O=10 |
|
|
| molecular_weight = 824.958 g/mol |
|
|
| smiles = O=C(OC)4(c2c(c1ccccc1n2)CCN3C(O)(CC)C(C3)C4)c5c(OC)cc6c(c5)89(N6C=O)(O)(C(=O)OC)(OC(=O)C)7(/C=C\CN(78)CC9)CC |
|
|
| InChI = 1/C46H56N4O10/c1-7-42(55)22-28-23-45(40(53)58-5,36-30(14-18-48(24-28) |
|
|
| InChIKey = OGWKCGZFUXNPDA-XQKSVPLYBW |
|
⚫ |
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C46H56N4O10/c1-7-42(55)22-28-23-45(40(53)58-5,36-30(14-18-48(24-28)25-42)29-12-9-10-13-33(29)47-36)32-20-31-34(21-35(32)57-4)50(26-51)38-44(31)16-19-49-17-11-15-43(8-2,37(44)49)39(60-27(3)52)46(38,56)41(54)59-6/h9-13,15,20-21,26,28,37-39,47,55-56H,7-8,14,16-19,22-25H2,1-6H3/t28-,37+,38-,39-,42+,43-,44-,45+,46+/m1/s1 |
|
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = OGWKCGZFUXNPDA-XQKSVPLYSA-N |
|
| StdInChIKey = ATQPZSQVWCPVGV-UHFFFAOYSA-N |
|
|
| MeSHName = |
|
|
}} |
|
|
|Section2= {{Chembox Properties |
|
|
| Formula = C<sub>24</sub>H<sub>20</sub>O<sub>10</sub> |
|
|
| MolarMass = 468.40 g/mol |
|
|
| ExactMass = 468.105647 u |
|
|
| Appearance = |
|
|
| Density = |
|
|
| MeltingPt = <!-- °C --> |
|
|
| BoilingPt = <!-- °C --> |
|
|
| Solubility = |
|
|
}} |
|
}} |
|
}} |