Misplaced Pages

:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions - Misplaced Pages

Article snapshot taken from[REDACTED] with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
< Misplaced Pages:WikiProject Chemicals | Chembox validation Browse history interactively← Previous editNext edit →Content deleted Content addedVisualWikitext
Revision as of 12:57, 21 November 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,084 edits Saving copy of the {{drugbox}} taken from revid 461740223 of page Vincristine for the Chem/Drugbox validation project (updated: 'DrugBank', 'ChEMBL', 'StdInChI').← Previous edit Revision as of 13:51, 21 November 2011 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,084 edits Saving copy of the {{chembox}} taken from revid 449554015 of page Gyrophoric_acid for the Chem/Drugbox validation project (updated: 'ChEMBL', 'CASNo').Next edit →
Line 1: Line 1:
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} {{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}}
{{Drugbox {{chembox
| verifiedrevid = 439364730
| Verifiedfields = changed
| Name = Gyrophoric acid
| Watchedfields = changed
| ImageFile = Gyrophoric acid.PNG
| verifiedrevid = 402875265
| ImageSize = 200px
| IUPAC_name = methyl (1''R'',9''R'',10''S'',11''R'',12''R'',19''R'')- 11-(acetyloxy)
| ImageName = Chemical structure of gyrophoric acid
| image = Vincristine.svg
| ImageAlt = Chemical structure of gyrophoric acid

| IUPACName = 4-oxy-2-hydroxy-6-methylbenzoic acid
<!--Clinical data-->
| tradename = | OtherNames = <!-- <br> -->
|Section1= {{Chembox Identifiers
| Drugs.com = {{drugs.com|monograph|vincristine-sulfate}}
| CASNo = <!-- blanked - oldvalue: 548-89-0 -->
| MedlinePlus = a682822
| pregnancy_AU = D | CASNo_Ref =
| pregnancy_US = D | CASOther =
| legal_status = Rx-only | ChEMBL = 470648
| PubChem = 135728
| routes_of_administration = '''Exclusively''' ]
| ChEMBL = 470648

| PubChem = 135728
<!--Pharmacokinetic data-->
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| bioavailability = n/a
| protein_bound = ~75% | ChemSpiderID = 119550
| SMILES = O=C(Oc1cc(c(C(=O)O)c(O)c1)C)c3c(cc(OC(=O)c2c(cc(O)cc2O)C)cc3O)C
| metabolism = ]
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| elimination_half-life = 19 to 155 hours
| StdInChI=1S/C24H20O10/c1-10-4-13(25)7-16(26)20(10)23(31)34-15-6-12(3)21(18(28)9-15)24(32)33-14-5-11(2)19(22(29)30)17(27)8-14/h4-9,25-28H,1-3H3,(H,29,30)
| excretion = Mostly biliary, 10% in urine

<!--Identifiers-->
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 57-22-7
| ATC_prefix = L01
| ATC_suffix = CA02
| ATC_supplemental =
| PubChem = 5978
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB00541
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 5758
| UNII_Ref = {{fdacite|changed|FDA}}
| UNII = 5J49Q6B70F
| KEGG_Ref = {{keggcite|changed|kegg}}
| KEGG = D08679
| ChEBI_Ref = {{ebicite|changed|EBI}}
| ChEBI = 28445
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = <!-- blanked - oldvalue: 303560 -->
| C=46 | H=56 | N=4 | O=10
| molecular_weight = 824.958 g/mol
| smiles = O=C(OC)4(c2c(c1ccccc1n2)CCN3C(O)(CC)C(C3)C4)c5c(OC)cc6c(c5)89(N6C=O)(O)(C(=O)OC)(OC(=O)C)7(/C=C\CN(78)CC9)CC
| InChI = 1/C46H56N4O10/c1-7-42(55)22-28-23-45(40(53)58-5,36-30(14-18-48(24-28)
| InChIKey = OGWKCGZFUXNPDA-XQKSVPLYBW
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI = 1S/C46H56N4O10/c1-7-42(55)22-28-23-45(40(53)58-5,36-30(14-18-48(24-28)25-42)29-12-9-10-13-33(29)47-36)32-20-31-34(21-35(32)57-4)50(26-51)38-44(31)16-19-49-17-11-15-43(8-2,37(44)49)39(60-27(3)52)46(38,56)41(54)59-6/h9-13,15,20-21,26,28,37-39,47,55-56H,7-8,14,16-19,22-25H2,1-6H3/t28-,37+,38-,39-,42+,43-,44-,45+,46+/m1/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = OGWKCGZFUXNPDA-XQKSVPLYSA-N | StdInChIKey = ATQPZSQVWCPVGV-UHFFFAOYSA-N
| MeSHName =
}}
|Section2= {{Chembox Properties
| Formula = C<sub>24</sub>H<sub>20</sub>O<sub>10</sub>
| MolarMass = 468.40 g/mol
| ExactMass = 468.105647 u
| Appearance =
| Density =
| MeltingPt = <!-- °C -->
| BoilingPt = <!-- °C -->
| Solubility =
}}
}} }}

Revision as of 13:51, 21 November 2011

This page contains a copy of the infobox ({{chembox}}) taken from revid 449554015 of page Gyrophoric_acid with values updated to verified values.
Gyrophoric acid
Chemical structure of gyrophoric acid
Chemical structure of gyrophoric acid
Names
IUPAC name 4-oxy-2-hydroxy-6-methylbenzoic acid
Identifiers
3D model (JSmol)
ChEMBL
ChemSpider
PubChem CID
InChI
  • InChI=1S/C24H20O10/c1-10-4-13(25)7-16(26)20(10)23(31)34-15-6-12(3)21(18(28)9-15)24(32)33-14-5-11(2)19(22(29)30)17(27)8-14/h4-9,25-28H,1-3H3,(H,29,30)Key: ATQPZSQVWCPVGV-UHFFFAOYSA-N
SMILES
  • O=C(Oc1cc(c(C(=O)O)c(O)c1)C)c3c(cc(OC(=O)c2c(cc(O)cc2O)C)cc3O)C
Properties
Chemical formula C24H20O10
Molar mass 468.40 g/mol
Except where otherwise noted, data are given for materials in their standard state (at 25 °C , 100 kPa). checkverify (what is  ?) Infobox references
Tracking categories (test):
Chemical compound
Misplaced Pages:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions Add topic