Misplaced Pages

:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions - Misplaced Pages

Article snapshot taken from[REDACTED] with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
< Misplaced Pages:WikiProject Chemicals | Chembox validation Browse history interactively← Previous editNext edit →Content deleted Content addedVisualWikitext
Revision as of 15:32, 21 November 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,084 edits Saving copy of the {{drugbox}} taken from revid 456603366 of page Iofendylate for the Chem/Drugbox validation project (updated: 'ChEMBL').← Previous edit Revision as of 15:32, 21 November 2011 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,084 edits Saving copy of the {{drugbox}} taken from revid 456800055 of page Iohexol for the Chem/Drugbox validation project (updated: 'ChEMBL').Next edit →
Line 1: Line 1:
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} {{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}}
{{Drugbox {{Drugbox
| Verifiedfields = changed | Verifiedfields = changed
| Watchedfields = changed | Watchedfields = changed
| verifiedrevid = 396496109 | verifiedrevid = 407429797
| IUPAC_name = 1-''N'',3-''N''-bis(2,3-dihydroxypropyl)-5--2,4,6-triiodobenzene-1,3-dicarboxamide
| IUPAC_name = ethyl 10-(4-iodophenyl)undecanoate
| image = Iofendylate.png | image = Iohexol.svg
| drug_name = Iophendylate


<!--Clinical data--> <!--Clinical data-->
| tradename = | tradename =
| Drugs.com = {{drugs.com|CONS|iohexol}}
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> | pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_US = <!-- A / B / C / D / X --> | pregnancy_US = B
⚫ | legal_status = Rx-only
| pregnancy_category =
| routes_of_administration = ], ], oral, intracavital
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C -->
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
⚫ | legal_status =
| routes_of_administration =


<!--Pharmacokinetic data--> <!--Pharmacokinetic data-->
| bioavailability = | bioavailability =
| protein_bound = | protein_bound = Low
| metabolism = | metabolism = Nil
| elimination_half-life = | elimination_half-life = Variable
| excretion = | excretion = ], unchanged


<!--Identifiers--> <!--Identifiers-->
| CASNo_Ref = {{cascite|correct|CAS}} | CASNo_Ref = {{cascite|correct|CAS}}
| CAS_number_Ref = {{cascite|correct|??}} | CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 99-79-6 | CAS_number = 66108-95-0
| ATC_prefix = V08 | ATC_prefix = V08
| ATC_suffix = AD04 | ATC_suffix = AB02
| PubChem = 7458 | PubChem = 3730
| DrugBank_Ref = {{drugbankcite|changed|drugbank}} | DrugBank_Ref = {{drugbankcite|changed|drugbank}}
| DrugBank = DB01187 | DrugBank = DB01362
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 2301035 | ChemSpiderID = 3599
| UNII_Ref = {{fdacite|changed|FDA}} | UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 2990I809YH | UNII = 4419T9MX03
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D01817
| ChEBI_Ref = {{ebicite|changed|EBI}}
| ChEBI = 31709
| ChEMBL_Ref = {{ebicite|changed|EBI}} | ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = <!-- blanked - oldvalue: 951 --> | ChEMBL = <!-- blanked - oldvalue: 1200455 -->
⚫ | C=19 | H=26 | I=3 | N=3 | O=9
| chemical_formula =
⚫ | molecular_weight = 821.138 g/mol
⚫ | C=19 | H=29 | I=1 | O=2
| smiles = O=C(N(c1c(I)c(c(I)c(c1I)C(=O)NCC(O)CO)C(=O)NCC(O)CO)CC(O)CO)C
⚫ | molecular_weight = 416.33683
| InChI = 1/C19H26I3N3O9/c1-8(29)25(4-11(32)7-28)17-15(21)12(18(33)23-2-9(30)5-26)14(20)13(16(17)22)19(34)24-3-10(31)6-27/h9-11,26-28,30-32H,2-7H2,1H3,(H,23,33)(H,24,34)
| smiles = Ic1ccccc1C(CCCCCCCCC(=O)OCC)C
| InChIKey = NTHXOOBQLCIOLC-UHFFFAOYAM
| InChI = 1/C19H29IO2/c1-3-22-19(21)15-9-7-5-4-6-8-12-16(2)17-13-10-11-14-18(17)20/h10-11,13-14,16H,3-9,12,15H2,1-2H3
| InChIKey = IWRUDYQZPTVTPA-UHFFFAOYAP
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C19H29IO2/c1-3-22-19(21)15-9-7-5-4-6-8-12-16(2)17-13-10-11-14-18(17)20/h10-11,13-14,16H,3-9,12,15H2,1-2H3 | StdInChI = 1S/C19H26I3N3O9/c1-8(29)25(4-11(32)7-28)17-15(21)12(18(33)23-2-9(30)5-26)14(20)13(16(17)22)19(34)24-3-10(31)6-27/h9-11,26-28,30-32H,2-7H2,1H3,(H,23,33)(H,24,34)
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = IWRUDYQZPTVTPA-UHFFFAOYSA-N | StdInChIKey = NTHXOOBQLCIOLC-UHFFFAOYSA-N
}} }}

Revision as of 15:32, 21 November 2011

This page contains a copy of the infobox ({{drugbox}}) taken from revid 456800055 of page Iohexol with values updated to verified values.
WikiProject Chemicals/Chembox validation/VerifiedDataSandbox
Clinical data
AHFS/Drugs.comMicromedex Detailed Consumer Information
Routes of
administration		Intrathecal, intravascular, oral, intracavital
ATC code
Legal status
Legal status
  • In general: ℞ (Prescription only)
Pharmacokinetic data
Protein bindingLow
MetabolismNil
Elimination half-lifeVariable
ExcretionRenal, unchanged
Identifiers
IUPAC name
  • 1-N,3-N-bis(2,3-dihydroxypropyl)-5--2,4,6-triiodobenzene-1,3-dicarboxamide
CAS Number
PubChem CID
DrugBank
ChemSpider
UNII
KEGG
ChEBI
Chemical and physical data
FormulaC19H26I3N3O9
Molar mass821.138 g/mol g·mol
3D model (JSmol)
SMILES
  • O=C(N(c1c(I)c(c(I)c(c1I)C(=O)NCC(O)CO)C(=O)NCC(O)CO)CC(O)CO)C
InChI
  • InChI=1S/C19H26I3N3O9/c1-8(29)25(4-11(32)7-28)17-15(21)12(18(33)23-2-9(30)5-26)14(20)13(16(17)22)19(34)24-3-10(31)6-27/h9-11,26-28,30-32H,2-7H2,1H3,(H,23,33)(H,24,34)
  • Key:NTHXOOBQLCIOLC-UHFFFAOYSA-N
  (what is this?)  (verify)
Misplaced Pages:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions Add topic