Misplaced Pages

:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions - Misplaced Pages

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
< Misplaced Pages:WikiProject Chemicals | Chembox validation Browse history interactively← Previous editNext edit →Content deleted Content addedVisualWikitext
Revision as of 13:38, 23 November 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 457107129 of page Medazepam for the Chem/Drugbox validation project (updated: 'DrugBank', 'CAS_number').← Previous edit Revision as of 13:39, 23 November 2011 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 456660424 of page Medetomidine for the Chem/Drugbox validation project (updated: 'CAS_number').Next edit →
Line 1: Line 1:
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} {{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}}
{{Drugbox {{Drugbox
| Verifiedfields = changed | Verifiedfields = changed
| verifiedrevid = 408583871 | verifiedrevid = 408583997
| IUPAC_name = 9-chloro-2-methyl-6-phenyl-2,5-diazabicycloundeca-5,8,10,12-tetraene | IUPAC_name = (''RS'')-4--3''H''-imidazole
| image = Medazepam skeletal.svg | image = Medetomidine.svg
| imagename = 1 : 1 mixture (racemate)
| width = 120
| drug_name = Medetomidine
| image2 = Medazepam3d.png


<!--Clinical data--> <!--Clinical data-->
| tradename = | tradename =
| Drugs.com = {{drugs.com|international|medazepam}} | Drugs.com = {{drugs.com|monograph|dexmedetomidine-hydrochloride}}
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
⚫ | pregnancy_category = ?
| pregnancy_US = <!-- A / B / C / D / X -->
| legal_status = ](US)
⚫ | pregnancy_category =
⚫ | routes_of_administration = Oral
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C -->
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
| legal_status = Veterinary use only
⚫ | routes_of_administration =


<!--Pharmacokinetic data--> <!--Pharmacokinetic data-->
| bioavailability = ? | bioavailability =
| protein_bound =
| metabolism = ] | metabolism =
| elimination_half-life = 36-150 hours | elimination_half-life =
| excretion = ] | excretion =


<!--Identifiers--> <!--Identifiers-->
| CAS_number_Ref = {{cascite|correct|??}} | CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = <!-- blanked - oldvalue: 2898-12-6 --> | CAS_number = <!-- blanked - oldvalue: 86347-14-0 -->
| ATCvet = yes
| ATC_prefix = N05 | ATC_prefix = N05
| ATC_suffix = BA03 | ATC_suffix = CM91
| ATC_supplemental =
| PubChem = 4041 | PubChem = 68602
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} | DrugBank_Ref = {{drugbankcite|changed|drugbank}}
| DrugBank = <!-- blanked - oldvalue: none -->
| DrugBank = DB00633
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 3901 | ChemSpiderID = 61868
| UNII_Ref = {{fdacite|changed|FDA}} | UNII_Ref = {{fdacite|changed|FDA}}
| UNII = P0J3387W3S | UNII = MR15E85MQM
| KEGG_Ref = {{keggcite|correct|kegg}} | KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D01292 | KEGG = D08165
| ChEBI_Ref = {{ebicite|changed|EBI}}
| ChEBI = 48552
| ChEMBL_Ref = {{ebicite|correct|EBI}} | ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 28333 | ChEMBL = 77921


<!--Chemical data--> <!--Chemical data-->
| chemical_formula =
| C=16 | H=15 | Cl=1 | N=2 | C=13 | H=16 | N=2
| molecular_weight = 270.8 | molecular_weight = 200.279 g/mol
| smiles = Clc3ccc1c(\C(=N/CCN1C)c2ccccc2)c3
| smiles = n1cc(nc1)C(c2c(c(ccc2)C)C)C
| InChI = 1/C16H15ClN2/c1-19-10-9-18-16(12-5-3-2-4-6-12)14-11-13(17)7-8-15(14)19/h2-8,11H,9-10H2,1H3
| InChI = 1/C13H16N2/c1-9-5-4-6-12(10(9)2)11(3)13-7-14-8-15-13/h4-8,11H,1-3H3,(H,14,15)
| InChIKey = YLCXGBZIZBEVPZ-UHFFFAOYAU
| InChIKey = CUHVIMMYOGQXCV-UHFFFAOYAH
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C16H15ClN2/c1-19-10-9-18-16(12-5-3-2-4-6-12)14-11-13(17)7-8-15(14)19/h2-8,11H,9-10H2,1H3 | StdInChI = 1S/C13H16N2/c1-9-5-4-6-12(10(9)2)11(3)13-7-14-8-15-13/h4-8,11H,1-3H3,(H,14,15)
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = YLCXGBZIZBEVPZ-UHFFFAOYSA-N | StdInChIKey = CUHVIMMYOGQXCV-UHFFFAOYSA-N
}} }}

Revision as of 13:39, 23 November 2011

This page contains a copy of the infobox ({{drugbox}}) taken from revid 456660424 of page Medetomidine with values updated to verified values.
Medetomidine
Clinical data
AHFS/Drugs.comMonograph
ATCvet code
Legal status
Legal status
  • Veterinary use only
Identifiers
IUPAC name
  • (RS)-4--3H-imidazole
PubChem CID
DrugBank
ChemSpider
UNII
KEGG
ChEBI
ChEMBL
Chemical and physical data
FormulaC13H16N2
Molar mass200.279 g/mol g·mol
3D model (JSmol)
SMILES
  • n1cc(nc1)C(c2c(c(ccc2)C)C)C
InChI
  • InChI=1S/C13H16N2/c1-9-5-4-6-12(10(9)2)11(3)13-7-14-8-15-13/h4-8,11H,1-3H3,(H,14,15)
  • Key:CUHVIMMYOGQXCV-UHFFFAOYSA-N
  (what is this?)  (verify)