| Revision as of 11:56, 24 November 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 456772841 of page Meprednisone for the Chem/Drugbox validation project (updated: 'ChEMBL', 'CAS_number').← Previous edit |
Revision as of 11:57, 24 November 2011 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 457279625 of page Meptazinol for the Chem/Drugbox validation project (updated: 'CAS_number').Next edit → |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{Drugbox |
|
{{Drugbox |
|
| Verifiedfields = changed |
|
| Verifiedfields = changed |
|
| verifiedrevid = 400296889 |
|
| verifiedrevid = 408589699 |
|
| IUPAC_name = (16β)-17,21-dihydroxy-16-methylpregna-1,4-diene-3,11,20-trione |
|
| IUPAC_name = (''RS'')-3-(3-ethyl-1-methylazepan-3-yl)phenol |
|
| image = Meprednisone.png |
|
| image = Meptazinol Enantiomers Structural Formulae.png |
|
|
| width = 200 |
|
|
| image2 = |
|
|
| width2 = |
|
|
| imagename = 1 : 1 mixture (racemate) |
|
|
| drug_name = Meptazinol |
|
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
|
| tradename = |
|
| tradename = |
|
| Drugs.com = {{drugs.com|international|meprednisone}} |
|
| Drugs.com = {{drugs.com|international|meptazinol}} |
|
|
| licence_EU = <!-- EMEA requires brand name --> |
|
|
| licence_US = <!-- FDA may use generic name --> |
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| pregnancy_category = |
|
| pregnancy_category = |
|
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S8 --> |
|
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
|
| legal_UK = <!-- GSL / P / POM / CD --> |
|
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
|
| legal_UK = POM |
|
| legal_US = <!-- OTC / Rx-only --> |
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| legal_status = |
|
| legal_status = |
|
|
| dependency_liability = Low |
|
| routes_of_administration = |
|
|
|
| routes_of_administration = Oral, ], ] |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
<!--Pharmacokinetic data--> |
|
| bioavailability = |
|
| bioavailability = |
|
| protein_bound = |
|
| protein_bound = |
|
|
| metabolism = The peak analgesic effect is seen within 30–60 minutes and lasts about 3–4 hours. |
|
| metabolism = |
|
|
| elimination_half-life = |
|
| elimination_half-life = Half-Life (1.4–4 hours). |
|
|
| excretion = The drug is rapidly metabolised to the glucuronide, and mostly excreted in the urine. |
|
| excretion = |
|
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number = <!-- blanked - oldvalue: 1247-42-3 --> |
|
| CAS_number = <!-- blanked - oldvalue: 54340-58-8 --> |
|
| ATC_prefix = H02 |
|
| ATC_prefix = N02 |
|
| ATC_suffix = AB15 |
|
| ATC_suffix = AX05 |
|
|
| ATC_supplemental = |
|
| PubChem = 5284587 |
|
| PubChem = 41049 |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank = |
|
| DrugBank = |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 4447637 |
|
| ChemSpiderID = 37469 |
|
| UNII_Ref = {{fdacite|changed|FDA}} |
|
| UNII_Ref = {{fdacite|changed|FDA}} |
|
| UNII = 67U96J8P35 |
|
| UNII = 18Y7S5JKZD |
|
| KEGG_Ref = {{keggcite|changed|kegg}} |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG = D06673 |
|
| KEGG = D08182 |
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL = <!-- blanked - oldvalue: 1201148 --> |
|
| ChEMBL = 314437 |
|
|
|
| ⚫ |
| C=22 | H=28 | O=5 |
|
|
|
<!--Chemical data--> |
| ⚫ |
| molecular_weight = 372.455 g/mol |
|
|
|
| chemical_formula = |
|
| smiles = O=C(CO)3(O)(C)C24CC\C1=C\C(=O)\C=C/1(C)4C(=O)C23C |
|
|
⚫ |
| C=15 | H=23 | N=1 | O=1 |
|
| InChI = 1/C22H28O5/c1-12-8-16-15-5-4-13-9-14(24)6-7-20(13,2)19(15)17(25)10-21(16,3)22(12,27)18(26)11-23/h6-7,9,12,15-16,19,23,27H,4-5,8,10-11H2,1-3H3/t12-,15-,16-,19+,20-,21-,22-/m0/s1 |
|
|
⚫ |
| molecular_weight = 233.34922 g/mol |
|
| InChIKey = PIDANAQULIKBQS-RNUIGHNZBC |
|
|
|
| smiles = Oc1cccc(c1)C2(CC)CCCCN(C)C2 |
|
|
| InChI = 1/C15H23NO/c1-3-15(9-4-5-10-16(2)12-15)13-7-6-8-14(17)11-13/h6-8,11,17H,3-5,9-10,12H2,1-2H3 |
|
|
| InChIKey = JLICHNCFTLFZJN-UHFFFAOYAS |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C22H28O5/c1-12-8-16-15-5-4-13-9-14(24)6-7-20(13,2)19(15)17(25)10-21(16,3)22(12,27)18(26)11-23/h6-7,9,12,15-16,19,23,27H,4-5,8,10-11H2,1-3H3/t12-,15-,16-,19+,20-,21-,22-/m0/s1 |
|
| StdInChI = 1S/C15H23NO/c1-3-15(9-4-5-10-16(2)12-15)13-7-6-8-14(17)11-13/h6-8,11,17H,3-5,9-10,12H2,1-2H3 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = PIDANAQULIKBQS-RNUIGHNZSA-N |
|
| StdInChIKey = JLICHNCFTLFZJN-UHFFFAOYSA-N |
|
|
| synonyms = |
|
|
| density = |
|
|
| melting_notes = |
|
|
| boiling_point = |
|
|
| solubility = |
|
|
| specific_rotation = |
|
|
| sec_combustion = |
|
}} |
|
}} |
