Revision as of 11:57, 24 November 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 457279625 of page Meptazinol for the Chem/Drugbox validation project (updated: 'CAS_number').← Previous edit |
Revision as of 11:57, 24 November 2011 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 456671137 of page Mercaptopurine for the Chem/Drugbox validation project (updated: 'DrugBank').Next edit → |
Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{Drugbox |
|
{{Drugbox |
|
| Verifiedfields = changed |
|
| Verifiedfields = changed |
|
| verifiedrevid = 408589699 |
|
| verifiedrevid = 418795182 |
|
| IUPAC_name = (''RS'')-3-(3-ethyl-1-methylazepan-3-yl)phenol |
|
| IUPAC_name = 3,7-dihydropurine-6-thione |
|
|
| image = Mercaptopurine.svg |
|
| image = Meptazinol Enantiomers Structural Formulae.png |
|
|
| width = 200 |
|
| width = 200 |
|
| image2 = |
|
|
| width2 = |
|
|
| imagename = 1 : 1 mixture (racemate) |
|
|
| drug_name = Meptazinol |
|
|
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
|
| tradename = |
|
| tradename = Purinethol |
|
| Drugs.com = {{drugs.com|international|meptazinol}} |
|
| Drugs.com = {{drugs.com|monograph|mercaptopurine}} |
|
|
| MedlinePlus = a682653 |
|
| licence_EU = <!-- EMEA requires brand name --> |
|
|
⚫ |
| pregnancy_category = ?,(Increased Risk of Abortion) |
|
| licence_US = <!-- FDA may use generic name --> |
|
|
⚫ |
| legal_status = ? |
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
|
⚫ |
| routes_of_administration = Oral |
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
⚫ |
| pregnancy_category = |
|
|
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
|
|
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
|
| legal_UK = POM |
|
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
⚫ |
| legal_status = |
|
|
| dependency_liability = Low |
|
⚫ |
| routes_of_administration = Oral, ], ] |
|
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
<!--Pharmacokinetic data--> |
|
| bioavailability = |
|
| bioavailability = 5 to 37% |
|
|
| metabolism = ] |
|
| protein_bound = |
|
|
|
| elimination_half-life = 60 to 120 min., longer for its active metabolites |
|
| metabolism = The peak analgesic effect is seen within 30–60 minutes and lasts about 3–4 hours. |
|
|
|
| excretion = ] |
|
| elimination_half-life = Half-Life (1.4–4 hours). |
|
|
| excretion = The drug is rapidly metabolised to the glucuronide, and mostly excreted in the urine. |
|
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number = <!-- blanked - oldvalue: 54340-58-8 --> |
|
| CAS_number = 50-44-2 |
|
| ATC_prefix = N02 |
|
| ATC_prefix = L01 |
|
| ATC_suffix = AX05 |
|
| ATC_suffix = BB02 |
|
⚫ |
| PubChem = 667490 |
|
| ATC_supplemental = |
|
⚫ |
| PubChem = 41049 |
|
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank = |
|
| DrugBank = DB01033 |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 37469 |
|
| ChemSpiderID = 580869 |
|
| UNII_Ref = {{fdacite|changed|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = 18Y7S5JKZD |
|
| UNII = PKK6MUZ20G |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG = D08182 |
|
| KEGG = D04931 |
|
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEBI = 50667 |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL = 314437 |
|
| ChEMBL = 1425 |
|
|
|
|
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
⚫ |
| C=5 | H=4 | N=4 | S=1 |
|
| chemical_formula = |
|
|
⚫ |
| molecular_weight = 152.177 g/mol |
⚫ |
| C=15 | H=23 | N=1 | O=1 |
|
|
|
| smiles = S=C2/N=C\Nc1ncnc12 |
⚫ |
| molecular_weight = 233.34922 g/mol |
|
|
|
| InChI = 1/C5H4N4S/c10-5-3-4(7-1-6-3)8-2-9-5/h1-2H,(H2,6,7,8,9,10) |
|
| smiles = Oc1cccc(c1)C2(CC)CCCCN(C)C2 |
|
|
|
| InChIKey = GLVAUDGFNGKCSF-UHFFFAOYAL |
|
| InChI = 1/C15H23NO/c1-3-15(9-4-5-10-16(2)12-15)13-7-6-8-14(17)11-13/h6-8,11,17H,3-5,9-10,12H2,1-2H3 |
|
|
| InChIKey = JLICHNCFTLFZJN-UHFFFAOYAS |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C15H23NO/c1-3-15(9-4-5-10-16(2)12-15)13-7-6-8-14(17)11-13/h6-8,11,17H,3-5,9-10,12H2,1-2H3 |
|
| StdInChI = 1S/C5H4N4S/c10-5-3-4(7-1-6-3)8-2-9-5/h1-2H,(H2,6,7,8,9,10) |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = JLICHNCFTLFZJN-UHFFFAOYSA-N |
|
| StdInChIKey = GLVAUDGFNGKCSF-UHFFFAOYSA-N |
|
| synonyms = |
|
|
| density = |
|
|
| melting_notes = |
|
|
| boiling_point = |
|
|
| solubility = |
|
|
| specific_rotation = |
|
|
| sec_combustion = |
|
|
}} |
|
}} |