Revision as of 12:35, 24 November 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 456775260 of page Midodrine for the Chem/Drugbox validation project (updated: 'DrugBank', 'ChEMBL').← Previous edit |
Revision as of 12:36, 24 November 2011 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 447616004 of page Miglitol for the Chem/Drugbox validation project (updated: 'DrugBank').Next edit → |
Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{Drugbox |
|
{{Drugbox |
|
⚫ |
| verifiedrevid = 411550118 |
|
| Verifiedfields = changed |
|
|
|
| IUPAC_name = (2''R'',3''R'',4''R'',5''S'')-1-(2-hydroxyethyl)-2-(hydroxymethyl)<br>piperidine-3,4,5-triol |
⚫ |
| verifiedrevid = 402499342 |
|
|
|
| image = Miglitol structure.svg |
|
| IUPAC_name = (''RS'')- ''N''-glycinamide |
|
|
| image = Midodrine.svg |
|
| width = 200 |
|
| width = 200px |
|
|
| imagename = 1 : 1 mixture (racemate) |
|
|
| drug_name = Midodrine |
|
|
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
|
| tradename = Proamatine |
|
| tradename = Glyset |
|
| Drugs.com = {{drugs.com|monograph|midodrine-hydrochloride}} |
|
| Drugs.com = {{drugs.com|monograph|miglitol}} |
|
| MedlinePlus = a602023 |
|
| MedlinePlus = a601079 |
|
|
| licence_US = Miglitol |
|
|
| pregnancy_AU = B3 |
|
|
| pregnancy_US = B |
|
|
| pregnancy_category = |
|
|
| legal_AU = <!-- Unscheduled / S2 / S4 / S8 --> |
|
|
| legal_UK = <!-- GSL / P / POM / CD --> |
|
|
| legal_US = Rx-only |
|
|
| legal_status = |
|
|
| routes_of_administration = Oral |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
|
| bioavailability = Dose-dependent |
|
|
| protein_bound = Negligible (<4.0%) |
|
|
| metabolism = Nil |
|
|
| elimination_half-life = 2 hours |
|
|
| excretion = ] (95%) |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
⚫ |
| CAS_number = 72432-03-2 |
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
|
|
| ATC_prefix = A10 |
⚫ |
| CAS_number = 133163-28-7 |
|
|
| ATC_prefix = C01 |
|
| ATC_suffix = BF02 |
|
|
| ATC_supplemental = |
|
| ATC_suffix = CA17 |
|
|
| PubChem = 4195 |
|
| PubChem = 441314 |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank = DB00211 |
|
| DrugBank = DB00491 |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 4050 |
|
| ChemSpiderID = 390074 |
|
| UNII_Ref = {{fdacite|changed|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = 6YE7PBM15H |
|
| UNII = 0V5436JAQW |
|
| KEGG_Ref = {{keggcite|changed|kegg}} |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG = D08220 |
|
| KEGG = D00625 |
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEBI = 6933 |
|
| ChEMBL = 1561 |
|
|
|
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
|
|
<!--Chemical data--> |
|
| ChEMBL = <!-- blanked - oldvalue: 1076 --> |
|
|
| C=12 | H=18 | N=2 | O=4 |
|
| C=8 | H=17 | N=1 | O=5 |
|
| molecular_weight = 254.282 g/mol |
|
| molecular_weight = 207.224 g/mol |
|
| smiles = O=C(NCC(O)c1cc(OC)ccc1OC)CN |
|
| smiles = OCCN1((O)(O)(O)C1)CO |
|
| InChI = 1/C12H18N2O4/c1-17-8-3-4-11(18-2)9(5-8)10(15)7-14-12(16)6-13/h3-5,10,15H,6-7,13H2,1-2H3,(H,14,16) |
|
| InChI = 1/C8H17NO5/c10-2-1-9-3-6(12)8(14)7(13)5(9)4-11/h5-8,10-14H,1-4H2/t5-,6+,7-,8-/m1/s1 |
|
| InChIKey = PTKSEFOSCHHMPD-UHFFFAOYAG |
|
| InChIKey = IBAQFPQHRJAVAV-ULAWRXDQBK |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C12H18N2O4/c1-17-8-3-4-11(18-2)9(5-8)10(15)7-14-12(16)6-13/h3-5,10,15H,6-7,13H2,1-2H3,(H,14,16) |
|
| StdInChI = 1S/C8H17NO5/c10-2-1-9-3-6(12)8(14)7(13)5(9)4-11/h5-8,10-14H,1-4H2/t5-,6+,7-,8-/m1/s1 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = PTKSEFOSCHHMPD-UHFFFAOYSA-N |
|
| StdInChIKey = IBAQFPQHRJAVAV-ULAWRXDQSA-N |
|
|
| density = 1.458 |
|
| synonyms = <small>2-amino-''N''--acetamide</small> |
|
|
|
| melting_point = 114 |
|
}} |
|
}} |