Revision as of 12:36, 24 November 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 400314321 of page Migrastatin for the Chem/Drugbox validation project (updated: 'ChEMBL').← Previous edit |
Revision as of 12:38, 24 November 2011 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 460463385 of page Milrinone for the Chem/Drugbox validation project (updated: 'DrugBank').Next edit → |
Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{chembox |
|
{{Drugbox |
|
|
| Verifiedfields = changed |
|
| verifiedrevid = 400312989 |
|
| verifiedrevid = 414088890 |
|
| Name = '''Migrastatin''' |
|
|
|
| IUPAC_name = 2-methyl-6-oxo-1,6-dihydro-3,4'-bipyridine-5-carbonitrile |
|
| ImageFile = Migrastatin.svg |
|
|
|
| image = Milrinone.svg |
|
| ImageName = Migrastatin |
|
|
|
|
|
| Section1 = {{Chembox Identifiers |
|
|
|
<!--Clinical data--> |
|
| InChI = 1/C27H39NO7/c1-17-14-18(2)27(35-25(32)13-8-6-5-7-12-22(34-4)26(17)33)19(3)21(29)11-9-10-20-15-23(30)28-24(31)16-20/h7-8,12-14,17,19-20,22,26-27,33H,5-6,9-11,15-16H2,1-4H3,(H,28,30,31)/b12-7+,13-8+,18-14-/t17-,19-,22+,26+,27+/m1/s1 |
|
|
|
| tradename = |
|
| InChIKey = OGYMUMAKGYYNHV-IJMHZYIBBB |
|
|
|
| Drugs.com = {{drugs.com|monograph|milrinone-lactate}} |
|
|
| MedlinePlus = a601020 |
|
|
| pregnancy_US = C |
|
|
| legal_status = Rx-only |
|
|
| routes_of_administration = IV only |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
|
| bioavailability = 100% (as IV bolus, infusion) |
|
|
| protein_bound = 70 to 80% |
|
|
| metabolism = Hepatic (12%) |
|
|
| elimination_half-life = 2.3 hours (mean, in CHF) |
|
|
| excretion = Urine (85% as unchanged drug) within 24 hours |
|
|
|
|
|
<!--Identifiers--> |
|
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
|
| CAS_number = 78415-72-2 |
|
|
| ATC_prefix = C01 |
|
|
| ATC_suffix = CE02 |
|
|
| ATC_supplemental = |
|
|
| PubChem = 4197 |
|
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
|
| DrugBank = DB00235 |
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
⚫ |
| ChemSpiderID = 4052 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = JU9YAX04C7 |
|
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
|
| KEGG = D00417 |
|
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEBI = 50693 |
|
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
|
| ChEMBL = 189 |
|
|
|
|
|
<!--Chemical data--> |
|
|
| C=12 | H=9 | N=3 | O=1 |
|
|
| molecular_weight = 211.219 g/mol |
|
|
| smiles = Cc1c(cc(c(=O)1)C#N)c2ccncc2 |
|
|
| InChI = 1/C12H9N3O/c1-8-11(9-2-4-14-5-3-9)6-10(7-13)12(16)15-8/h2-6H,1H3,(H,15,16) |
|
|
| InChIKey = PZRHRDRVRGEVNW-UHFFFAOYAY |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
|
| StdInChI = 1S/C12H9N3O/c1-8-11(9-2-4-14-5-3-9)6-10(7-13)12(16)15-8/h2-6H,1H3,(H,15,16) |
|
| StdInChI = 1S/C27H39NO7/c1-17-14-18(2)27(35-25(32)13-8-6-5-7-12-22(34-4)26(17)33)19(3)21(29)11-9-10-20-15-23(30)28-24(31)16-20/h7-8,12-14,17,19-20,22,26-27,33H,5-6,9-11,15-16H2,1-4H3,(H,28,30,31)/b12-7+,13-8+,18-14-/t17-,19-,22+,26+,27+/m1/s1 |
|
|
| SMILES = C1/C=C(\(OC(=O)/C=C/CC/C=C/(1O)OC)(C)C(=O)CCCC2CC(=O)NC(=O)C2)/C |
|
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = OGYMUMAKGYYNHV-IJMHZYIBSA-N |
|
| StdInChIKey = PZRHRDRVRGEVNW-UHFFFAOYSA-N |
|
|
| density = 1.344 |
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
| ChEMBL = 474321 |
|
| melting_point = 315 |
|
|
| boiling_point = 449 |
⚫ |
| ChemSpiderID=21106454 |
|
|
}} |
|
|
| Section2 = {{Chembox Properties |
|
|
| Formula = C<sub>27</sub>H<sub>39</sub>NO<sub>7</sub> |
|
|
| MolarMass = 489.60 g/mol}} |
|
|
}} |
|
}} |