Revision as of 12:40, 24 November 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 447615903 of page Mitiglinide for the Chem/Drugbox validation project (updated: 'ChEMBL', 'CAS_number').← Previous edit |
Revision as of 12:40, 24 November 2011 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 457013089 of page Mitobronitol for the Chem/Drugbox validation project (updated: 'CAS_number').Next edit → |
Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{Drugbox |
|
{{Drugbox |
|
|
| Verifiedfields = changed |
⚫ |
| verifiedrevid = 444015631 |
|
|
|
| Watchedfields = changed |
|
| IUPAC_name = (2''S'')-2-benzyl-4--4-oxobutanoic acid |
|
|
⚫ |
| verifiedrevid = 408763068 |
⚫ |
| image = Mitiglinide.svg |
|
|
|
| IUPAC_name = 1,6-dibromo-1,6-dideoxy-<small>D</small>-mannitol |
|
⚫ |
| image = Mitobronitol.png |
|
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
|
| tradename = |
|
| tradename = |
|
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| Drugs.com = {{drugs.com|international|mitiglinide}} |
|
|
|
| pregnancy_US = <!-- A / B / C / D / X --> |
⚫ |
| routes_of_administration = oral |
|
|
|
| pregnancy_category = |
|
|
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
|
|
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
|
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
|
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
|
| legal_status = |
|
⚫ |
| routes_of_administration = |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
|
| bioavailability = |
|
|
| protein_bound = |
|
|
| metabolism = |
|
|
| elimination_half-life = |
|
|
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number = <!-- blanked - oldvalue: 207844-01-7 --> |
|
| CAS_number = <!-- blanked - oldvalue: 488-41-5 --> |
|
| ATC_prefix = A10 |
|
|
| ATC_suffix = BX08 |
|
| ATC_prefix = L01 |
|
| ChEMBL = 471498 |
|
| ATC_suffix = AX01 |
|
| PubChem = 121891 |
|
| PubChem = 656655 |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank = DB01252 |
|
| DrugBank = |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 108739 |
|
| ChemSpiderID = 571004 |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII_Ref = {{fdacite|changed|FDA}} |
|
| UNII = D86I0XLB13 |
|
| UNII = 5UP30YED7N |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG = D01854 |
|
| KEGG = D02020 |
|
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
|
| ChEMBL = 447629 |
|
|
|
|
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| C=19 | H=25 | N=1 | O=3 |
|
| C=6 | H=12 | Br=2 | O=4 |
|
| molecular_weight = 315.41 g/mol |
|
| molecular_weight = 307.97 g/mol |
|
| smiles = O=C(O)(Cc1ccccc1)CC(=O)N3C2CCCC2C3 |
|
| smiles = BrC(O)(O)(O)(O)CBr |
|
| InChI = 1/C19H25NO3/c21-18(20-12-15-8-4-5-9-16(15)13-20)11-17(19(22)23)10-14-6-2-1-3-7-14/h1-3,6-7,15-17H,4-5,8-13H2,(H,22,23)/t15-,16+,17-/m0/s1 |
|
| InChI = 1/C6H12Br2O4/c7-1-3(9)5(11)6(12)4(10)2-8/h3-6,9-12H,1-2H2/t3-,4-,5-,6-/m1/s1 |
|
| InChIKey = WPGGHFDDFPHPOB-BBWFWOEEBF |
|
| InChIKey = VFKZTMPDYBFSTM-KVTDHHQDBB |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C19H25NO3/c21-18(20-12-15-8-4-5-9-16(15)13-20)11-17(19(22)23)10-14-6-2-1-3-7-14/h1-3,6-7,15-17H,4-5,8-13H2,(H,22,23)/t15-,16+,17-/m0/s1 |
|
| StdInChI = 1S/C6H12Br2O4/c7-1-3(9)5(11)6(12)4(10)2-8/h3-6,9-12H,1-2H2/t3-,4-,5-,6-/m1/s1 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = WPGGHFDDFPHPOB-BBWFWOEESA-N |
|
| StdInChIKey = VFKZTMPDYBFSTM-KVTDHHQDSA-N |
|
}} |
|
}} |