Revision as of 12:40, 24 November 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 457013089 of page Mitobronitol for the Chem/Drugbox validation project (updated: 'CAS_number').← Previous edit |
Revision as of 12:41, 24 November 2011 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 447540160 of page Mitotane for the Chem/Drugbox validation project (updated: 'DrugBank').Next edit → |
Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{Drugbox |
|
{{Drugbox |
|
⚫ |
| verifiedrevid = 408764161 |
|
| Verifiedfields = changed |
|
|
|
| IUPAC_name = (''RS'')-1-chloro-2--benzene |
|
| Watchedfields = changed |
|
|
⚫ |
| image = Mitotane.svg |
⚫ |
| verifiedrevid = 408763068 |
|
|
|
| width = 200 |
|
| IUPAC_name = 1,6-dibromo-1,6-dideoxy-<small>D</small>-mannitol |
|
|
|
| imagename = 1 : 1 mixture (racemate) |
⚫ |
| image = Mitobronitol.png |
|
|
|
| drug_name = Mitotane |
|
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
|
| tradename = |
|
| tradename = |
|
|
| Drugs.com = {{drugs.com|monograph|mitotane}} |
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
|
|
| MedlinePlus = a608050 |
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
|
|
| licence_US = MITOTANE |
|
| pregnancy_category = |
|
| pregnancy_category = C |
|
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
|
|
⚫ |
| legal_status = Rx-only |
|
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
|
⚫ |
| routes_of_administration = Oral |
|
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
|
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
⚫ |
| legal_status = |
|
⚫ |
| routes_of_administration = |
|
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
<!--Pharmacokinetic data--> |
|
| bioavailability = |
|
| bioavailability = 40% |
|
| protein_bound = |
|
| protein_bound = 6% |
|
| metabolism = |
|
| metabolism = |
|
| elimination_half-life = |
|
| elimination_half-life = 18 to 159 days |
|
| excretion = |
|
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CAS_number = <!-- blanked - oldvalue: 488-41-5 --> |
|
| CAS_number = 53-19-0 |
|
| ATC_prefix = L01 |
|
| ATC_prefix = L01 |
|
| ATC_suffix = AX01 |
|
| ATC_suffix = XX23 |
|
|
| ATC_supplemental = |
|
| PubChem = 656655 |
|
| PubChem = 4211 |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank = |
|
| DrugBank = DB00648 |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 571004 |
|
| ChemSpiderID = 4066 |
|
| UNII_Ref = {{fdacite|changed|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = 5UP30YED7N |
|
| UNII = 78E4J5IB5J |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG = D02020 |
|
| KEGG = D00420 |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL = 447629 |
|
| ChEMBL = 1670 |
|
|
|
|
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| C=6 | H=12 | Br=2 | O=4 |
|
| C=14 | H=10 | Cl=4 |
|
| molecular_weight = 307.97 g/mol |
|
| molecular_weight = 320.04 g/mol |
|
| smiles = BrC(O)(O)(O)(O)CBr |
|
| smiles = Clc1ccccc1C(c2ccc(Cl)cc2)C(Cl)Cl |
|
| InChI = 1/C6H12Br2O4/c7-1-3(9)5(11)6(12)4(10)2-8/h3-6,9-12H,1-2H2/t3-,4-,5-,6-/m1/s1 |
|
| InChI = 1/C14H10Cl4/c15-10-7-5-9(6-8-10)13(14(17)18)11-3-1-2-4-12(11)16/h1-8,13-14H |
|
| InChIKey = VFKZTMPDYBFSTM-KVTDHHQDBB |
|
| InChIKey = JWBOIMRXGHLCPP-UHFFFAOYAD |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C6H12Br2O4/c7-1-3(9)5(11)6(12)4(10)2-8/h3-6,9-12H,1-2H2/t3-,4-,5-,6-/m1/s1 |
|
| StdInChI = 1S/C14H10Cl4/c15-10-7-5-9(6-8-10)13(14(17)18)11-3-1-2-4-12(11)16/h1-8,13-14H |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = VFKZTMPDYBFSTM-KVTDHHQDSA-N |
|
| StdInChIKey = JWBOIMRXGHLCPP-UHFFFAOYSA-N |
|
}} |
|
}} |