Revision as of 13:10, 24 November 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 456624997 of page Moxifloxacin for the Chem/Drugbox validation project (updated: 'DrugBank', 'UNII').← Previous edit |
Revision as of 13:11, 24 November 2011 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 456615628 of page Moxonidine for the Chem/Drugbox validation project (updated: 'CAS_number').Next edit → |
Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{drugbox |
|
{{Drugbox |
|
| Verifiedfields = changed |
|
| Verifiedfields = changed |
|
⚫ |
| verifiedrevid = 408765028 |
|
| Watchedfields = changed |
|
|
|
| IUPAC_name = 4-chloro-''N''-(4,5-dihydro-1''H''-imidazol-2-yl)-<br>6-methoxy-2-methylpyrimidin-5-amine |
|
|
| image = Moxonidine.svg |
|
|
| width = 180 |
|
|
|
|
|
<!--Clinical data--> |
|
|
| tradename = |
|
|
| Drugs.com = {{drugs.com|international|moxonidine}} |
|
|
| pregnancy_AU = B3 |
|
|
| legal_UK = POM |
|
|
| routes_of_administration = Oral |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
⚫ |
| bioavailability = 88% |
|
⚫ |
| protein_bound = |
|
|
| metabolism = |
|
⚫ |
| elimination_half-life = 2.2 hours |
|
⚫ |
| excretion = ] |
|
|
|
|
|
<!--Identifiers--> |
|
⚫ |
| CAS_number_Ref = {{cascite|correct|??}} |
|
|
| CAS_number = <!-- blanked - oldvalue: 75438-57-2 --> |
|
⚫ |
| ATC_prefix = C02 |
|
⚫ |
| ATC_suffix = AC05 |
|
⚫ |
| PubChem = 4810 |
|
⚫ |
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
⚫ |
| DrugBank = |
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
⚫ |
| ChemSpiderID = 4645 |
|
| UNII_Ref = {{fdacite|changed|FDA}} |
|
| UNII_Ref = {{fdacite|changed|FDA}} |
|
| UNII = U188XYD42P |
|
| UNII = CC6X0L40GW |
|
⚫ |
| KEGG_Ref = {{keggcite|correct|kegg}} |
⚫ |
| verifiedrevid = 408764902 |
|
|
|
| KEGG = D05087 |
|
| |
|
|
| IUPAC_name = 1-cyclopropyl-7-[(1''S'',6''S'')-2,8-diazabicyclo |
|
|
non-8-yl]-6-fluoro-8-methoxy-4-oxo- |
|
|
quinoline-3-carboxylic acid |
|
|
| image = Moxifloxacin Structural Formulae V.1.svg |
|
|
| image2 = Moxifloxacin-cation-from-xtal-3D-balls.png |
|
⚫ |
| CASNo_Ref = {{cascite|correct|CAS}} |
|
|
| InChI = 1/C21H24FN3O4/c1-29-20-17-13(19(26)14(21(27)28)9-25(17)12-4-5-12)7-15(22)18(20)24-8-11-3-2-6-23-16(11)10-24/h7,9,11-12,16,23H,2-6,8,10H2,1H3,(H,27,28)/t11-,16+/m0/s1 |
|
|
| InChIKey = FABPRXSRWADJSP-MEDUHNTEBH |
|
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL = 32 |
|
| ChEMBL = 19236 |
|
|
|
|
|
<!--Chemical data--> |
|
⚫ |
| C=9 | H=12 | Cl=1 | N=5 | O=1 |
|
⚫ |
| molecular_weight = 241.677 g/mol |
|
|
| smiles = Clc1nc(nc(OC)c1N/C2=N/CCN2)C |
|
|
| InChI = 1/C9H12ClN5O/c1-5-13-7(10)6(8(14-5)16-2)15-9-11-3-4-12-9/h3-4H2,1-2H3,(H2,11,12,15) |
|
|
| InChIKey = WPNJAUFVNXKLIM-UHFFFAOYAJ |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C21H24FN3O4/c1-29-20-17-13(19(26)14(21(27)28)9-25(17)12-4-5-12)7-15(22)18(20)24-8-11-3-2-6-23-16(11)10-24/h7,9,11-12,16,23H,2-6,8,10H2,1H3,(H,27,28)/t11-,16+/m0/s1 |
|
| StdInChI = 1S/C9H12ClN5O/c1-5-13-7(10)6(8(14-5)16-2)15-9-11-3-4-12-9/h3-4H2,1-2H3,(H2,11,12,15) |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = FABPRXSRWADJSP-MEDUHNTESA-N |
|
| StdInChIKey = WPNJAUFVNXKLIM-UHFFFAOYSA-N |
⚫ |
| CAS_number_Ref = {{cascite|correct|??}} |
|
|
| CAS_number = 354812-41-2 |
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
⚫ |
| ChemSpiderID = 134802 |
|
⚫ |
| ATC_prefix = J01 |
|
⚫ |
| ATC_suffix = MA14 |
|
|
| ATC_supplemental = {{ATC|S01|AX22}} |
|
⚫ |
| PubChem = 152946 |
|
⚫ |
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
⚫ |
| DrugBank = DB00218 |
|
|
| chemical_formula = |
|
⚫ |
| C=21 |H=24 |N=3 |F=1 |O=4 |
|
⚫ |
| molecular_weight = 401.431 ]/] |
|
|
| smiles = COc1c2c(cc(c1N3C4CCCN4C3)F)c(=O)c(cn2C5CC5)C(=O)O |
|
⚫ |
| bioavailability = 86 to 92% |
|
⚫ |
| protein_bound = 30 to 50% |
|
|
| metabolism = ] and ] conjugation<br>] system not involved |
|
⚫ |
| elimination_half-life = 12 hours |
|
⚫ |
| excretion = hepatic |
|
|
| pregnancy_category = C <small>(United States)</small><br>B3 <small>(Australia)</small> |
|
|
| legal_status = ] |
|
|
| routes_of_administration = ], ], local (eyedrops) |
|
|
}} |
|
}} |