Revision as of 13:19, 24 November 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,141 edits Saving copy of the {{chembox}} taken from revid 454451664 of page N-Acetylaspartylglutamic_acid for the Chem/Drugbox validation project (updated: 'ChEMBL', 'CASNo').← Previous edit |
Revision as of 13:19, 24 November 2011 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,141 edits Saving copy of the {{chembox}} taken from revid 453570349 of page N-Acetylgalactosamine for the Chem/Drugbox validation project (updated: 'ChEBI', 'CASNo').Next edit → |
Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{chembox |
|
{{Chembox |
|
| verifiedrevid = 453508811 |
|
| verifiedrevid = 453568861 |
|
|Name=''N''-Acetylaspartylglutamic acid |
|
| Name=''N''-Acetylgalactosamine |
|
|ImageFile=Acetylaspartylglutamic acid.png |
|
| ImageFile = acetylgalactosamine.png |
|
|ImageSize=200px |
|
| ImageSize = 150px |
|
|
| IUPACName = 2-(Acetylamino)-2-deoxy-<small>D</small>-galactose |
|
|IUPACName=(2''S'')-2-<nowiki>amino]pentanedioic acid |
|
|
|
| OtherNames = GalNAc; 2-Acetamido-2-deoxy-<small>D</small>-galactose; ''N''-Acetylchondrosamine; 2-Acetamido-2-deoxy-<small>D</small>-galactopyranose; ''N''-Acetyl-<small>D</small>-galactosamine |
|
|OtherNames=''N''-Acetyl-1-aspartylglutamic acid; NAAG; Spaglumic acid |
|
|
|Section1= {{Chembox Identifiers |
|
| Section1 = {{Chembox Identifiers |
|
|
| Abbreviations = |
|
| CASNo = <!-- blanked - oldvalue: 4910-46-7 --> |
|
|
|
| CASNo = <!-- blanked - oldvalue: 31022-50-1 --> |
|
| PubChem= 188803 |
|
|
|
| EINECS = |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
|
|
| PubChem = 84265 |
|
| ChEMBL = <!-- blanked - oldvalue: 1329032 --> |
|
|
|
| SMILES = O(C(CO)O(O)1NC(C)=O)1O |
|
| IUPHAR_ligand = 1405 |
|
|
| SMILES= CC(=O)N(CC(=O)O)C(=O)N(CCC(=O)O)C(=O)O |
|
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 164080 |
|
| ChemSpiderID = 76020 |
|
| InChI = 1/C11H16N2O8/c1-5(14)12-7(4-9(17)18)10(19)13-6(11(20)21)2-3-8(15)16/h6-7H,2-4H2,1H3,(H,12,14)(H,13,19)(H,15,16)(H,17,18)(H,20,21)/t6-,7-/m0/s1 |
|
| InChI = 1/C8H15NO6/c1-3(11)9-5-7(13)6(12)4(2-10)15-8(5)14/h4-8,10,12-14H,2H2,1H3,(H,9,11)/t4-,5-,6+,7-,8+/m1/s1 |
|
| InChIKey = OPVPGKGADVGKTG-BQBZGAKWBZ |
|
| InChIKey = OVRNDRQMDRJTHS-CBQIKETKBW |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C11H16N2O8/c1-5(14)12-7(4-9(17)18)10(19)13-6(11(20)21)2-3-8(15)16/h6-7H,2-4H2,1H3,(H,12,14)(H,13,19)(H,15,16)(H,17,18)(H,20,21)/t6-,7-/m0/s1 |
|
| StdInChI = 1S/C8H15NO6/c1-3(11)9-5-7(13)6(12)4(2-10)15-8(5)14/h4-8,10,12-14H,2H2,1H3,(H,9,11)/t4-,5-,6+,7-,8+/m1/s1 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = OPVPGKGADVGKTG-BQBZGAKWSA-N |
|
| StdInChIKey = OVRNDRQMDRJTHS-CBQIKETKSA-N |
|
|
| RTECS = |
|
}} |
|
|
|
| MeSHName = |
|
|Section2= {{Chembox Properties |
|
|
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
| Formula=C<sub>11</sub>H<sub>16</sub>N<sub>2</sub>O<sub>8</sub> |
|
|
|
| ChEBI = 40356 |
|
| MolarMass=304.25 g/mol |
|
|
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
}} |
|
|
|
| KEGG = |
|
|Section3= {{Chembox Hazards |
|
|
|
| ATCCode_prefix = |
|
| MainHazards= |
|
|
|
| ATCCode_suffix = |
|
| FlashPt= |
|
|
|
| ATC_Supplemental =}} |
|
| Autoignition= |
|
|
|
| Section2 = {{Chembox Properties |
|
}} |
|
|
|
| Formula = C<sub>8</sub>H<sub>15</sub>NO<sub>6</sub> |
|
|
| MolarMass = 221.21 g/mol |
|
|
| Appearance = |
|
|
| Density = |
|
|
| MeltingPt = 172-173 °C |
|
|
| Melting_notes = |
|
|
| BoilingPt = |
|
|
| Boiling_notes = |
|
|
| Solubility = |
|
|
| SolubleOther = |
|
|
| Solvent = |
|
|
| pKa = |
|
|
| pKb = |
|
|
| IsoelectricPt = |
|
|
| LambdaMax = |
|
|
| Absorbance = |
|
|
| SpecRotation = |
|
|
| RefractIndex = |
|
|
| Viscosity = |
|
|
| Dipole = }} |
|
|
| Section3 = {{Chembox Structure |
|
|
| CrystalStruct = |
|
|
| Coordination = |
|
|
| MolShape = }} |
|
|
| Section4 = {{Chembox Thermochemistry |
|
|
| DeltaHf = |
|
|
| DeltaHc = |
|
|
| Entropy = |
|
|
| HeatCapacity = }} |
|
|
| Section5 = {{Chembox Pharmacology |
|
|
| AdminRoutes = |
|
|
| Bioavail = |
|
|
| Metabolism = |
|
|
| HalfLife = |
|
|
| ProteinBound = |
|
|
| Excretion = |
|
|
| Legal_status = |
|
|
| Legal_US = |
|
|
| Legal_UK = |
|
|
| Legal_AU = |
|
|
| Legal_CA = |
|
|
| PregCat = |
|
|
| PregCat_AU = |
|
|
| PregCat_US = }} |
|
|
| Section6 = {{Chembox Explosive |
|
|
| ShockSens = |
|
|
| FrictionSens = |
|
|
| ExplosiveV = |
|
|
| REFactor = }} |
|
|
| Section7 = {{Chembox Hazards |
|
|
| ExternalMSDS = |
|
|
| EUClass = |
|
|
| EUIndex = |
|
|
| MainHazards = |
|
|
| NFPA-H = |
|
|
| NFPA-F = |
|
|
| NFPA-R = |
|
|
| NFPA-O = |
|
|
| RPhrases = |
|
|
| SPhrases = {{S24/25}} |
|
|
| RSPhrases = |
|
|
| FlashPt = |
|
|
| Autoignition = |
|
|
| ExploLimits = |
|
|
| PEL = }} |
|
|
| Section8 = {{Chembox Related |
|
|
| OtherFunctn = ]<br>]<br>] |
|
|
| Function = ]s |
|
|
| OtherCpds = }} |
|
}} |
|
}} |