Revision as of 13:21, 24 November 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 453568185 of page N-Acetylneuraminic_acid for the Chem/Drugbox validation project (updated: 'ChEBI').← Previous edit |
Revision as of 13:22, 24 November 2011 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 453515484 of page N-Acetylserotonin for the Chem/Drugbox validation project (updated: 'ChEMBL', 'ChEBI', 'CASNo').Next edit → |
Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{Chembox |
|
{{Chembox |
|
| verifiedrevid = 453566528 |
|
| verifiedrevid = 453514473 |
|
| Name=''N''-Acetylneuraminic acid |
|
| Name = ''N''-Acetylserotonin |
|
| ImageFile = N-Acetylneuraminic acid.svg |
|
| ImageFile = N-Acetylserotonin.png |
|
| ImageSize = |
|
| ImageSize = |
|
|
| ImageFile2 = N-Acetylserotonin-3D-sticks.png |
|
| IUPACName = 5-(acetylamino)-3,5-dideoxy-<small>D</small>-''glycero''-α-<small>D</small>-''galacto''-non-2-ulopyranosonic acid |
|
|
|
| IUPACName = ''N''-acetamide |
|
| OtherNames = |
|
|
|
| OtherNames = ''N''-acetyl-5-hydroxytryptamine, ''N''-acetyl-5-HT |
|
| Section1 = {{Chembox Identifiers |
|
| Section1 = {{Chembox Identifiers |
|
| CASNo = 131-48-6 |
|
| CASNo = <!-- blanked - oldvalue: 1210-83-9 --> |
|
| ChEBI = 61599 |
|
| ChEMBL = 33103 |
|
| PubChem = 439197 |
|
| ChEBI = 17697 |
|
|
| PubChem = 903 |
|
| SMILES = OC(=O)1(O)C(O)(NC(C)=O)(O1)(O)(O)CO |
|
|
|
| SMILES = CC(=O)NCCC1=CNC2=C1C=C(C=C2)O |
|
| MeSHName = N-Acetylneuraminic+Acid |
|
|
|
| MeSHName = ''N''-Acetylserotonin |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 392681 |
|
| ChemSpiderID = 879 |
|
| InChI = 1/C11H19NO9/c1-4(14)12-7-5(15)2-11(20,10(18)19)21-9(7)8(17)6(16)3-13/h5-9,13,15-17,20H,2-3H2,1H3,(H,12,14)(H,18,19)/t5-,6+,7+,8+,9+,11+/m0/s1 |
|
| InChI = 1/C12H14N2O2/c1-8(15)13-5-4-9-7-14-12-3-2-10(16)6-11(9)12/h2-3,6-7,14,16H,4-5H2,1H3,(H,13,15) |
|
| InChIKey = SQVRNKJHWKZAKO-YRMXFSIDBI |
|
| InChIKey = MVAWJSIDNICKHF-UHFFFAOYAX |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C11H19NO9/c1-4(14)12-7-5(15)2-11(20,10(18)19)21-9(7)8(17)6(16)3-13/h5-9,13,15-17,20H,2-3H2,1H3,(H,12,14)(H,18,19)/t5-,6+,7+,8+,9+,11+/m0/s1 |
|
| StdInChI = 1S/C12H14N2O2/c1-8(15)13-5-4-9-7-14-12-3-2-10(16)6-11(9)12/h2-3,6-7,14,16H,4-5H2,1H3,(H,13,15) |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = SQVRNKJHWKZAKO-YRMXFSIDSA-N |
|
| StdInChIKey = MVAWJSIDNICKHF-UHFFFAOYSA-N |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
| Section2 = {{Chembox Properties |
|
|
| Formula = C<sub>12</sub>H<sub>14</sub>N<sub>2</sub>O<sub>2</sub> |
|
|C=11|H=19|N=1|O=9 |
|
|
| MolarMass = 309.273 g/mol |
|
| MolarMass = 218.252 g/mol |
|
| ExactMass = 309.105981 |
|
| Appearance = |
|
|
| Density = |
|
| Appearance = White crystalline powder |
|
|
| Density = |
|
| MeltingPt = |
|
|
| BoilingPt = |
|
| MeltingPt = 186°C (decomposes) |
|
|
| BoilingPt = |
|
| Solubility = |
|
}} |
|
}} |
|
| Section3 = {{Chembox Hazards |
|
| Section3 = {{Chembox Hazards |
|
| Solubility = |
|
| MainHazards = |
|
| MainHazards = |
|
| FlashPt = |
|
| FlashPt = |
|
| Autoignition = |
|
| Autoignition = |
|
|
}} |
|
}} |
|
}} |
|
}} |