Misplaced Pages

:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions - Misplaced Pages

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
< Misplaced Pages:WikiProject Chemicals | Chembox validation Browse history interactively← Previous editNext edit →Content deleted Content addedVisualWikitext
Revision as of 14:10, 24 November 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 443445462 of page Nitrous_acid for the Chem/Drugbox validation project (updated: 'KEGG').← Previous edit Revision as of 14:10, 24 November 2011 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 456724029 of page Nitroxoline for the Chem/Drugbox validation project (updated: 'ChEMBL').Next edit →
Line 1: Line 1:
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} {{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}}
{{Chembox {{Drugbox
| Verifiedfields = changed | Verifiedfields = changed
| Watchedfields = changed | Watchedfields = changed
| verifiedrevid = 396509456 | verifiedrevid = 408342463
| IUPAC_name = 5-nitroquinolin-8-ol
| ImageFile = Nitrous acid acsv.svg
| image = nitroxoline.png
| ImageSize = 200px
| width = 120px
| ImageName = Nitrous acid

| PIN = Nitrous acid
<!--Clinical data-->
| SystematicName = Hydroxidooxidonitrogen
| tradename =
| Section1 = {{Chembox Identifiers
| Drugs.com = {{drugs.com|international|nitroxoline}}
| CASNo = 7782-77-6
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| CASNo_Ref = {{cascite|correct|CAS}}
| pregnancy_US = <!-- A / B / C / D / X -->
| PubChem = 24529
| pregnancy_category =
| PubChem_Ref = {{Pubchemcite}}
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 -->
| ChemSpiderID = 22936
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII -->
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C -->
| EINECS = 231-963-7
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
| KEGG_Ref = {{keggcite|correct|kegg}}
| legal_status =
| KEGG = <!-- blanked - oldvalue: C00088 -->
| routes_of_administration =
| MeSHName = Nitrous+acid

| ChEBI_Ref = {{ebicite|correct|EBI}}
<!--Pharmacokinetic data-->
| ChEBI = 25567
| SMILES = O=NO | bioavailability =
| protein_bound =
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 1161681 | metabolism =
| elimination_half-life =
| excretion =

<!--Identifiers-->
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 4008-48-4
| ATC_prefix = J01
| ATC_suffix = XX07
| PubChem = 19910
| DrugBank_Ref = {{drugbankcite|changed|drugbank}}
| DrugBank = DB01422
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 18756
| UNII_Ref = {{fdacite|changed|FDA}}
| UNII = A8M33244M6
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D07245
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = <!-- blanked - oldvalue: 1454910 -->
| C=9 | H=6 | N=2 | O=3
| molecular_weight = 190.156 g/mol
| smiles = (=O)c1ccc(O)c2ncccc12
| InChI = 1/C9H6N2O3/c12-8-4-3-7(11(13)14)6-2-1-5-10-9(6)8/h1-5,12H
| InChIKey = RJIWZDNTCBHXAL-UHFFFAOYAL
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/HNO2/c2-1-3/h(H,2,3) | StdInChI = 1S/C9H6N2O3/c12-8-4-3-7(11(13)14)6-2-1-5-10-9(6)8/h1-5,12H
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = IOVCWXUNBOPUCH-UHFFFAOYSA-N | StdInChIKey = RJIWZDNTCBHXAL-UHFFFAOYSA-N
| Gmelin = 983
| 3DMet = B00022}}
| Section2 = {{Chembox Properties
| Formula = HNO<sub>2</sub>
| Appearance = Pale blue solution
| MolarMass = 47.013 g/mol
| Density = Approx. 1 g/ml
| Solubility =
| MeltingPt = Only known in solution
| pKa = 3.398
}}
| Section7 = {{Chembox Hazards
| ExternalMSDS =
| EUIndex = Not listed
| EUClass =
| RPhrases =
| SPhrases =
| MainHazards =
| NFPA-H =
| NFPA-F =
| NFPA-R =
| NFPA-O =
| FlashPt = Non-flammable
}}
| Section8 = {{Chembox Related
| OtherAnions = ]
| OtherCations = ]<br/>]<br/>]
| OtherCpds = ]
}}
}} }}

Revision as of 14:10, 24 November 2011

This page contains a copy of the infobox ({{drugbox}}) taken from revid 456724029 of page Nitroxoline with values updated to verified values.
WikiProject Chemicals/Chembox validation/VerifiedDataSandbox
Clinical data
AHFS/Drugs.comInternational Drug Names
ATC code
Identifiers
IUPAC name
  • 5-nitroquinolin-8-ol
CAS Number
PubChem CID
DrugBank
ChemSpider
UNII
KEGG
Chemical and physical data
FormulaC9H6N2O3
Molar mass190.156 g/mol g·mol
3D model (JSmol)
SMILES
  • (=O)c1ccc(O)c2ncccc12
InChI
  • InChI=1S/C9H6N2O3/c12-8-4-3-7(11(13)14)6-2-1-5-10-9(6)8/h1-5,12H
  • Key:RJIWZDNTCBHXAL-UHFFFAOYSA-N
  (what is this?)  (verify)