Misplaced Pages:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions

< Misplaced Pages:WikiProject Chemicals | Chembox validation Browse history interactively ← Previous edit Next edit →Content deleted Content addedVisual WikitextInline

Revision as of 15:54, 24 November 2011 editBeetstra (talk \| contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 456635836 of page Paromomycin_sulfate for the Chem/Drugbox validation project (updated: 'ChEMBL').← Previous edit		Revision as of 15:55, 24 November 2011 edit undoBeetstra (talk \| contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 444042942 of page Patulin for the Chem/Drugbox validation project (updated: 'KEGG').Next edit →
Line 1:		Line 1:
	{{ambox \| text = This page contains a copy of the infobox ({{tl\|~~drugbox~~}}) taken from revid of page ] with values updated to verified values.}}		{{ambox \| text = This page contains a copy of the infobox ({{tl\|chembox}}) taken from revid of page ] with values updated to verified values.}}
	{{~~Drugbox~~		{{chembox
	\| Verifiedfields = changed		\| Verifiedfields = changed
	\| verifiedrevid = ~~400842250~~		\| verifiedrevid = 408789487
			\| Reference = <ref name="Merck"/>
	\| IUPAC_name = (2''R'',3''S'',4''R'',5''R'',6''S'')-5-amino-6-<br>oxy-3-hydroxy-5-(hydroxymethyl)oxolan-2-yl]oxy-<br>3-hydroxy-cyclohexyl]oxy-2-(hydroxymethyl)oxane-3,4-diol
			\| ImageFileL1 = Patulin.png
	\| image = Paromomycin structure.svg
	\| ~~width~~ = ~~300~~		\| ImageSizeL1 = 120px
			\| ImageFileR1=Patulin_3d_structure.png
	\| drug_name = Paromomycin
			\| ImageSizeR2 = 120px

			\| IUPACName = 4-hydroxy-4''H''-furopyran-2(6''H'')-one
	<!--Clinical data-->
			\| OtherNames = 2-Hydroxy-3,7-dioxabicyclonona-5,9-dien-8-one<br />
	\| tradename =
			Clairformin<br />Claviform<br />Expansine<br />Clavacin<br />Clavatin<br />Expansin<br />Gigantin<br />Leucopin<br />Patuline
	\| Drugs.com = {{drugs.com\|monograph\|paromomycin-sulfate}}
			\| Section1 = {{Chembox Identifiers
	\| MedlinePlus = a601098
	\| ~~pregnancy_US~~ = B		\| Abbreviations =
	\| legal_status = Rx only <small>]</small>
	\| routes_of_administration = Oral, ]

	<!--Pharmacokinetic data-->
	\| bioavailability = None
	\| metabolism = None
	\| elimination_half-life = ?
	\| excretion = Fecal

	<!--Identifiers-->
⚫	\| ~~CAS_number_Ref~~ = {{cascite\|correct\|??}}
	\| CAS_number = 1263-89-4
	\| ATC_prefix = A07
	\| ATC_suffix = AA06
⚫	\| PubChem = ~~441375~~
	\| DrugBank_Ref = {{drugbankcite\|changed\|drugbank}}
	\| DrugBank = DB01421
	\| ChemSpiderID_Ref = {{chemspidercite\|correct\|chemspider}}		\| ChemSpiderID_Ref = {{chemspidercite\|correct\|chemspider}}
	\| ChemSpiderID = ~~390117~~		\| ChemSpiderID = 4534
			\| InChI = 1/C7H6O4/c8-6-3-4-5(11-6)1-2-10-7(4)9/h1,3,7,9H,2H2
⚫	\| ChEMBL_Ref = {{ebicite\|~~changed~~\|EBI}}
			\| InChIKey = ZRWPUFFVAOMMNM-UHFFFAOYAU
⚫	\| ~~ChEMBL~~ = <!-- blanked - oldvalue: ~~370143~~ -->
		⚫	\| ChEMBL_Ref = {{ebicite\|correct\|EBI}}
	\| C=23 \| H=47 \| N=5 \| O=18 \| S=1
			\| ChEMBL = 294018
	\| molecular_weight = 615.629 g/mol
	\| smiles = O=S(=O)(O)O.O(3(O2O(CO)(O1O(CN)(O)(O)1N)2O)(O)(N)C3N)4O((O)(O)4N)CO
	\| InChI = 1/C23H45N5O14.H2O4S/c24-2-7-13(32)15(34)10(27)21(37-7)41-19-9(4-30)39-23(17(19)36)42-20-12(31)5(25)1-6(26)18(20)40-22-11(28)16(35)14(33)8(3-29)38-22;1-5(2,3)4/h5-23,29-36H,1-4,24-28H2;(H2,1,2,3,4)/t5-,6+,7+,8-,9-,10-,11-,12+,13-,14-,15-,16-,17-,18-,19-,20-,21-,22-,23+;/m1./s1
	\| InChIKey = LJRDOKAZOAKLDU-UDXJMMFXBW
	\| StdInChI_Ref = {{stdinchicite\|correct\|chemspider}}		\| StdInChI_Ref = {{stdinchicite\|correct\|chemspider}}
			\| StdInChI = 1S/C7H6O4/c8-6-3-4-5(11-6)1-2-10-7(4)9/h1,3,7,9H,2H2
	\| StdInChI = 1S/C23H45N5O14.H2O4S/c24-2-7-13(32)15(34)10(27)21(37-7)41-19-9(4-30)39-23(17(19)36)42-20-12(31)5(25)1-6(26)18(20)40-22-11(28)16(35)14(33)8(3-29)38-22;1-5(2,3)4/h5-23,29-36H,1-4,24-28H2;(H2,1,2,3,4)/t5-,6+,7+,8-,9-,10-,11-,12+,13-,14-,15-,16-,17-,18-,19-,20-,21-,22-,23+;/m1./s1
	\| StdInChIKey_Ref = {{stdinchicite\|correct\|chemspider}}		\| StdInChIKey_Ref = {{stdinchicite\|correct\|chemspider}}
	\| StdInChIKey = ~~LJRDOKAZOAKLDU~~-~~UDXJMMFXSA~~-N		\| StdInChIKey = ZRWPUFFVAOMMNM-UHFFFAOYSA-N
		⚫	\| CASNo_Ref = {{cascite\|correct\|CAS}}
			\| CASNo = 149-29-1
			\| EINECS = 205-735-2
		⚫	\| PubChem = 4696
			\| KEGG_Ref = {{keggcite\|changed\|kegg}}
		⚫	\| KEGG = <!-- blanked - oldvalue: C16748 -->
			\| UNII_Ref = {{fdacite\|changed\|FDA}}
			\| UNII = 95X2BV4W8R
			\| SMILES = O=C\1O/C2=C/COC(O)C2=C/1
			\| InChI =
			\| RTECS =
			\| MeSHName =
			\| ChEBI_Ref = {{ebicite\|correct\|EBI}}
			\| ChEBI =
			\| ATCCode_prefix =
			\| ATCCode_suffix =
			\| ATC_Supplemental =}}
			\| Section2 = {{Chembox Properties
			\| C=7\|H=6\|O=4
			\| MolarMass = 154.12 g/mol
			\| Appearance = Compact prisms
			\| Density =
			\| MeltingPtC = 110
			\| Melting_notes =
			\| BoilingPt =
			\| Boiling_notes =
			\| Solubility = Soluble
			\| SolubleOther =
			\| Solvent =
			\| pKa =
			\| pKb = }}
			\| Section7 = {{Chembox Hazards
			\| EUClass =
			\| EUIndex =
			\| MainHazards =
			\| NFPA-H =
			\| NFPA-F =
			\| NFPA-R =
			\| NFPA-O =
			\| RPhrases =
			\| SPhrases =
			\| RSPhrases =
			\| FlashPt =
			\| Autoignition =
			\| ExploLimits =
			\| PEL = }}
	}}		}}