Revision as of 11:32, 5 December 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,084 edits Saving copy of the {{drugbox}} taken from revid 462576927 of page Panadiplon for the Chem/Drugbox validation project (updated: 'CAS_number').← Previous edit |
Revision as of 11:32, 5 December 2011 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,084 edits Saving copy of the {{drugbox}} taken from revid 452187380 of page Papaverine for the Chem/Drugbox validation project (updated: 'DrugBank').Next edit → |
Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{Drugbox |
|
{{Drugbox |
|
⚫ |
| verifiedrevid = 420028570 |
|
| Verifiedfields = changed |
|
|
|
| IUPAC_name = 1-(3,4-dimethoxybenzyl)-6,7-dimethoxyisoquinoline |
⚫ |
| verifiedrevid = 462272462 |
|
|
|
| image = Papaverin - Papaverine.svg |
|
| IUPAC_name = 3-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)-5 -propan-2-ylimidazoquinoxalin-4-one |
|
|
| image = Panadiplon.svg |
|
| width = 200px |
|
|
| image2 = Papaverine-from-xtal-3D-balls-B.png |
|
| width = 150 |
|
|
|
| width2 = 200px |
|
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
|
| tradename = |
|
| tradename = Pavabid |
|
|
| Drugs.com = {{drugs.com|monograph|papaverine-hydrochloride}} |
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
|
|
| MedlinePlus = a682707 |
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
|
| pregnancy_category = |
|
| pregnancy_category = ]: C{{Ref_label|4|4|a}} |
|
|
| routes_of_administration = Oral, ], ], rectal,{{Ref_label|5|5|a}} ] |
|
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
|
|
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
|
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> |
|
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
|
| legal_status = |
|
|
| routes_of_administration = |
|
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
<!--Pharmacokinetic data--> |
|
| bioavailability = |
|
| bioavailability = 80%{{Ref_label|3|3|a}} |
|
| protein_bound = |
|
| protein_bound = ~90% |
|
| metabolism = |
|
| metabolism = ]{{Ref_label|3|3|b}} |
|
| elimination_half-life = |
|
| elimination_half-life = 1.5–2 hours{{Ref_label|3|3|c}} |
|
| excretion = |
|
| excretion = ]{{Ref_label|3|3|d}} |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
| CAS_number_Ref = {{cascite|changed|??}} |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CAS_number = <!-- blanked - oldvalue: 124423-84-3 --> |
|
| CAS_number = 58-74-2 |
|
|
| CAS_supplemental = <br/>61-25-6 (hydrochloride) <!-- Also CAS verified --> |
|
| ATC_prefix = none |
|
|
| ATC_suffix = |
|
| ATC_prefix = A03 |
|
| PubChem = 3033821 |
|
| ATC_suffix = AD01 |
|
|
| ATC_supplemental = {{ATC|G04|BE02}} |
|
|
| PubChem = 4680 |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank = |
|
| DrugBank = DB01113 |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 2298411 |
|
| ChemSpiderID = 4518 |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = V4PW0S7ZP7 |
|
| UNII = DAA13NKG2Q |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG = D05346 |
|
| KEGG = D07425 |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL = 279867 |
|
| ChEMBL = 19224 |
|
|
|
|
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| C=18 | H=17 | N=5 | O=2 |
|
| C=20 | H=21 | N=1 | O=4 |
|
| molecular_weight = 335.36 g/mol |
|
| molecular_weight = 339.385 g/mol{{Ref_label|1|1|c}} |
|
| smiles = O=C4N(c5ccccc5n3cnc(c1nc(on1)C2CC2)c34)C(C)C |
|
| smiles = COc1ccc(cc1OC)Cc2c3cc(c(cc3ccn2)OC)OC |
|
| InChI = 1/C18H17N5O2/c1-10(2)23-13-6-4-3-5-12(13)22-9-19-14(15(22)18(23)24)16-20-17(25-21-16)11-7-8-11/h3-6,9-11H,7-8H2,1-2H3 |
|
| InChI = 1/C20H21NO4/c1-22-17-6-5-13(10-18(17)23-2)9-16-15-12-20(25-4)19(24-3)11-14(15)7-8-21-16/h5-8,10-12H,9H2,1-4H3 |
|
| InChIKey = ZGEGOFCLSWVVKG-UHFFFAOYAS |
|
| InChIKey = XQYZDYMELSJDRZ-UHFFFAOYAJ |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C18H17N5O2/c1-10(2)23-13-6-4-3-5-12(13)22-9-19-14(15(22)18(23)24)16-20-17(25-21-16)11-7-8-11/h3-6,9-11H,7-8H2,1-2H3 |
|
| StdInChI = 1S/C20H21NO4/c1-22-17-6-5-13(10-18(17)23-2)9-16-15-12-20(25-4)19(24-3)11-14(15)7-8-21-16/h5-8,10-12H,9H2,1-4H3 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = ZGEGOFCLSWVVKG-UHFFFAOYSA-N |
|
| StdInChIKey = XQYZDYMELSJDRZ-UHFFFAOYSA-N |
|
}} |
|
}} |