Misplaced Pages:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions

< Misplaced Pages:WikiProject Chemicals | Chembox validation Browse history interactively ← Previous edit Next edit →Content deleted Content addedVisual WikitextInline

Revision as of 11:48, 5 December 2011 editBeetstra (talk \| contribs)Edit filter managers, Administrators172,084 edits Saving copy of the {{chembox}} taken from revid 433294208 of page Perchloryl_fluoride for the Chem/Drugbox validation project (updated: 'CASNo').← Previous edit		Revision as of 11:48, 5 December 2011 edit undoBeetstra (talk \| contribs)Edit filter managers, Administrators172,084 edits Saving copy of the {{chembox}} taken from revid 455212176 of page Perfluorobutanesulfonic_acid for the Chem/Drugbox validation project (updated: 'CASNo').Next edit →
Line 1:		Line 1:
	{{ambox \| text = This page contains a copy of the infobox ({{tl\|chembox}}) taken from revid of page ] with values updated to verified values.}}		{{ambox \| text = This page contains a copy of the infobox ({{tl\|chembox}}) taken from revid of page ] with values updated to verified values.}}
	{{~~chembox~~		{{Chembox
	\| verifiedrevid = ~~400844424~~		\| verifiedrevid = 455210813
			\| ImageFile = Perfluorobutanesulfonic acid.svg
	\| Name = Perchloryl fluoride
			\| ImageSize = 210px
	\| ImageFileL1 = Perchloryl-fluoride-2D.png
			\| PIN = Perfluorobutanesulfonic acid
	\| ImageSizeL1 = 120px
			\| SystematicName = 1,1,2,2,3,3,4,4,4-Nonafluorobutane-1-sulfonic acid
	\| ImageNameL1 = Perchloryl fluoride
			\| OtherNames = FC-98<br />
	\| ImageFileR1 = Perchloryl-fluoride-3D-vdW.png
			Nonaflate<br />
	\| ImageSizeR1 = 120px
			Nonafluorobutanesulphonic acid<br />
	\| ImageName1 = Perchloryl fluoride
			Perfluorobutane sulfonate<br />
	\| IUPACName = Perchloryl fluoride
			PFBS
	\| OtherNames = Chlorine oxyfluoride, Perchlorofluoride, Chlorine fluorine oxide, Trioxychlorofluoride, Perchloric acid fluoride
	\| Section1 = {{Chembox Identifiers		\| Section1 = {{Chembox Identifiers
		⚫	\| CASNo = <!-- blanked - oldvalue: 375-73-5 -->
	\| SMILES = FCl(=O)(=O)=O
			\| CASOther = 59933-66-3
		⚫	\| PubChem = 67815
			\| PubChem_Ref = {{pubchemcite}}
		⚫	\| ChemSpiderID = 61132
	\| ChemSpiderID_Ref = {{chemspidercite\|correct\|chemspider}}		\| ChemSpiderID_Ref = {{chemspidercite\|correct\|chemspider}}
			\| EINECS = 206-793-1
⚫	\| ChemSpiderID = ~~22680~~
			\| UNNumber = 3094, 3265
	\| InChI = 1/ClFO3/c2-1(3,4)5
		⚫	\| RTECS = EK5930000
	\| InChIKey = XHFXMNZYIKFCPN-UHFFFAOYAO
	\| StdInChI_Ref = {{stdinchicite\|correct\|chemspider}}		\| StdInChI_Ref = {{stdinchicite\|correct\|chemspider}}
	\| StdInChI = 1S/~~ClFO3~~/c2-1(3,4)5		\| StdInChI = 1S/C4HF9O3S/c5-1(6,3(9,10)11)2(7,8)4(12,13)17(14,15)16/h(H,14,15,16)
	\| StdInChIKey_Ref = {{stdinchicite\|correct\|chemspider}}		\| StdInChIKey_Ref = {{stdinchicite\|correct\|chemspider}}
	\| StdInChIKey = ~~XHFXMNZYIKFCPN~~-UHFFFAOYSA-N		\| StdInChIKey = JGTNAGYHADQMCM-UHFFFAOYSA-N
			\| SMILES = OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F
⚫	\| CASNo = <!-- blanked - oldvalue: ~~7616~~-94-6 -->
			\| InChI = 1S/C4HF9O3S/c5-1(6,3(9,10)11)2(7,8)4(12,13)17(14,15)16/h(H,14,15,16)
⚫	\| PubChem = ~~24258~~
			\| InChIKey = JGTNAGYHADQMCM-UHFFFAOYSA-N}}
⚫	\| RTECS = ~~SD1925000~~
	}}
	\| Section2 = {{Chembox Properties		\| Section2 = {{Chembox Properties
	\| Formula = ~~ClFO~~<sub>3<sub>		\| Formula = C<sub>4</sub>HF<sub>9</sub>O<sub>3</sub>S
	\| MolarMass = ~~102~~.~~4496~~ g/mol		\| MolarMass = 300.10 g/mol
		⚫	\| Density =
	\| Appearance = Colorless gas
	\| ~~Density~~ = ~~1.4 g/cm<sup>3</sup>~~		\| Solvent =
			\| SolubleOther =
	\| Solubility = 0.06 g/100 ml (20 °C)
			\| MeltingPt = 76–84 °C<ref>{{cite web \|url=http://www.chemexper.com/chemicals/supplier/cas/59933-66-3.html \|title=Nonafluorobutanesulphonic acid - 59933-66-3 Catalog of Chemical Suppliers \|format= \|work= \|accessdate=16 January 2009}}</ref>
	\| MeltingPtC = −147.8
			\| BoilingPt = 211 °C <ref name="ChemID"></ref>}}
	\| BoilingPtC = −46.7
		⚫	\| Section3 = {{Chembox Hazards
	\| pKa =
	\| ~~pKb~~ =		\| EUClass = Corrosive ('''C''')
			\| RPhrases = {{R34}}<ref>{{cite web \|url=http://www.apolloscientific.co.uk/downloads/msds/PC9086_msds.pdf \|title=Safety Data Sheet-Nonafluorobutanesulphonic acid \|format= \|work= \|accessdate=16 January 2009}}</ref>
	\| Viscosity =
	}}
	\| Section3 = {{Chembox Structure
	\| MolShape = Tetrahedral<ref name="emeleus1976"/>{{rp\|373}}
⚫	\| ~~Dipole~~ =
	}}
	\| Section4 = {{Chembox Thermochemistry
	\| DeltaHf = −5.7<ref name="emeleus1976">{{cite book \| title = Advances in inorganic chemistry and radiochemistry, Volume 18 \| author1 = ] \| author2 = A. G. Sharpe \| publisher = Academic Press \| year = 1976 \| isbn = 0120236184 }}</ref>{{rp\|380}}
	\| DeltaHc =
	\| Entropy =
	\| HeatCapacity = }}
⚫	\| ~~Section7~~ = {{Chembox Hazards
	\| ExternalMSDS =
	\| MainHazards = Corrosive, oxidizing, toxic
	\| FlashPt =
	\| RPhrases =
	\| SPhrases =
	\| NFPA-H = 3
	\| NFPA-F = 2
	\| NFPA-R = 3
	\| NFPA-O = OX
	\| TLV = 3 ppm
	}}
	\| Section8 = {{Chembox Related
	\| OtherAnions =
	\| OtherCations =
	\| OtherCpds =
	}}		}}
	}}		}}

Revision as of 11:48, 5 December 2011

This page contains a copy of the infobox ({{chembox}}) taken from revid 455212176 of page Perfluorobutanesulfonic_acid with values updated to verified values.

WikiProject Chemicals/Chembox validation/VerifiedDataSandbox
Names

Preferred IUPAC name Perfluorobutanesulfonic acid
Systematic IUPAC name 1,1,2,2,3,3,4,4,4-Nonafluorobutane-1-sulfonic acid
Other names FC-98 Nonaflate Nonafluorobutanesulphonic acid Perfluorobutane sulfonate PFBS
Identifiers
3D model (JSmol)	Interactive image
ChemSpider	61132
EC Number	206-793-1
PubChem CID	67815
RTECS number	EK5930000
UN number	3094, 3265
InChI InChI=1S/C4HF9O3S/c5-1(6,3(9,10)11)2(7,8)4(12,13)17(14,15)16/h(H,14,15,16)Key: JGTNAGYHADQMCM-UHFFFAOYSA-N InChI=1S/C4HF9O3S/c5-1(6,3(9,10)11)2(7,8)4(12,13)17(14,15)16/h(H,14,15,16)Key: JGTNAGYHADQMCM-UHFFFAOYSA-N
SMILES OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F
Properties
Chemical formula	C₄HF₉O₃S
Molar mass	300.10 g/mol
Melting point	76–84 °C
Boiling point	211 °C
Except where otherwise noted, data are given for materials in their standard state (at 25 °C , 100 kPa). Y verify (what is ?) Infobox references

Tracking categories (test):

SizeSet

Chemical compound

"Nonafluorobutanesulphonic acid - 59933-66-3 Catalog of Chemical Suppliers". Retrieved 16 January 2009.
Nonafluorobutanesulfonic acid at ChemIDplus