Revision as of 12:01, 5 December 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 458438144 of page Phenazocine for the Chem/Drugbox validation project (updated: 'CAS_number').← Previous edit |
Revision as of 12:01, 5 December 2011 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 456749768 of page Phenazone for the Chem/Drugbox validation project (updated: '').Next edit → |
Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{Drugbox |
|
{{Drugbox |
|
| Verifiedfields = changed |
|
| Verifiedfields = changed |
|
| verifiedrevid = 458437102 |
|
| verifiedrevid = 408804905 |
|
| IUPAC_name = (2''R'',6''R'',11''R'')- 6,11-dimethyl- 3-(2-phenylethyl)- 1,2,3,4,5,6-hexahydro- 2,6-methano- 3-benzazocin- 8-ol |
|
| IUPAC_name = 1,2-dihydro- 1,5-dimethyl- 2-phenyl- 3''H''-pyrazol- 3-one |
|
| image = Phenazocine.png |
|
| image = Phenazone.svg |
|
| width = 180 |
|
| width = 200 |
|
|
| drug_name = Antipyrine |
|
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
|
| tradename = |
|
| tradename = |
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
|
| pregnancy_category = |
|
| pregnancy_category = |
|
| legal_AU = <!-- S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
|
|
| legal_CA = |
|
|
| legal_UK = Class A, Withdrawn |
|
|
| legal_US = Schedule II |
|
|
| legal_status = |
|
| legal_status = |
|
| routes_of_administration = Oral |
|
| routes_of_administration = |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
<!--Pharmacokinetic data--> |
|
| bioavailability = |
|
| bioavailability = |
|
| protein_bound = |
|
| metabolism = |
|
| excretion = |
|
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
| CAS_number_Ref = {{cascite|changed|??}} |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number = <!-- blanked - oldvalue: 127-35-5 --> |
|
|
|
| CAS_number = 60-80-0 |
|
| ATC_prefix = N02 |
|
| ATC_prefix = N02 |
|
| ATC_suffix = AD02 |
|
| ATC_suffix = BB01 |
|
|
| ATC_supplemental = {{ATC|S02|DA03}} |
|
| PubChem = 14707 |
|
| PubChem = 2206 |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank = |
|
| DrugBank = DB01435 |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 14031 |
|
| ChemSpiderID = 2121 |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = J0ND6N0AQC |
|
| UNII = T3CHA1B51H |
|
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
|
| KEGG = D01776 |
|
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEBI = 31225 |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL = 46399 |
|
| ChEMBL = 277474 |
|
|
|
|
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| C=22 | H=27 | N=1 | O=1 |
|
| C=11 | H=12 | N=2 | O=1 |
|
| molecular_weight = 321.45588 g/mol |
|
| molecular_weight = 188.226 g/mol |
|
| smiles = Oc1ccc4c(c1)C2(C(C(N(CC2)CCc3ccccc3)C4)C)C |
|
| smiles = O=C2\C=C(/N(N2c1ccccc1)C)C |
|
| InChI = 1/C22H27NO/c1-16-21-14-18-8-9-19(24)15-20(18)22(16,2)11-13-23(21)12-10-17-6-4-3-5-7-17/h3-9,15-16,21,24H,10-14H2,1-2H3 |
|
| InChI = 1/C11H12N2O/c1-9-8-11(14)13(12(9)2)10-6-4-3-5-7-10/h3-8H,1-2H3 |
|
| InChIKey = ZQHYKVKNPWDQSL-UHFFFAOYAO |
|
| InChIKey = VEQOALNAAJBPNY-UHFFFAOYAS |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C22H27NO/c1-16-21-14-18-8-9-19(24)15-20(18)22(16,2)11-13-23(21)12-10-17-6-4-3-5-7-17/h3-9,15-16,21,24H,10-14H2,1-2H3 |
|
| StdInChI = 1S/C11H12N2O/c1-9-8-11(14)13(12(9)2)10-6-4-3-5-7-10/h3-8H,1-2H3 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = ZQHYKVKNPWDQSL-UHFFFAOYSA-N |
|
| StdInChIKey = VEQOALNAAJBPNY-UHFFFAOYSA-N |
|
| synonyms = Fenazocina, Phenazocinum, DEA No. 9715 |
|
| synonyms = analgesine, antipyrine |
|
}} |
|
}} |