Misplaced Pages

:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions - Misplaced Pages

Article snapshot taken from[REDACTED] with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
< Misplaced Pages:WikiProject Chemicals | Chembox validation Browse history interactively← Previous editNext edit →Content deleted Content addedVisualWikitext
Revision as of 12:54, 5 December 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,084 edits Saving copy of the {{chembox}} taken from revid 442487459 of page Phosphorine for the Chem/Drugbox validation project (updated: 'CASNo').← Previous edit Revision as of 12:55, 5 December 2011 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,084 edits Saving copy of the {{chembox}} taken from revid 454142852 of page Phosphorous_acid for the Chem/Drugbox validation project (updated: '').Next edit →
Line 1: Line 1:
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} {{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}}
{{Chembox {{Chembox
| verifiedrevid = 415959260 | verifiedrevid = 451036575
| ImageFileL1 = Phosphorine-skeletal.svg | ImageFileL1 = Phosphonic-acid-2D-dimensions.png
| ImageSizeL1 = 120px
| ImageFileL1_Ref = {{chemboximage|correct|??}}
| ImageNameL1 = Wireframe model of phosphorous acid
| ImageSizeL1 = 121
| ImageFileR1 = Phosphonic-acid-3D-balls-A.png
| ImageNameL1 = Kekulé skeletal formula of phosphorine
| ImageSizeR1 = 120px
| ImageFileR1 = Phosphabenzene-Spartan-MP2-3D-balls.png
| ImageNameR1 = Ball and stick model of phosphorous acid
| ImageFileR1_Ref = {{chemboximage|correct|??}}
| IUPACName = phosphonic acid
| ImageSizeR1 = 121
| OtherNames = Dihydroxyphosphine oxide<br />
| ImageNameR1 = Aromatic ball and stick model of phosphorine
Dihydroxy(oxo)-λ<sup>5</sup>-phosphane<br />
| SystematicName = Phosphinine<ref>{{Cite web|title = Phosphate-Binding Proteolipid - Compound Summary|url = http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=123046|work = The PubChem Project|location = USA|publisher = National Center of Biotechnology Information}}</ref>
Dihydroxy-λ<sup>5</sup>-phosphanone<br />
| OtherNames = Phosphabenzene
Orthophosphorous acid<br />
| Section1 = {{Chembox Identifiers
Oxo-λ<sup>5</sup>-phosphanediol<br />
| CASNo = <!-- blanked - oldvalue: 289-68-9 -->
Oxo-λ<sup>5</sup>-phosphonous acid
| CASNo_Ref = {{cascite|correct|??}}
| Section1 = {{Chembox Identifiers
| PubChem = 123046
| PubChem_Ref = {{Pubchemcite|correct|PubChem}} | KEGG_Ref = {{keggcite|correct|kegg}}
| ChemSpiderID = 109668 | KEGG = C06701
| InChI = 1/H3O3P/c1-4(2)3/h4H,(H2,1,2,3)
| InChIKey = ABLZXFCXXLZCGV-UHFFFAOYAF
| CASNo = 13598-36-2
| CASNo_Ref = {{cascite|correct|CAS}}
| ChemSpiderID = 10449259
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID1 = 10459438
| MeSHName = Phosphinine
| ChemSpiderID1_Comment = (<sup>17</sup>''O''<sup>3</sup>)
| SMILES = C1=CC=PC=C1
| ChemSpiderID1_Ref = {{Chemspidercite}}
| SMILES1 = c1ccpcc1
| RTECS = SZ6400000
| StdInChI = 1S/C5H5P/c1-2-4-6-5-3-1/h1-5H
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} | ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 44976
| InChI = 1/C5H5P/c1-2-4-6-5-3-1/h1-5H
| SMILES = OP(=O)O
| StdInChIKey = UNQNIRQQBJCMQR-UHFFFAOYSA-N
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/H3O3P/c1-4(2)3/h4H,(H2,1,2,3)
| InChIKey = UNQNIRQQBJCMQR-UHFFFAOYAZ
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
}}
| StdInChIKey = ABLZXFCXXLZCGV-UHFFFAOYSA-N}}
| Section2 = {{Chembox Properties | Section2 = {{Chembox Properties
| C = 5
| Formula = H<sub>3</sub>PO<sub>3</sub>
| H = 5
| P = 1 | MolarMass = 82.00 g/mol
| Appearance = white solid <br> ]
| ExactMass = 96.012886672 g mol<sup>-1</sup>
| Density = 1.651 g/cm<sup>3</sup> (21 °C)
}}
| Solubility = 310 g/100 mL
| Section3 = {{Chembox Related
| SolubleOther = soluble in ]
| Function = -ines
| MeltingPtC = 73.6
| OtherFunctn = ]<br />
| BoilingPt = 200 °C (decomp)
]<br />
}}<!--
]
| ] (p''K''<sub>a1</sub>)
| OtherCpds = ]
| 2.0
}}
|-
| ] (p''K''<sub>a2</sub>)
| 6.7
|-

-->
| Section3 = {{Chembox Structure
| MolShape = tetrahedral
| CrystalStruct =
| Dipole =
}}
| Section7 = {{Chembox Hazards
| ExternalMSDS =
| MainHazards = skin irritant
| NFPA-H = 2
| NFPA-R = 1
| NFPA-F = 0
| RPhrases = 22-35
| SPhrases = 26-36/37/39-45
}}
| Section8 = {{Chembox Related
| Function = ]
| OtherFunctn =
| OtherCpds = ] (i.e., PO(OH)<sub>3</sub>)<br />] (i.e., H<sub>2</sub>PO(OH))
}}
}} }}

Revision as of 12:55, 5 December 2011

This page contains a copy of the infobox ({{chembox}}) taken from revid 454142852 of page Phosphorous_acid with values updated to verified values.
WikiProject Chemicals/Chembox validation/VerifiedDataSandbox
Wireframe model of phosphorous acid
Wireframe model of phosphorous acid
Ball and stick model of phosphorous acid
Ball and stick model of phosphorous acid
Names
IUPAC name phosphonic acid
Other names Dihydroxyphosphine oxide

Dihydroxy(oxo)-λ-phosphane
Dihydroxy-λ-phosphanone
Orthophosphorous acid
Oxo-λ-phosphanediol

Oxo-λ-phosphonous acid
Identifiers
CAS Number
3D model (JSmol)
ChEBI
ChemSpider
KEGG
RTECS number
  • SZ6400000
InChI
  • InChI=1S/H3O3P/c1-4(2)3/h4H,(H2,1,2,3)Key: ABLZXFCXXLZCGV-UHFFFAOYSA-N
  • InChI=1/H3O3P/c1-4(2)3/h4H,(H2,1,2,3)Key: ABLZXFCXXLZCGV-UHFFFAOYAF
SMILES
  • OP(=O)O
Properties
Chemical formula H3PO3
Molar mass 82.00 g/mol
Appearance white solid
deliquescent
Density 1.651 g/cm (21 °C)
Melting point 73.6 °C (164.5 °F; 346.8 K)
Boiling point 200 °C (decomp)
Solubility in water 310 g/100 mL
Solubility soluble in alcohol
Structure
Molecular shape tetrahedral
Hazards
Occupational safety and health (OHS/OSH):
Main hazards skin irritant
NFPA 704 (fire diamond)
NFPA 704 four-colored diamondHealth 2: Intense or continued but not chronic exposure could cause temporary incapacitation or possible residual injury. E.g. chloroformFlammability 0: Will not burn. E.g. waterInstability 1: Normally stable, but can become unstable at elevated temperatures and pressures. E.g. calciumSpecial hazards (white): no code
2 0 1
Related compounds
Except where otherwise noted, data are given for materials in their standard state (at 25 °C , 100 kPa). checkverify (what is  ?) Infobox references
Tracking categories (test):
Chemical compound
Misplaced Pages:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions Add topic