Revision as of 14:14, 5 December 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 453649135 of page Prephenic_acid for the Chem/Drugbox validation project (updated: 'CASNo').← Previous edit |
Revision as of 14:14, 5 December 2011 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 444066147 of page Prephytoene_diphosphate for the Chem/Drugbox validation project (updated: 'CASNo').Next edit → |
Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{chembox |
|
{{chembox |
|
| verifiedrevid = 440835385 |
|
| verifiedrevid = 444064303 |
|
|ImageFile=Prephenic acid.svg |
|
|ImageFile=Prephytoene diphosphate.png |
|
|ImageSize=150px |
|
|ImageSize=250px |
|
|
|IUPACName=-2-cyclopropyl]methyl phosphono hydrogen phosphate |
|
|IUPACName=1-(2-Carboxy-2-oxoethyl)-4-hydroxycyclohexa-2,5-dienecarboxylic acid |
|
|
|
|OtherNames=Prephytoene pyrophosphate |
|
|OtherNames=Prephenate; ''cis''-1-Carboxy-4-hydroxy-α-oxo-2,5-cyclohexadiene-1-propanoic acid |
|
|
|Section1= {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 16735981 |
|
| ChemSpiderID = 4517882 |
|
|
| InChI = 1/C40H68O7P2/c1-31(2)17-11-19-33(5)21-13-23-35(7)25-15-26-37(9)29-38-39(30-46-49(44,45)47-48(41,42)43)40(38,10)28-16-27-36(8)24-14-22-34(6)20-12-18-32(3)4/h17-18,21-22,25,27,29,38-39H,11-16,19-20,23-24,26,28,30H2,1-10H3,(H,44,45)(H2,41,42,43)/b33-21+,34-22+,35-25+,36-27+,37-29+ |
|
| InChI = 1/C10H10O6/c11-6-1-3-10(4-2-6,9(15)16)5-7(12)8(13)14/h1-4,6,11H,5H2,(H,13,14)(H,15,16)/t6-,10+ |
|
|
| InChIKey = FPWMCUPFBRFMLH-XGAOUMNUBN |
|
| InChIKey = RVCNKTPCHZNAAO-QKUGLALCBM |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
|
| StdInChI = 1S/C40H68O7P2/c1-31(2)17-11-19-33(5)21-13-23-35(7)25-15-26-37(9)29-38-39(30-46-49(44,45)47-48(41,42)43)40(38,10)28-16-27-36(8)24-14-22-34(6)20-12-18-32(3)4/h17-18,21-22,25,27,29,38-39H,11-16,19-20,23-24,26,28,30H2,1-10H3,(H,44,45)(H2,41,42,43)/b33-21+,34-22+,35-25+,36-27+,37-29+ |
|
| StdInChI = 1S/C10H10O6/c11-6-1-3-10(4-2-6,9(15)16)5-7(12)8(13)14/h1-4,6,11H,5H2,(H,13,14)(H,15,16)/t6-,10+ |
|
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = FPWMCUPFBRFMLH-XGAOUMNUSA-N |
|
| StdInChIKey = RVCNKTPCHZNAAO-QKUGLALCSA-N |
|
| CASNo = <!-- blanked - oldvalue: 126-49-8 --> |
|
| CASNo = <!-- blanked - oldvalue: 38005-61-7 --> |
|
⚫ |
| PubChem = 5365949 |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
| CASNo_Comment = (unspecified) |
|
|
|
| ChEBI = 14885 |
|
| CASNo1=87664-40-2 |
|
|
|
| SMILES = O=P(O)(O)OP(=O)(O)OCC1C(\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)C)C1(CC/C=C(/CC\C=C(/C)CC\C=C(/C)C)C)C |
|
| CASNo1_Ref = {{cascite|correct|CAS}} |
|
|
⚫ |
}} |
|
| CASNo1_Comment = (''cis'') |
|
|
⚫ |
|Section2={{Chembox Properties |
⚫ |
| PubChem=1028 |
|
|
|
| Formula=C<sub>40</sub>H<sub>68</sub>O<sub>7</sub>P<sub>2</sub> |
|
| SMILES = O=C(O)/1(CC(=O)C(O)=O)\C=C/(O)\C=C\1 |
|
|
|
| MolarMass=722.91 g/mol |
|
| MeSHName=Prephenic+acid |
|
⚫ |
}} |
|
⚫ |
|Section2= {{Chembox Properties |
|
|
| C=10|H=10|O=6 |
|
|
| Appearance= |
|
| Appearance= |
|
| Density= |
|
| Density= |
Line 33: |
Line 30: |
|
| Solubility= |
|
| Solubility= |
|
}} |
|
}} |
|
|Section3= {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |