Revision as of 14:37, 5 December 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,084 edits Saving copy of the {{drugbox}} taken from revid 459941314 of page Propranolol for the Chem/Drugbox validation project (updated: '').← Previous edit | Revision as of 14:38, 5 December 2011 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,084 edits Saving copy of the {{chembox}} taken from revid 460199104 of page Propyl_acetate for the Chem/Drugbox validation project (updated: '').Next edit → | ||
Line 1: | Line 1: | ||
{{ambox | text = This page contains a copy of the infobox ({{tl| |
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} | ||
{{chembox | |||
| Verifiedfields = changed | |||
| Watchedfields = changed | | Watchedfields = changed | ||
| verifiedrevid = |
| verifiedrevid = 417944019 | ||
| Name = Propyl acetate | |||
| IUPAC_name = (''RS'')-1-(1-methylethylamino)-3-(1-naphthyloxy)propan-2-ol | |||
⚫ | | ImageFile_Ref = {{chemboximage|correct|??}} | ||
| image = Propranolol-2D-skeletal.png | |||
| ImageFile = Propyl acetate.png | |||
| width = 280 | |||
<!-- | ImageSize = 200px --> | |||
| image2 = Propranolol-from-xtal-3D-balls.png | |||
| ImageName = Propyl acetate | |||
| width2 = 150 | |||
| IUPACName = Propyl ethanoate | |||
| imagename = 1 : 1 mixture (racemate) | |||
| OtherNames = Propyl acetate<br />n-Propyl ethanoate</br>n-Propyl acetate</br>Propylacetate</br>Acetic acid, propyl ester</br>n-Propyl ester of acetic acid | |||
| drug_name = Propranolol | |||
| Section1 = {{Chembox Identifiers | |||
⚫ | | DrugBank_Ref = {{drugbankcite|changed|drugbank}} | ||
<!--Clinical data--> | |||
| |
| DrugBank = DB01670 | ||
| SMILES = O=C(OCCC)C | |||
| Drugs.com = {{drugs.com|monograph|propranolol-hydrochloride}} | |||
⚫ | | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ||
| licence_US = Propranolol | |||
| |
| ChemSpiderID = 7706 | ||
| |
| PubChem = 7997 | ||
| legal_AU = S4 | |||
| legal_UK = POM | |||
| legal_US = Rx-only | |||
| routes_of_administration = oral, ] | |||
<!--Pharmacokinetic data--> | |||
| bioavailability = 26% | |||
| metabolism = ] (extensive) | |||
| elimination_half-life = 4-5 hours | |||
| excretion = ] <1% | |||
<!--Identifiers--> | |||
⚫ | | CASNo_Ref = {{cascite|correct|CAS}} | ||
⚫ | | |
||
| CAS_number = 525-66-6 | |||
| ATC_prefix = C07 | |||
| ATC_suffix = AA05 | |||
| PubChem = 4946 | |||
| IUPHAR_ligand = 564 | |||
⚫ | | DrugBank_Ref = {{drugbankcite| |
||
| DrugBank = DB00571 | |||
⚫ | | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ||
| ChemSpiderID = 4777 | |||
| UNII_Ref = {{fdacite|correct|FDA}} | | UNII_Ref = {{fdacite|correct|FDA}} | ||
| UNII = |
| UNII = 4AWM8C91G6 | ||
| InChI = 1/C5H10O2/c1-3-4-7-5(2)6/h3-4H2,1-2H3 | |||
| KEGG_Ref = {{keggcite|correct|kegg}} | |||
| InChIKey = YKYONYBAUNKHLG-UHFFFAOYAC | |||
| KEGG = D08443 | |||
| ChEBI_Ref = {{ebicite|changed|EBI}} | |||
| ChEBI = 8499 | |||
| ChEMBL_Ref = {{ebicite|correct|EBI}} | | ChEMBL_Ref = {{ebicite|correct|EBI}} | ||
| ChEMBL = |
| ChEMBL = 44857 | ||
<!--Chemical data--> | |||
| C=16 | H=21 | N=1 | O=2 | |||
| molecular_weight = 259.34 g/mol | |||
| smiles = CC(C)NCC(COc1cccc2c1cccc2)O | |||
| InChI = 1/C16H21NO2/c1-12(2)17-10-14(18)11-19-16-9-5-7-13-6-3-4-8-15(13)16/h3-9,12,14,17-18H,10-11H2,1-2H3 | |||
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} | | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | ||
| StdInChI = 1S/ |
| StdInChI = 1S/C5H10O2/c1-3-4-7-5(2)6/h3-4H2,1-2H3 | ||
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | ||
| StdInChIKey = |
| StdInChIKey = YKYONYBAUNKHLG-UHFFFAOYSA-N | ||
⚫ | | CASNo_Ref = {{cascite|correct|CAS}} | ||
| CASNo = 109-60-4 | |||
}} | |||
| Section2 = {{Chembox Properties | |||
| Formula = C<sub>5</sub>H<sub>10</sub>O<sub>2</sub> | |||
| MolarMass = 102.131 g/mol | |||
| Appearance = Clear, colourless liquid | |||
| Density = 0.888 g/cm<sup>3</sup>, liquid | |||
| MeltingPt = −95 °C (178 K) | |||
| BoilingPt = 102 °C (374.8 K) | |||
}} | |||
| Section7 = {{Chembox Hazards | |||
| ExternalMSDS = | |||
| EUClass = Flammable ('''F''')<br />Irritant ('''Xi''') | |||
| NFPA-H = 2 | |||
| NFPA-F = 3 | |||
| NFPA-R = | |||
| RPhrases = {{R11}}, {{R36}} | |||
| SPhrases = {{S2}}, {{S16}}, {{S26}}, {{S29}},<br /> {{S33}} | |||
| FlashPt = 13-14 °C | |||
| Autoignition = 450 °C | |||
}}<!-- | |||
| LEL/UEL | |||
| 1.7-8% @ 38 °C | |||
|- | |||
--> | |||
| Section8 = {{Chembox Related | |||
| Function = ]s | |||
| OtherFunctn = ]<br />''n''-]<br />] | |||
| OtherCpds = ]<br /> ] | |||
}} | |||
}} | }} |
Revision as of 14:38, 5 December 2011
This page contains a copy of the infobox ({{chembox}}) taken from revid 460199104 of page Propyl_acetate with values updated to verified values. |
Names | |
---|---|
IUPAC name Propyl ethanoate | |
Other names
Propyl acetate n-Propyl ethanoate n-Propyl acetate Propylacetate Acetic acid, propyl ester n-Propyl ester of acetic acid | |
Identifiers | |
CAS Number | |
3D model (JSmol) | |
ChEMBL | |
ChemSpider | |
DrugBank | |
PubChem CID | |
UNII | |
InChI
| |
SMILES
| |
Properties | |
Chemical formula | C5H10O2 |
Molar mass | 102.131 g/mol |
Appearance | Clear, colourless liquid |
Density | 0.888 g/cm, liquid |
Melting point | −95 °C (178 K) |
Boiling point | 102 °C (374.8 K) |
Hazards | |
NFPA 704 (fire diamond) | 2 3 |
Flash point | 13-14 °C |
Related compounds | |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C , 100 kPa). N verify (what is ?) Infobox references |