Misplaced Pages

:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions - Misplaced Pages

Article snapshot taken from[REDACTED] with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
< Misplaced Pages:WikiProject Chemicals | Chembox validation Browse history interactively← Previous editNext edit →Content deleted Content addedVisualWikitext
Revision as of 14:37, 5 December 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,084 edits Saving copy of the {{drugbox}} taken from revid 459941314 of page Propranolol for the Chem/Drugbox validation project (updated: '').← Previous edit Revision as of 14:38, 5 December 2011 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,084 edits Saving copy of the {{chembox}} taken from revid 460199104 of page Propyl_acetate for the Chem/Drugbox validation project (updated: '').Next edit →
Line 1: Line 1:
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} {{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}}
{{chembox
{{Drugbox| Verifiedfields = changed | Verifiedfields = changed
| Watchedfields = changed | Watchedfields = changed
| verifiedrevid = 415686711 | verifiedrevid = 417944019
| Name = Propyl acetate
| IUPAC_name = (''RS'')-1-(1-methylethylamino)-3-(1-naphthyloxy)propan-2-ol
| ImageFile_Ref = {{chemboximage|correct|??}}
| image = Propranolol-2D-skeletal.png
| ImageFile = Propyl acetate.png
| width = 280
<!-- | ImageSize = 200px -->
| image2 = Propranolol-from-xtal-3D-balls.png
| ImageName = Propyl acetate
| width2 = 150
| IUPACName = Propyl ethanoate
| imagename = 1 : 1 mixture (racemate)
| OtherNames = Propyl acetate<br />n-Propyl ethanoate</br>n-Propyl acetate</br>Propylacetate</br>Acetic acid, propyl ester</br>n-Propyl ester of acetic acid
| drug_name = Propranolol
| Section1 = {{Chembox Identifiers

| DrugBank_Ref = {{drugbankcite|changed|drugbank}}
<!--Clinical data-->
| brand = Inderal | DrugBank = DB01670
| SMILES = O=C(OCCC)C
| Drugs.com = {{drugs.com|monograph|propranolol-hydrochloride}}
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| licence_US = Propranolol
| pregnancy_AU = C | ChemSpiderID = 7706
| pregnancy_US = C | PubChem = 7997
| legal_AU = S4
| legal_UK = POM
| legal_US = Rx-only
| routes_of_administration = oral, ]

<!--Pharmacokinetic data-->
| bioavailability = 26%
| metabolism = ] (extensive)
| elimination_half-life = 4-5 hours
| excretion = ] <1%

<!--Identifiers-->
| CASNo_Ref = {{cascite|correct|CAS}}
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 525-66-6
| ATC_prefix = C07
| ATC_suffix = AA05
| PubChem = 4946
| IUPHAR_ligand = 564
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB00571
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 4777
| UNII_Ref = {{fdacite|correct|FDA}} | UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 9Y8NXQ24VQ | UNII = 4AWM8C91G6
| InChI = 1/C5H10O2/c1-3-4-7-5(2)6/h3-4H2,1-2H3
| KEGG_Ref = {{keggcite|correct|kegg}}
| InChIKey = YKYONYBAUNKHLG-UHFFFAOYAC
| KEGG = D08443
| ChEBI_Ref = {{ebicite|changed|EBI}}
| ChEBI = 8499
| ChEMBL_Ref = {{ebicite|correct|EBI}} | ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 27 | ChEMBL = 44857

<!--Chemical data-->
| C=16 | H=21 | N=1 | O=2
| molecular_weight = 259.34 g/mol
| smiles = CC(C)NCC(COc1cccc2c1cccc2)O
| InChI = 1/C16H21NO2/c1-12(2)17-10-14(18)11-19-16-9-5-7-13-6-3-4-8-15(13)16/h3-9,12,14,17-18H,10-11H2,1-2H3
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C16H21NO2/c1-12(2)17-10-14(18)11-19-16-9-5-7-13-6-3-4-8-15(13)16/h3-9,12,14,17-18H,10-11H2,1-2H3 | StdInChI = 1S/C5H10O2/c1-3-4-7-5(2)6/h3-4H2,1-2H3
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = AQHHHDLHHXJYJD-UHFFFAOYSA-N | StdInChIKey = YKYONYBAUNKHLG-UHFFFAOYSA-N
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo = 109-60-4
}}
| Section2 = {{Chembox Properties
| Formula = C<sub>5</sub>H<sub>10</sub>O<sub>2</sub>
| MolarMass = 102.131 g/mol
| Appearance = Clear, colourless liquid
| Density = 0.888 g/cm<sup>3</sup>, liquid
| MeltingPt = −95 °C (178 K)
| BoilingPt = 102 °C (374.8 K)
}}
| Section7 = {{Chembox Hazards
| ExternalMSDS =
| EUClass = Flammable ('''F''')<br />Irritant ('''Xi''')
| NFPA-H = 2
| NFPA-F = 3
| NFPA-R =
| RPhrases = {{R11}}, {{R36}}
| SPhrases = {{S2}}, {{S16}}, {{S26}}, {{S29}},<br /> {{S33}}
| FlashPt = 13-14 °C
| Autoignition = 450 °C
}}<!--

| LEL/UEL
| 1.7-8% @ 38 °C
|-

-->
| Section8 = {{Chembox Related
| Function = ]s
| OtherFunctn = ]<br />''n''-]<br />]
| OtherCpds = ]<br /> ]
}}
}} }}

Revision as of 14:38, 5 December 2011

This page contains a copy of the infobox ({{chembox}}) taken from revid 460199104 of page Propyl_acetate with values updated to verified values.
Propyl acetate
Propyl acetate
Propyl acetate
Names
IUPAC name Propyl ethanoate
Other names Propyl acetate
n-Propyl ethanoate
n-Propyl acetate
Propylacetate
Acetic acid, propyl ester
n-Propyl ester of acetic acid
Identifiers
CAS Number
3D model (JSmol)
ChEMBL
ChemSpider
DrugBank
PubChem CID
UNII
InChI
  • InChI=1S/C5H10O2/c1-3-4-7-5(2)6/h3-4H2,1-2H3Key: YKYONYBAUNKHLG-UHFFFAOYSA-N
  • InChI=1/C5H10O2/c1-3-4-7-5(2)6/h3-4H2,1-2H3Key: YKYONYBAUNKHLG-UHFFFAOYAC
SMILES
  • O=C(OCCC)C
Properties
Chemical formula C5H10O2
Molar mass 102.131 g/mol
Appearance Clear, colourless liquid
Density 0.888 g/cm, liquid
Melting point −95 °C (178 K)
Boiling point 102 °C (374.8 K)
Hazards
NFPA 704 (fire diamond)
NFPA 704 four-colored diamondHealth 2: Intense or continued but not chronic exposure could cause temporary incapacitation or possible residual injury. E.g. chloroformFlammability 3: Liquids and solids that can be ignited under almost all ambient temperature conditions. Flash point between 23 and 38 °C (73 and 100 °F). E.g. gasolineInstability (yellow): no hazard codeSpecial hazards (white): no code
2 3
Flash point 13-14 °C
Related compounds
Except where otherwise noted, data are given for materials in their standard state (at 25 °C , 100 kPa). ☒verify (what is  ?) Infobox references
Chemical compound
Misplaced Pages:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions Add topic