| Revision as of 14:42, 5 December 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 447923763 of page Propylisopropyltryptamine for the Chem/Drugbox validation project (updated: '').← Previous edit |
Revision as of 14:43, 5 December 2011 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 447990923 of page Propylketobemidone for the Chem/Drugbox validation project (updated: '').Next edit → |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{Drugbox |
|
{{Drugbox |
|
| verifiedrevid = 400869180 |
|
| verifiedrevid = 400869429 |
|
| IUPAC_name = -''N''-propyl-''N''-isopropylamine |
|
| IUPAC_name = 1-butan-1-one |
|
| image = propylisopropyltryptamine.png |
|
| image = Propylketobemidone.svg |
|
| width = 140 |
|
| width = 160 |
|
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
|
| tradename = |
|
| tradename = |
|
| pregnancy_AU = |
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| pregnancy_US = |
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| pregnancy_category = |
|
| pregnancy_category = |
|
|
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
| ⚫ |
| legal_AU = |
|
|
| legal_CA = |
|
| legal_CA = <!-- Schedule I --> |
|
| legal_UK = |
|
| legal_UK = <!-- Class A --> |
|
| legal_US = |
|
| legal_US = <!-- Schedule I --> |
|
| legal_status = |
|
| legal_status = |
|
| routes_of_administration = |
|
| routes_of_administration = |
| Line 30: |
Line 30: |
|
| ATC_suffix = |
|
| ATC_suffix = |
|
| PubChem = |
|
| PubChem = |
|
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
⚫ |
| DrugBank = |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 21106369 |
|
| ChemSpiderID = 21106370 |
|
|
|
|
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| C=16 | H=24 | N=2 |
|
| C=16 | H=23 | N=1 | O=2 |
|
| molecular_weight = 244.38 g/mol |
|
| molecular_weight = 261.37 g/mol |
|
| smiles = CC(C)N(CCC)CCc2cnc1ccccc12 |
|
| smiles = O=C(CCC)C1(CCN(C)CC1)c2cccc(O)c2 |
|
| InChI = 1/C16H24N2/c1-4-10-18(13(2)3)11-9-14-12-17-16-8-6-5-7-15(14)16/h5-8,12-13,17H,4,9-11H2,1-3H3 |
|
| InChI = 1/C16H23NO2/c1-3-5-15(19)16(8-10-17(2)11-9-16)13-6-4-7-14(18)12-13/h4,6-7,12,18H,3,5,8-11H2,1-2H3 |
|
| InChIKey = OFXPLOPRCQJJFP-UHFFFAOYAP |
|
| InChIKey = VQISXVAQCJSTNS-UHFFFAOYAL |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C16H24N2/c1-4-10-18(13(2)3)11-9-14-12-17-16-8-6-5-7-15(14)16/h5-8,12-13,17H,4,9-11H2,1-3H3 |
|
| StdInChI = 1S/C16H23NO2/c1-3-5-15(19)16(8-10-17(2)11-9-16)13-6-4-7-14(18)12-13/h4,6-7,12,18H,3,5,8-11H2,1-2H3 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = OFXPLOPRCQJJFP-UHFFFAOYSA-N |
|
| StdInChIKey = VQISXVAQCJSTNS-UHFFFAOYSA-N |
|
|
| synonyms = |
|
}} |
|
}} |
