| Revision as of 09:24, 6 December 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,084 edits Saving copy of the {{chembox}} taken from revid 464306572 of page Hydrogen_bromide for the Chem/Drugbox validation project (updated: 'ChEMBL', 'KEGG').← Previous edit |
Revision as of 09:24, 6 December 2011 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,084 edits Saving copy of the {{chembox}} taken from revid 464278112 of page Cyclic_guanosine_monophosphate for the Chem/Drugbox validation project (updated: '').Next edit → |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{Chembox |
|
{{chembox |
|
⚫ |
| verifiedrevid = 443545777 |
|
| Verifiedfields = changed |
|
|
|
| ImageFile = CGMP2.svg |
|
| Watchedfields = changed |
|
|
|
| ImageSize = 200px |
| ⚫ |
| verifiedrevid = 443862322 |
|
|
|
| IUPACName = 2-amino-9-nonan-8-yl]-3''H''-purin-6-one |
|
| ImageFileL1 = Hydrogen-bromide-2D-dimensions.png |
|
|
|
| OtherNames = cGMP; 3',5'-cyclic GMP; Guanosine cyclic monophosphate; Cyclic 3',5'-GMP; Guanosine 3',5'-cyclic phosphate |
|
| ImageFileL1_Ref = {{chemboximage|correct|??}} |
|
|
| ImageSizeL1 = 125 |
|
|
| ImageNameL1 = Skeletal formula of hydrogen bromide with the explicit hydrogen and a measurement added |
|
|
| ImageFileR1 = Hydrogen-bromide-3D-vdW-2.png |
|
|
| ImageFileR1_Ref = {{chemboximage|correct|??}} |
|
|
| ImageSizeR1 = 115 |
|
|
| ImageNameR1 = Spacefill model of hydrogen bromide |
|
|
| PIN = Hydrogen bromide{{Citation needed|date = November 2011}} |
|
|
| SystematicName = Bromane<ref>{{Cite web|title = Hydrobromic Acid - Compound Summary|url = http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=260&loc=ec_rcs|work = PubChem Compound|publisher = National Center for Biotechnology Information|accessdate = 10 November 2011|location = USA|date = 16 September 2004|at = Identification and Related Records}}</ref> |
|
|
| Section1 = {{Chembox Identifiers |
|
| Section1 = {{Chembox Identifiers |
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| CASNo = 10035-10-6 |
|
|
⚫ |
| ChemSpiderID = 22734 |
| ⚫ |
| CASNo_Ref = {{cascite|correct|CAS}} |
|
|
|
| InChI = 1/C10H12N5O7P/c11-10-13-7-4(8(17)14-10)12-2-15(7)9-5(16)6-3(21-9)1-20-23(18,19)22-6/h2-3,5-6,9,16H,1H2,(H,18,19)(H3,11,13,14,17)/t3-,5-,6-,9-/m1/s1 |
| ⚫ |
| PubChem = 260 |
|
|
|
| InChIKey = ZOOGRGPOEVQQDX-UUOKFMHZBB |
|
| PubChem_Ref = {{Pubchemcite|correct|Pubchem}} |
|
|
⚫ |
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
| ⚫ |
| ChemSpiderID = 255 |
|
|
|
| ChEMBL = 395336 |
| ⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
⚫ |
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| EINECS = 233-113-0 |
|
|
|
| StdInChI = 1S/C10H12N5O7P/c11-10-13-7-4(8(17)14-10)12-2-15(7)9-5(16)6-3(21-9)1-20-23(18,19)22-6/h2-3,5-6,9,16H,1H2,(H,18,19)(H3,11,13,14,17)/t3-,5-,6-,9-/m1/s1 |
|
| UNNumber = 1048 |
|
|
⚫ |
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| KEGG = <!-- blanked - oldvalue: C13645 --> |
|
|
⚫ |
| StdInChIKey = ZOOGRGPOEVQQDX-UUOKFMHZSA-N |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
|
⚫ |
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| MeSHName = Hydrobromic+Acid |
|
|
| ChEBI = 47266 |
|
| CASNo = 7665-99-8 |
|
⚫ |
| PubChem = 24316 |
| ⚫ |
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
|
|
| IUPHAR_ligand = 2347 |
|
| ChEMBL = <!-- blanked - oldvalue: 1231461 --> |
|
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
| RTECS = MW3850000 |
|
| ChEBI = 16356 |
|
|
| SMILES = O=C4/N=C(/N)Nc1c4ncn12O3COP(=O)(O32O)O |
|
| Beilstein = 3587158 |
|
|
| SMILES = Br |
|
| MeSHName = Cyclic+GMP |
|
⚫ |
}} |
|
| StdInChI = 1S/BrH/h1H |
|
| ⚫ |
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| ⚫ |
| StdInChIKey = CPELXLSAUQHCOX-UHFFFAOYSA-N |
|
| ⚫ |
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| ⚫ |
}} |
|
|
| Section2 = {{Chembox Properties |
|
| Section2 = {{Chembox Properties |
|
| H = 1 |
|
| C=10|H=12|N=5|O=7|P=1 |
|
| Br = 1 |
|
| Appearance = |
|
|
| Density = |
|
| ExactMass = 79.926162679 g mol<sup>-1</sup> |
|
|
|
| MeltingPt = |
|
| Appearance = Colorless gas |
|
|
| Odor = Acrid |
|
| BoilingPt = |
|
⚫ |
}} |
|
| Density = 3.307 g dm<sup>-3</sup> |
|
|
⚫ |
| Section3 = {{Chembox Hazards |
|
| MeltingPtK = 186 |
|
|
| BoilingPtK = 207 |
|
| Solubility = |
|
|
| MainHazards = |
|
| Solubility = 1.93 kg dm<sup>-3</sup> (at 20 °C) |
|
|
|
| FlashPt = |
|
| VaporPressure = 2.308 MPa (at 21 °C) |
|
|
|
| Autoignition = |
|
| pKa = ~–9 <ref>Perrin, D. D. Dissociation constants of inorganic acids and bases in aqueous solution. Butterworths, London, 1969.</ref> |
|
|
⚫ |
}} |
|
| pKb = ~23 |
|
|
| RefractIndex = 1.325 |
|
| ⚫ |
}} |
|
|
| Section3 = {{Chembox Structure |
|
|
| MolShape = Linear |
|
|
| Dipole = 82 mD |
|
| ⚫ |
}} |
|
|
| Section4 = {{Chembox Thermochemistry |
|
|
| DeltaHf = -36.45--36.13 kJ mol<sup>-1</sup> |
|
|
| Entropy = 198.696-198.704 J K<sup>-1</sup> mol<sup>-1</sup> |
|
|
| HeatCapacity = 350.7 mJ K<sup>-1</sup> g<sup>-1</sup> |
|
|
}} |
|
| ⚫ |
| Section5 = {{Chembox Hazards |
|
|
| ExternalMSDS = <br /> |
|
|
|
|
|
| GHSPictograms = {{GHS corrosion}} {{GHS exclamation mark}} |
|
|
| GHSSignalWord = '''DANGER''' |
|
|
| HPhrases = {{H-phrases|314|335}} |
|
|
| PPhrases = {{P-phrases|261|280|305+351+338|310}} |
|
|
| EUIndex = 035-002-00-0 |
|
|
| EUClass = {{Hazchem C}} |
|
|
| RPhrases = {{R35}}, {{R37}} |
|
|
| SPhrases = {{S1/2}}, {{S7/9}}, {{S26}}, {{S45}} |
|
|
| NFPA-H = 3 |
|
|
| NFPA-F = 0 |
|
|
| NFPA-R = 0 |
|
|
}} |
|
|
| Section6 = {{Chembox Related |
|
|
| OtherCpds = ]<br /> |
|
|
]<br /> |
|
|
] |
|
|
}} |
|
|
}} |
|
}} |
Y verify (what is ?)
Infobox references