| Revision as of 09:24, 6 December 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 464278112 of page Cyclic_guanosine_monophosphate for the Chem/Drugbox validation project (updated: '').← Previous edit |
Revision as of 09:24, 6 December 2011 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 464290048 of page Hydrochloric_acid for the Chem/Drugbox validation project (updated: '').Next edit → |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{chembox |
|
{{Chembox |
|
| verifiedrevid = 443545777 |
|
| verifiedrevid = 455312229 |
|
| ImageFile = CGMP2.svg |
|
| ImageFile = Hydrochloric acid 30 percent.jpg |
|
|
| ImageFile_Ref = {{chemboximage|correct|??}} |
|
| ImageSize = 200px |
|
| ImageSize = 150px |
|
| IUPACName = 2-amino-9-nonan-8-yl]-3''H''-purin-6-one |
|
|
|
| ImageName = Sample of hydrochloric acid in a bottle |
|
| OtherNames = cGMP; 3',5'-cyclic GMP; Guanosine cyclic monophosphate; Cyclic 3',5'-GMP; Guanosine 3',5'-cyclic phosphate |
|
|
|
| IUPACName = Hydrochloric acid{{Citation needed|date=May 2011}} |
|
|
| OtherNames = Muriatic acid<br /> |
|
|
Spirit of salt |
|
| Section1 = {{Chembox Identifiers |
|
| Section1 = {{Chembox Identifiers |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
| ChemSpiderID = 22734 |
|
| ChEBI = 17883 |
|
⚫ |
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| InChI = 1/C10H12N5O7P/c11-10-13-7-4(8(17)14-10)12-2-15(7)9-5(16)6-3(21-9)1-20-23(18,19)22-6/h2-3,5-6,9,16H,1H2,(H,18,19)(H3,11,13,14,17)/t3-,5-,6-,9-/m1/s1 |
|
|
⚫ |
| CASNo = 7647-01-0 |
|
| InChIKey = ZOOGRGPOEVQQDX-UUOKFMHZBB |
|
| ⚫ |
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
|
| ChEMBL = 395336 |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
|
| StdInChI = 1S/ClH/h1H |
|
| StdInChI = 1S/C10H12N5O7P/c11-10-13-7-4(8(17)14-10)12-2-15(7)9-5(16)6-3(21-9)1-20-23(18,19)22-6/h2-3,5-6,9,16H,1H2,(H,18,19)(H3,11,13,14,17)/t3-,5-,6-,9-/m1/s1 |
|
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = ZOOGRGPOEVQQDX-UUOKFMHZSA-N |
|
| StdInChIKey = VEXZGXHMUGYJMC-UHFFFAOYSA-N |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
| ChemSpiderID = 307 |
| ⚫ |
| CASNo = 7665-99-8 |
|
|
| PubChem = 24316 |
|
| UNII = QTT17582CB |
|
⚫ |
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| IUPHAR_ligand = 2347 |
|
|
⚫ |
}} |
| ⚫ |
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
|
⚫ |
| Section7 = {{Chembox Hazards |
|
| ChEBI = 16356 |
|
|
|
| ExternalMSDS = |
|
| SMILES = O=C4/N=C(/N)Nc1c4ncn12O3COP(=O)(O32O)O |
|
|
|
| NFPA-H = 3|NFPA-F = 0|NFPA-R=1|NFPA-O = COR <!-- 32–38% solution--> |
|
| MeSHName = Cyclic+GMP |
|
|
|
| EUClass = Toxic ('''T''')<br/>Corrosive ('''C''')<br/>Dangerous for the environment ('''N''') <!-- 25-38% solution --> |
| ⚫ |
}} |
|
|
|
| EUIndex = 017-002-01-X |
|
| Section2 = {{Chembox Properties |
|
|
|
| FlashPt = Non-flammable. |
|
| C=10|H=12|N=5|O=7|P=1 |
|
|
|
| RPhrases = {{R35}}, {{R37}} |
|
| Appearance = |
|
|
|
| SPhrases = {{S1/2}}, {{S26}}, {{S45}} |
|
| Density = |
|
|
⚫ |
}} |
|
| MeltingPt = |
|
|
⚫ |
| Section8 = {{Chembox Related |
|
| BoilingPt = |
|
|
|
| Function = ]s |
| ⚫ |
}} |
|
|
|
| OtherFunctn = ]<br /> |
| ⚫ |
| Section3 = {{Chembox Hazards |
|
|
|
]<br /> |
|
| Solubility = |
|
|
|
] |
|
| MainHazards = |
|
|
⚫ |
}} |
|
| FlashPt = |
|
|
| Autoignition = |
|
| ⚫ |
}} |
|
|
}} |
|
}} |
Y verify (what is ?)
Infobox references