Misplaced Pages

:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions - Misplaced Pages

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
< Misplaced Pages:WikiProject Chemicals | Chembox validation Browse history interactively← Previous editNext edit →Content deleted Content addedVisualWikitext
Revision as of 10:50, 6 December 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 464297937 of page Ketamine for the Chem/Drugbox validation project (updated: '').← Previous edit Revision as of 10:54, 6 December 2011 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 464344515 of page Lefetamine for the Chem/Drugbox validation project (updated: 'CAS_number').Next edit →
Line 1: Line 1:
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} {{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}}
{{drugbox {{Drugbox
| verifiedrevid = 464192226 | verifiedrevid = 451642269
| IUPAC_name = (''RS'')-2-(2-Chlorophenyl)-2-(methylamino)cyclohexanone | IUPAC_name = (1''R'')-''N'',''N''-dimethyl-1,2-diphenylethanamine
| image = Ketamine.svg | image = Lefetamine.svg
| image2 = Lefetamine3d.png
| width = 150
⚫ | width2 = 160
| image2 = Ketamine.pdb.gif
⚫ | width2 = 200
| imagename = 1 : 1 mixture (racemate)
| drug_name = Ketamine


<!--Clinical data--> <!--Clinical data-->
| tradename =
| Drugs.com = {{drugs.com|CDI|ketamine}}
⚫ | pregnancy_category =
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| legal_status = ] (])
| pregnancy_US = <!-- A / B / C / D / X -->
| routes_of_administration = ]
⚫ | pregnancy_category = B
| legal_AU = S8
| legal_CA = Schedule I
| legal_UK = Class C
| legal_US = Schedule III
| routes_of_administration = ], ], ]d, oral, ]


<!--Pharmacokinetic data--> <!--Pharmacokinetic data-->
| bioavailability =
| metabolism = Hepatic, primarily by CYP3A4<ref>{{Cite journal|author=Hijazi Y, Boulieu R|title=Contribution of CYP3A4, CYP2B6, and CYP2C9 isoforms to N-demethylation of ketamine in human liver microsomes|journal=Drug Metabolism and Disposition|volume=30|issue=7|pages=853–8|year=2002|month=July|pmid=12065445|doi=10.1124/dmd.30.7.853}}</ref>
| metabolism =
| elimination_half-life = 2.5–3 hours. | elimination_half-life =
| excretion = renal (>90%) | excretion =


<!--Identifiers--> <!--Identifiers-->
| CASNo_Ref = {{cascite|correct|CAS}}
| CAS_number_Ref = {{cascite|correct|??}} | CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 6740-88-1 | CAS_number = <!-- blanked - oldvalue: 7262-75-1 -->
| ATC_prefix = N01 | ATC_prefix = none
| ATC_suffix = AX03 | ATC_suffix =
⚫ | PubChem = 443970
| ATC_supplemental = {{ATC|N01|AX14}}
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 6121
⚫ | PubChem = 3821
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB01221
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 3689 | ChemSpiderID = 392017
| UNII_Ref = {{fdacite|correct|FDA}} | UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 690G0D6V8H | UNII = 4J9726V5Y9
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D08098
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 742


<!--Chemical data--> <!--Chemical data-->
| C=13 | H=16 | Cl=1 | N=1 | O=1 | C=16 | H=19 | N=1
| molecular_weight = 237.725 g/mol | molecular_weight = 225.329 g/mol
| smiles = CNC1(CCCCC1=O)c2ccccc2Cl | smiles = N(C)((c1ccccc1)Cc2ccccc2)C
| InChI = 1/C13H16ClNO/c1-15-13(9-5-4-8-12(13)16)10-6-2-3-7-11(10)14/h2-3,6-7,15H,4-5,8-9H2,1H3 | InChI = 1/C16H19N/c1-17(2)16(15-11-7-4-8-12-15)13-14-9-5-3-6-10-14/h3-12,16H,13H2,1-2H3/t16-/m1/s1
| InChIKey = YEJZJVJJPVZXGX-MRXNPFEDBZ
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C13H16ClNO/c1-15-13(9-5-4-8-12(13)16)10-6-2-3-7-11(10)14/h2-3,6-7,15H,4-5,8-9H2,1H3 | StdInChI = 1S/C16H19N/c1-17(2)16(15-11-7-4-8-12-15)13-14-9-5-3-6-10-14/h3-12,16H,13H2,1-2H3/t16-/m1/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = YQEZLKZALYSWHR-UHFFFAOYSA-N | StdInChIKey = YEJZJVJJPVZXGX-MRXNPFEDSA-N
| melting_point = 262
}} }}

Revision as of 10:54, 6 December 2011

This page contains a copy of the infobox ({{drugbox}}) taken from revid 464344515 of page Lefetamine with values updated to verified values.
WikiProject Chemicals/Chembox validation/VerifiedDataSandbox
Clinical data
Routes of
administration		Oral
ATC code
  • none
Legal status
Legal status
Identifiers
IUPAC name
  • (1R)-N,N-dimethyl-1,2-diphenylethanamine
PubChem CID
ChemSpider
UNII
Chemical and physical data
FormulaC16H19N
Molar mass225.329 g/mol g·mol
3D model (JSmol)
SMILES
  • N(C)((c1ccccc1)Cc2ccccc2)C
InChI
  • InChI=1S/C16H19N/c1-17(2)16(15-11-7-4-8-12-15)13-14-9-5-3-6-10-14/h3-12,16H,13H2,1-2H3/t16-/m1/s1
  • Key:YEJZJVJJPVZXGX-MRXNPFEDSA-N
  (verify)