Revision as of 10:54, 6 December 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 464344515 of page Lefetamine for the Chem/Drugbox validation project (updated: 'CAS_number').← Previous edit | Revision as of 10:56, 6 December 2011 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 464290800 of page Lidocaine for the Chem/Drugbox validation project (updated: '').Next edit → | ||
Line 1: | Line 1: | ||
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} | {{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} | ||
{{Drugbox | {{Drugbox| Verifiedfields = changed | ||
| verifiedrevid = |
| verifiedrevid = 417820511 | ||
| IUPAC_name = ( |
| IUPAC_name = 2-(diethylamino)-<br />''N''-(2,6-dimethylphenyl)acetamide | ||
| image = |
| image = Lidocaine.svg | ||
| width = 200px | |||
| image2 = Lefetamine3d.png | |||
| image2 = Lidocaine-from-xtal-3D-balls.png | |||
| width2 = |
| width2 = 200px | ||
<!--Clinical data--> | <!--Clinical data--> | ||
| tradename = |
| tradename = Xylocaine | ||
| Drugs.com = {{drugs.com|CONS|lidocaine}} | |||
| pregnancy_category = | |||
| pregnancy_AU = A | |||
| legal_status = ] (]) | |||
| pregnancy_US = B | |||
| routes_of_administration = ] | |||
| legal_AU = S4 | |||
| legal_US = Rx Only (U.S.) (excluding 1%) | |||
| routes_of_administration = ], ], ] | |||
<!--Pharmacokinetic data--> | <!--Pharmacokinetic data--> | ||
| bioavailability = | | bioavailability = 35% (oral) <br /> 3% (topical) | ||
| metabolism = | | metabolism = ], 90% ]-mediated | ||
| elimination_half-life = | | elimination_half-life = 1.5–2 hours | ||
| excretion = |
| excretion = ] | ||
<!--Identifiers--> | <!--Identifiers--> | ||
| CASNo_Ref = {{cascite|correct|CAS}} | |||
| CAS_number_Ref = {{cascite|correct|??}} | | CAS_number_Ref = {{cascite|correct|??}} | ||
| CAS_number = |
| CAS_number = 137-58-6 | ||
| CAS_supplemental = <br/>{{CAS|73-78-9}} (hydrochloride) | |||
| ATC_prefix = none | |||
| |
| ATC_prefix = N01 | ||
| |
| ATC_suffix = BB02 | ||
| ATC_supplemental = {{ATC|C01|BB01}} {{ATC|D04|AB01}} {{ATC|S02|DA01}} {{ATC|C05|AD01}} | |||
| PubChem = 3676 | |||
| DrugBank_Ref = {{drugbankcite|changed|drugbank}} | |||
| DrugBank = DB00281 | |||
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ||
| ChemSpiderID = |
| ChemSpiderID = 3548 | ||
| UNII_Ref = {{fdacite|correct|FDA}} | | UNII_Ref = {{fdacite|correct|FDA}} | ||
| UNII = |
| UNII = 98PI200987 | ||
| KEGG_Ref = {{keggcite|correct|kegg}} | |||
| KEGG = D00358 | |||
| ChEBI_Ref = {{ebicite|changed|EBI}} | |||
| ChEBI = 6456 | |||
| ChEMBL_Ref = {{ebicite|correct|EBI}} | |||
| ChEMBL = 79 | |||
<!--Chemical data--> | <!--Chemical data--> | ||
| C= |
| C=14 | H=22 | N=2 | O=1 | ||
| molecular_weight = |
| molecular_weight = 234.34 g/mol | ||
| smiles = |
| smiles = O=C(Nc1c(cccc1C)C)CN(CC)CC | ||
| InChI = 1/ |
| InChI = 1/C14H22N2O/c1-5-16(6-2)10-13(17)15-14-11(3)8-7-9-12(14)4/h7-9H,5-6,10H2,1-4H3,(H,15,17) | ||
| InChIKey = YEJZJVJJPVZXGX-MRXNPFEDBZ | |||
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} | | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | ||
| StdInChI = 1S/ |
| StdInChI = 1S/C14H22N2O/c1-5-16(6-2)10-13(17)15-14-11(3)8-7-9-12(14)4/h7-9H,5-6,10H2,1-4H3,(H,15,17) | ||
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | ||
| StdInChIKey = |
| StdInChIKey = NNJVILVZKWQKPM-UHFFFAOYSA-N | ||
| synonyms = ''N''-(2,6-dimethylphenyl)-''N''<sup>2</sup>,''N''<sup>2</sup>-diethylglycinamide | |||
| melting_point = 68 | |||
}} | }} |
Revision as of 10:56, 6 December 2011
This page contains a copy of the infobox ({{drugbox}}) taken from revid 464290800 of page Lidocaine with values updated to verified values. |
Clinical data | |
---|---|
Trade names | Xylocaine |
Other names | N-(2,6-dimethylphenyl)-N,N-diethylglycinamide |
AHFS/Drugs.com | Micromedex Detailed Consumer Information |
Pregnancy category |
|
Routes of administration | IV, subcutaneous, topical |
ATC code | |
Legal status | |
Legal status |
|
Pharmacokinetic data | |
Bioavailability | 35% (oral) 3% (topical) |
Metabolism | Hepatic, 90% CYP1A2-mediated |
Elimination half-life | 1.5–2 hours |
Excretion | renal |
Identifiers | |
IUPAC name
| |
CAS Number | |
PubChem CID | |
DrugBank | |
ChemSpider | |
UNII | |
KEGG | |
ChEBI | |
ChEMBL | |
Chemical and physical data | |
Formula | C14H22N2O |
Molar mass | 234.34 g/mol g·mol |
3D model (JSmol) | |
Melting point | 68 °C (154 °F) |
SMILES
| |
InChI
| |
(what is this?) (verify) |