Misplaced Pages:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions

< Misplaced Pages:WikiProject Chemicals | Chembox validation Browse history interactively ← Previous edit Next edit →Content deleted Content addedVisual WikitextInline

Revision as of 10:56, 6 December 2011 editBeetstra (talk \| contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 464290800 of page Lidocaine for the Chem/Drugbox validation project (updated: '').← Previous edit		Revision as of 10:59, 6 December 2011 edit undoBeetstra (talk \| contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 464319253 of page Malvidin for the Chem/Drugbox validation project (updated: 'CASNo').Next edit →
Line 1:		Line 1:
	{{ambox \| text = This page contains a copy of the infobox ({{tl\|~~drugbox~~}}) taken from revid of page ] with values updated to verified values.}}		{{ambox \| text = This page contains a copy of the infobox ({{tl\|chembox}}) taken from revid of page ] with values updated to verified values.}}
			{{chembox
	{{Drugbox\| Verifiedfields = changed
	\| verifiedrevid = ~~417820511~~		\| verifiedrevid = 440126448
			\| ImageFile=malvidin.png
	\| IUPAC_name = 2-(diethylamino)-<br />''N''-(2,6-dimethylphenyl)acetamide
			\| ImageSize=250px
	\| image = Lidocaine.svg
			\| IUPACName=3,5,7-trihydroxy-2-(4-hydroxy- 3,5-dimethoxyphenyl)chromenium
	\| width = 200px
			\| OtherNames=
	\| image2 = Lidocaine-from-xtal-3D-balls.png
			\|Section1= {{Chembox Identifiers
	\| width2 = 200px
		⚫	\| ChemSpiderID_Ref = {{chemspidercite\|correct\|chemspider}}

		⚫	\| ChemSpiderID = 140095
	<!--Clinical data-->
	\| ~~tradename~~ = ~~Xylocaine~~		\| ChEMBL2 = 592005
	\| Drugs.com = {{drugs.com\|CONS\|lidocaine}}
	\| pregnancy_AU = A
	\| pregnancy_US = B
	\| legal_AU = S4
	\| legal_US = Rx Only (U.S.) (excluding 1%)
	\| routes_of_administration = ], ], ]

	<!--Pharmacokinetic data-->
	\| bioavailability = 35% (oral) <br /> 3% (topical)
	\| metabolism = ], 90% ]-mediated
	\| elimination_half-life = 1.5–2 hours
	\| excretion = ]

	<!--Identifiers-->
⚫	\| CASNo_Ref = {{cascite\|correct\|~~CAS~~}}
	\| CAS_number_Ref = {{cascite\|correct\|??}}
	\| CAS_number = 137-58-6
	\| CAS_supplemental = <br/>{{CAS\|73-78-9}} (hydrochloride)
	\| ATC_prefix = N01
	\| ATC_suffix = BB02
	\| ATC_supplemental = {{ATC\|C01\|BB01}} {{ATC\|D04\|AB01}} {{ATC\|S02\|DA01}} {{ATC\|C05\|AD01}}
⚫	\| PubChem = ~~3676~~
	\| DrugBank_Ref = {{drugbankcite\|changed\|drugbank}}
	\| DrugBank = DB00281
⚫	\| ChemSpiderID_Ref = {{chemspidercite\|correct\|chemspider}}
⚫	\| ChemSpiderID = ~~3548~~
	\| UNII_Ref = {{fdacite\|correct\|FDA}}
	\| UNII = 98PI200987
	\| KEGG_Ref = {{keggcite\|correct\|kegg}}
	\| KEGG = D00358
	\| ChEBI_Ref = {{ebicite\|changed\|EBI}}
	\| ChEBI = 6456
	\| ChEMBL_Ref = {{ebicite\|correct\|EBI}}		\| ChEMBL_Ref = {{ebicite\|correct\|EBI}}
	\| ChEMBL = 79		\| ChEMBL = 255753
			\| InChI = 1/C17H14O7/c1-22-14-3-8(4-15(23-2)16(14)21)17-12(20)7-10-11(19)5-9(18)6-13(10)24-17/h3-7H,1-2H3,(H3-,18,19,20,21)/p+1

			\| InChIKey = KZMACGJDUUWFCH-IKLDFBCSAG
	<!--Chemical data-->
	\| C=14 \| H=22 \| N=2 \| O=1
	\| molecular_weight = 234.34 g/mol
	\| smiles = O=C(Nc1c(cccc1C)C)CN(CC)CC
	\| InChI = 1/C14H22N2O/c1-5-16(6-2)10-13(17)15-14-11(3)8-7-9-12(14)4/h7-9H,5-6,10H2,1-4H3,(H,15,17)
	\| StdInChI_Ref = {{stdinchicite\|correct\|chemspider}}		\| StdInChI_Ref = {{stdinchicite\|correct\|chemspider}}
	\| StdInChI = 1S/~~C14H22N2O~~/c1-5-16(6-2)~~10-13~~(17)15-14-11(3)~~8-7~~-9-12(14)4/h7-~~9H,5-6,10H2~~,1-~~4H3~~,(H,15,17)		\| StdInChI = 1S/C17H14O7/c1-22-14-3-8(4-15(23-2)16(14)21)17-12(20)7-10-11(19)5-9(18)6-13(10)24-17/h3-7H,1-2H3,(H3-,18,19,20,21)/p+1
	\| StdInChIKey_Ref = {{stdinchicite\|correct\|chemspider}}		\| StdInChIKey_Ref = {{stdinchicite\|correct\|chemspider}}
	\| StdInChIKey = ~~NNJVILVZKWQKPM~~-UHFFFAOYSA-N		\| StdInChIKey = KZMACGJDUUWFCH-UHFFFAOYSA-O
		⚫	\| CASNo_Ref = {{cascite\|correct\|??}}
	\| synonyms = ''N''-(2,6-dimethylphenyl)-''N''<sup>2</sup>,''N''<sup>2</sup>-diethylglycinamide
			\| CASNo = <!-- blanked - oldvalue: 643-84-5 -->
	\| melting_point = 68
		⚫	\| PubChem=159287
			\| SMILES = O(c1cc(cc(OC)c1O)c3c2cc(O)cc(O)c2cc3O)C
			}}
			\|Section2= {{Chembox Properties
			\| Formula=C<sub>17</sub>H<sub>15</sub>O<sub>7</sub>+
			\| MolarMass = 331.2968 g/mol
			\| ExactMass = 331.081778
			\| Appearance=
			\| Density=
			\| MeltingPt=
			\| BoilingPt=
			\| Solubility=
			}}
			\|Section3= {{Chembox Hazards
			\| MainHazards=
			\| FlashPt=
			\| Autoignition=
			}}
	}}		}}

Revision as of 10:59, 6 December 2011

This page contains a copy of the infobox ({{chembox}}) taken from revid 464319253 of page Malvidin with values updated to verified values.

WikiProject Chemicals/Chembox validation/VerifiedDataSandbox
Names

IUPAC name 3,5,7-trihydroxy-2-(4-hydroxy- 3,5-dimethoxyphenyl)chromenium
Identifiers
3D model (JSmol)	Interactive image
ChEMBL	ChEMBL255753 ChEMBL592005
ChemSpider	140095
PubChem CID	159287
InChI InChI=1S/C17H14O7/c1-22-14-3-8(4-15(23-2)16(14)21)17-12(20)7-10-11(19)5-9(18)6-13(10)24-17/h3-7H,1-2H3,(H3-,18,19,20,21)/p+1Key: KZMACGJDUUWFCH-UHFFFAOYSA-O InChI=1/C17H14O7/c1-22-14-3-8(4-15(23-2)16(14)21)17-12(20)7-10-11(19)5-9(18)6-13(10)24-17/h3-7H,1-2H3,(H3-,18,19,20,21)/p+1Key: KZMACGJDUUWFCH-IKLDFBCSAG
SMILES O(c1cc(cc(OC)c1O)c3c2cc(O)cc(O)c2cc3O)C
Properties
Chemical formula	C₁₇H₁₅O₇+
Molar mass	331.2968 g/mol
Except where otherwise noted, data are given for materials in their standard state (at 25 °C , 100 kPa). Y verify (what is ?) Infobox references

Tracking categories (test):

SizeSet

Chemical compound