Misplaced Pages

:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions - Misplaced Pages

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
< Misplaced Pages:WikiProject Chemicals | Chembox validation Browse history interactively← Previous editNext edit →Content deleted Content addedVisualWikitext
Revision as of 13:12, 6 December 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 460511135 of page Rovelizumab for the Chem/Drugbox validation project (updated: 'CAS_number').← Previous edit Revision as of 13:12, 6 December 2011 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 447431053 of page Roxatidine for the Chem/Drugbox validation project (updated: 'CAS_number').Next edit →
Line 1: Line 1:
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} {{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}}
{{Drugbox {{Drugbox
⚫ | verifiedrevid = 443579961
| Verifiedfields = changed
| IUPAC_name = 2-oxo-2-(3-propylamino)ethyl acetate
⚫ | verifiedrevid = 447733520
| image = | image = Roxatidine acetate.svg
| width = 250

| drug_name = Roxatidine acetate
<!--Monoclonal antibody data-->
| type = mab
| mab_type = mab
| source = zu/o
| target = ], ]<ref name="jones">{{cite journal | last = Jones | first = R | year = 2000 | month = April | title = Rovelizumab (ICOS Corp) | journal = | volume = 3 | issue = 4 | pages = 442&ndash;6 | pmid = 16100700}}</ref>


<!--Clinical data--> <!--Clinical data-->
| tradename = | tradename =
| pregnancy_AU =
| pregnancy_US =
| pregnancy_category = | pregnancy_category =
| legal_AU =
| legal_CA =
| legal_UK =
| legal_US =
| legal_status = | legal_status =
| routes_of_administration = | routes_of_administration = Oral


<!--Pharmacokinetic data--> <!--Pharmacokinetic data-->
| bioavailability = | bioavailability = 80–90%
| protein_bound = | protein_bound = 5–7%
| metabolism = ] ]<br>Minor involvement of ] and ]
| metabolism =
| elimination_half-life = | elimination_half-life = 5–7 hours
| excretion = | excretion = ]


<!--Identifiers--> <!--Identifiers-->
⚫ | CAS_number = <!-- blanked - oldvalue: 78628-28-1 -->
⚫ | ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID = NA | ATC_prefix = A02
⚫ | ATC_suffix = BA06
⚫ | CAS_number_Ref = {{cascite|correct|??}}
⚫ | PubChem = 5105
⚫ | CAS_number = <!-- blanked - oldvalue: 197099-66-4 -->
| ATC_prefix = none
⚫ | ATC_suffix =
⚫ | PubChem =
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} | DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = | DrugBank = DB08806
⚫ | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 4926
⚫ | UNII_Ref = {{fdacite|correct|FDA}}
| UNII = IV9VHT3YUM
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D08495
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 46102


<!--Chemical data--> <!--Chemical data-->
| C=19 | H=28 | N=2 | O=4
| chemical_formula =
⚫ | molecular_weight = 348.437 g/mol

| smiles = O=C(OCC(=O)NCCCOc1cc(ccc1)CN2CCCCC2)C
⚫ | molecular_weight =
| InChI = 1/C19H28N2O4/c1-16(22)25-15-19(23)20-9-6-12-24-18-8-5-7-17(13-18)14-21-10-3-2-4-11-21/h5,7-8,13H,2-4,6,9-12,14-15H2,1H3,(H,20,23)
| InChIKey = SMTZFNFIKUPEJC-UHFFFAOYAO
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C19H28N2O4/c1-16(22)25-15-19(23)20-9-6-12-24-18-8-5-7-17(13-18)14-21-10-3-2-4-11-21/h5,7-8,13H,2-4,6,9-12,14-15H2,1H3,(H,20,23)
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = SMTZFNFIKUPEJC-UHFFFAOYSA-N
}} }}

Revision as of 13:12, 6 December 2011

This page contains a copy of the infobox ({{drugbox}}) taken from revid 447431053 of page Roxatidine with values updated to verified values.
Roxatidine acetate
Clinical data
Routes of
administration		Oral
ATC code
Pharmacokinetic data
Bioavailability80–90%
Protein binding5–7%
MetabolismHepatic deacetylation
Minor involvement of CYP2D6 and CYP2A6
Elimination half-life5–7 hours
ExcretionRenal
Identifiers
IUPAC name
  • 2-oxo-2-(3-propylamino)ethyl acetate
PubChem CID
DrugBank
ChemSpider
UNII
KEGG
ChEMBL
Chemical and physical data
FormulaC19H28N2O4
Molar mass348.437 g/mol g·mol
3D model (JSmol)
SMILES
  • O=C(OCC(=O)NCCCOc1cc(ccc1)CN2CCCCC2)C
InChI
  • InChI=1S/C19H28N2O4/c1-16(22)25-15-19(23)20-9-6-12-24-18-8-5-7-17(13-18)14-21-10-3-2-4-11-21/h5,7-8,13H,2-4,6,9-12,14-15H2,1H3,(H,20,23)
  • Key:SMTZFNFIKUPEJC-UHFFFAOYSA-N
  (verify)