| Revision as of 13:13, 6 December 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 447110409 of page Roxithromycin for the Chem/Drugbox validation project (updated: 'DrugBank').← Previous edit |
Revision as of 13:13, 6 December 2011 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 460512832 of page Rozrolimupab for the Chem/Drugbox validation project (updated: 'CAS_number').Next edit → |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{Drugbox |
|
{{Drugbox |
|
|
| Verifiedfields = changed |
|
| verifiedrevid = 443360310 |
|
| verifiedrevid = 407040478 |
|
| IUPAC_name = (3''R'',4''S'',5''S'',6''R'',7''R'',9''R'',11''S'',12''R'',13''S'',14''R'')-6-oxy-14-ethyl-7,12,13-trihydroxy-4-oxy-10-(2-methoxyethoxymethoxyimino)-3,5,7,9,11,13-hexamethyl-1-oxacyclotetradecan-2-one |
|
|
|
| IUPAC_name = 1. Anti-RhD recombinant human polyclonal antibody composed of 25 unique IgG1 antibodies<br>2. Recombinant human antigen-specific polyclonal antibody (pAb) against RhD antigen expressed in Chinese hamster ovary cells |
|
| image = Roxithromycin.svg |
|
|
|
| image = |
|
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
|
| tradename = |
|
| tradename = |
|
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| Drugs.com = {{drugs.com|international|roxithromycin}} |
|
|
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| pregnancy_category = ? (]) <br /> B1 (]) |
|
|
|
| pregnancy_category = |
|
|
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
|
|
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
|
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
|
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| legal_status = |
|
| legal_status = |
|
| routes_of_administration = |
|
| routes_of_administration = |
| Line 15: |
Line 21: |
|
| bioavailability = |
|
| bioavailability = |
|
| protein_bound = |
|
| protein_bound = |
|
| metabolism = Liver, peak concentration averaging 2 hours after ingestion. |
|
| metabolism = |
|
| elimination_half-life = 12 hours |
|
| elimination_half-life = |
|
|
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
⚫ |
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number = 80214-83-1 |
|
|
|
| CAS_number = <!-- blanked - oldvalue: 909402-77-3 --> |
|
| ATC_prefix = J01 |
|
| ATC_prefix = none |
|
| ATC_supplemental = FA06 |
|
|
| PubChem = 6915744 |
|
| ATC_suffix = |
|
|
| PubChem = |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank = DB00778 |
|
| DrugBank = |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
| ChemSpiderID = 5291557 |
|
| ChemSpiderID = NA |
| ⚫ |
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = 21KOF230FA |
|
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
|
| KEGG = D01710 |
|
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
|
| ChEBI = 48935 |
|
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
|
| ChEMBL = 1214185 |
|
|
|
|
|
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
|
| chemical_formula = |
|
| C=41 | H=76 | N=2 | O=15 |
|
|
|
|
|
| molecular_weight = 837.047 g/mol |
|
|
|
| molecular_weight = Antibodies in the 144.8 -148.8 kDa range |
|
| smiles = O=C3O(CC)(O)(C)(O)(\C(=N\OCOCCOC)(C)C(O)(C)(O1O(C)C(N(C)C)1O)((O2O((O)(OC)(C2)C)C)3C)C)C |
|
|
| InChI = 1/C41H76N2O15/c1-15-29-41(10,49)34(45)24(4)31(42-53-21-52-17-16-50-13)22(2)19-39(8,48)36(58-38-32(44)28(43(11)12)18-23(3)54-38)25(5)33(26(6)37(47)56-29)57-30-20-40(9,51-14)35(46)27(7)55-30/h22-30,32-36,38,44-46,48-49H,15-21H2,1-14H3/b42-31+/t22-,23-,24+,25+,26-,27+,28+,29-,30+,32-,33+,34-,35+,36-,38+,39-,40-,41-/m1/s1 |
|
|
| InChIKey = RXZBMPWDPOLZGW-XMRMVWPWBP |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
|
| StdInChI = 1S/C41H76N2O15/c1-15-29-41(10,49)34(45)24(4)31(42-53-21-52-17-16-50-13)22(2)19-39(8,48)36(58-38-32(44)28(43(11)12)18-23(3)54-38)25(5)33(26(6)37(47)56-29)57-30-20-40(9,51-14)35(46)27(7)55-30/h22-30,32-36,38,44-46,48-49H,15-21H2,1-14H3/b42-31+/t22-,23-,24+,25+,26-,27+,28+,29-,30+,32-,33+,34-,35+,36-,38+,39-,40-,41-/m1/s1 |
|
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
|
| StdInChIKey = RXZBMPWDPOLZGW-XMRMVWPWSA-N |
|
|
}} |
|
}} |
