Revision as of 13:50, 6 December 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,081 edits Saving copy of the {{chembox}} taken from revid 450942402 of page Sedoheptulose for the Chem/Drugbox validation project (updated: 'CASNo').← Previous edit |
Revision as of 13:50, 6 December 2011 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,081 edits Saving copy of the {{chembox}} taken from revid 444100400 of page Sedoheptulose_7-phosphate for the Chem/Drugbox validation project (updated: 'CASNo').Next edit → |
Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{chembox |
|
{{chembox |
|
| verifiedrevid = 449586821 |
|
| verifiedrevid = 444098469 |
|
| ImageFile = Sedoheptulose.svg |
|
| ImageFile = Sedoheptulose 7-phosphate.svg |
|
| ImageSize = |
|
| ImageSize = |
|
| IUPACName = |
|
| IUPACName = |
Line 8: |
Line 8: |
|
| Section1 = {{Chembox Identifiers |
|
| Section1 = {{Chembox Identifiers |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 4573620 |
|
| ChemSpiderID = 144663 |
|
| InChI = 1/C7H14O7/c8-1-3(10)5(12)7(14)6(13)4(11)2-9/h3,5-10,12-14H,1-2H2/t3-,5-,6-,7-/m1/s1 |
|
| InChI = 1/C7H15O10P/c8-1-3(9)5(11)7(13)6(12)4(10)2-17-18(14,15)16/h4-8,10-13H,1-2H2,(H2,14,15,16)/t4-,5-,6-,7+/m1/s1 |
|
| InChIKey = HSNZZMHEPUFJNZ-SHUUEZRQBR |
|
| InChIKey = JDTUMPKOJBQPKX-GBNDHIKLBF |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C7H14O7/c8-1-3(10)5(12)7(14)6(13)4(11)2-9/h3,5-10,12-14H,1-2H2/t3-,5-,6-,7-/m1/s1 |
|
| StdInChI = 1S/C7H15O10P/c8-1-3(9)5(11)7(13)6(12)4(10)2-17-18(14,15)16/h4-8,10-13H,1-2H2,(H2,14,15,16)/t4-,5-,6-,7+/m1/s1 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = HSNZZMHEPUFJNZ-SHUUEZRQSA-N |
|
| StdInChIKey = JDTUMPKOJBQPKX-GBNDHIKLSA-N |
|
| CASNo = <!-- blanked - oldvalue: 3019-74-7 --> |
|
| CASNo = <!-- blanked - oldvalue: 2646-35-7 --> |
|
| PubChem = 5459879 |
|
| PubChem = 165007 |
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
| ChEBI = 16802 |
|
| ChEBI = 15721 |
|
| SMILES = O=C((O)(O)(O)(O)CO)CO |
|
| SMILES = O=P(O)(OC(O)(O)(O)(O)C(=O)CO)O |
|
| MeSHName = sedoheptulose |
|
| MeSHName = sedoheptulose+7-phosphate |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
| Section2 = {{Chembox Properties |
|
| Formula = C<sub>7</sub>H<sub>14</sub>O<sub>7</sub> |
|
| Formula = C<sub>7</sub>H<sub>15</sub>O<sub>10</sub>P |
|
| MolarMass = 210.182 g/mol |
|
| MolarMass = 290.162 g/mol |
|
| Appearance = |
|
| Appearance = |
|
| Density = |
|
| Density = |