Misplaced Pages

:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions - Misplaced Pages

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
< Misplaced Pages:WikiProject Chemicals | Chembox validation Browse history interactively← Previous editNext edit →Content deleted Content addedVisualWikitext
Revision as of 13:50, 6 December 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 444100400 of page Sedoheptulose_7-phosphate for the Chem/Drugbox validation project (updated: 'CASNo').← Previous edit Revision as of 13:50, 6 December 2011 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 456833813 of page Selamectin for the Chem/Drugbox validation project (updated: 'ChEMBL', 'CAS_number').Next edit →
Line 1: Line 1:
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} {{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}}
{{chembox {{Drugbox
| Verifiedfields = changed
| verifiedrevid = 444098469 | verifiedrevid = 401050240
| ImageFile = Sedoheptulose 7-phosphate.svg
| ImageSize = | IUPAC_name =
| image = Selamectin Structural Formulae V.1.svg
| IUPACName =
| image2 = Selamectin_sf.gif
| OtherNames =

| Section1 = {{Chembox Identifiers
<!--Clinical data-->
⚫ | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| tradename = Revolution, Stronghold
⚫ | ChemSpiderID = 144663
| Drugs.com = {{drugs.com|international|selamectin}}
| InChI = 1/C7H15O10P/c8-1-3(9)5(11)7(13)6(12)4(10)2-17-18(14,15)16/h4-8,10-13H,1-2H2,(H2,14,15,16)/t4-,5-,6-,7+/m1/s1
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| InChIKey = JDTUMPKOJBQPKX-GBNDHIKLBF
| pregnancy_US = <!-- A / B / C / D / X -->
| pregnancy_category =
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C -->
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
| legal_status =
| routes_of_administration = Topical

<!--Pharmacokinetic data-->
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =

<!--Identifiers-->
⚫ | CAS_number_Ref = {{cascite|correct|??}}
⚫ | CAS_number = <!-- blanked - oldvalue: 165108-07-6 -->
| CAS_supplemental =
| ATCvet = yes
| ATC_prefix = P54
| ATC_suffix = AA05
| ATC_supplemental =
⚫ | PubChem = 9578507
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank =
⚫ | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
⚫ | ChemSpiderID = 16739776
| UNII_Ref = {{fdacite|changed|FDA}}
| UNII = A2669OWX9N
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = <!-- blanked - oldvalue: 160777 -->
| chemical_formula =
| C=43 | H=63 | N=1 | O=11
| molecular_weight = 769.96 g/mol
| smiles = CC1CCC2(CC3CC(O2)CC= C(C(C(C=CC=C4COC5C4(C(C= C(C5=NO)C)C(=O)O3)O)C) OC6CC(C(C(O6)C)O) OC)C)OC1C7CCCCC7
| InChI = 1/C49H74O14/c1-12-26(2)43-29(5)18-19-48(63-43)24-35-21-34(62-48)17-16-28(4)42(60-40-23-38(54-10)45(32(8)58-40)61-39-22-37(53-9)41(50)31(7)57-39)27(3)14-13-15-33-25-56-46-44(55-11)30(6)20-36(47(51)59-35)49(33,46)52/h13-16,18-20,26-27,29,31-32,34-46,50,52H,12,17,21-25H2,1-11H3/b14-13+,28-16+,33-15+/t26-,27-,29-,31-,32-,34+,35-,36-,37-,38-,39-,40-,41-,42?,43+,44+,45?,46+,48+,49+/m0/s1
| InChIKey = AFSHKCWTGFDXJR-JQPIHPQKBM
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C49H74O14/c1-12-26(2)43-29(5)18-19-48(63-43)24-35-21-34(62-48)17-16-28(4)42(60-40-23-38(54-10)45(32(8)58-40)61-39-22-37(53-9)41(50)31(7)57-39)27(3)14-13-15-33-25-56-46-44(55-11)30(6)20-36(47(51)59-35)49(33,46)52/h13-16,18-20,26-27,29,31-32,34-46,50,52H,12,17,21-25H2,1-11H3/b14-13+,28-16+,33-15+/t26-,27-,29-,31-,32-,34+,35-,36-,37-,38-,39-,40-,41-,42?,43+,44+,45?,46+,48+,49+/m0/s1
| StdInChI = 1S/C7H15O10P/c8-1-3(9)5(11)7(13)6(12)4(10)2-17-18(14,15)16/h4-8,10-13H,1-2H2,(H2,14,15,16)/t4-,5-,6-,7+/m1/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = JDTUMPKOJBQPKX-GBNDHIKLSA-N | StdInChIKey = AFSHKCWTGFDXJR-JQPIHPQKSA-N
⚫ | CASNo = <!-- blanked - oldvalue: 2646-35-7 -->
⚫ | PubChem = 165007
⚫ | ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 15721
| SMILES = O=P(O)(OC(O)(O)(O)(O)C(=O)CO)O
| MeSHName = sedoheptulose+7-phosphate
}}
| Section2 = {{Chembox Properties
| Formula = C<sub>7</sub>H<sub>15</sub>O<sub>10</sub>P
| MolarMass = 290.162 g/mol
| Appearance =
| Density =
| MeltingPt =
| BoilingPt =
}}
| Section3 = {{Chembox Hazards
| Solubility =
| MainHazards =
| FlashPt =
| Autoignition =
}}
}} }}

Revision as of 13:50, 6 December 2011

This page contains a copy of the infobox ({{drugbox}}) taken from revid 456833813 of page Selamectin with values updated to verified values.
WikiProject Chemicals/Chembox validation/VerifiedDataSandbox
Clinical data
Trade namesRevolution, Stronghold
AHFS/Drugs.comInternational Drug Names
Routes of
administration		Topical
ATCvet code
Identifiers
PubChem CID
ChemSpider
UNII
Chemical and physical data
FormulaC43H63NO11
Molar mass769.96 g/mol g·mol
3D model (JSmol)
SMILES
  • CC1CCC2(CC3CC(O2)CC= C(C(C(C=CC=C4COC5C4(C(C= C(C5=NO)C)C(=O)O3)O)C) OC6CC(C(C(O6)C)O) OC)C)OC1C7CCCCC7
InChI
  • InChI=1S/C49H74O14/c1-12-26(2)43-29(5)18-19-48(63-43)24-35-21-34(62-48)17-16-28(4)42(60-40-23-38(54-10)45(32(8)58-40)61-39-22-37(53-9)41(50)31(7)57-39)27(3)14-13-15-33-25-56-46-44(55-11)30(6)20-36(47(51)59-35)49(33,46)52/h13-16,18-20,26-27,29,31-32,34-46,50,52H,12,17,21-25H2,1-11H3/b14-13+,28-16+,33-15+/t26-,27-,29-,31-,32-,34+,35-,36-,37-,38-,39-,40-,41-,42?,43+,44+,45?,46+,48+,49+/m0/s1
  • Key:AFSHKCWTGFDXJR-JQPIHPQKSA-N
  (what is this?)  (verify)