Revision as of 15:08, 6 December 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,084 edits Saving copy of the {{chembox}} taken from revid 464377832 of page Cholesterol for the Chem/Drugbox validation project (updated: '').← Previous edit | Revision as of 15:14, 6 December 2011 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,084 edits Saving copy of the {{chembox}} taken from revid 464377212 of page Isopentane for the Chem/Drugbox validation project (updated: '').Next edit → | ||
Line 1: | Line 1: | ||
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} | {{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} | ||
{{chembox | {{chembox | ||
| verifiedrevid = |
| verifiedrevid = 443886500 | ||
| Name = Isopentane | |||
| ImageFile=Cholesterol.svg | |||
| ImageFile = 2-methylbutane-2D-skeletal.svg | |||
| ImageSize= | |||
| ImageSize = 140px | |||
| ImageFile2=Cholesterol-3d.png | |||
| ImageName = Isopentane | |||
| IUPACName=(3β)-​cholest-​5-​en-​3-​ol | |||
| ImageFile1 = Isopentane-3D-balls.png | |||
| OtherNames=(10''R'',​13''R'')-​10,​13-​dimethyl-​17-​(6-​methylheptan-​2-​yl)-​2,​3,​4,​7,​8,​9,​11,​12,​14,​15,​16,​17-​dodecahydro-​1''H''-​cyclopenta​phenanthren-​3-​ol | |||
| ImageSize1 = 140px | |||
⚫ | | Section1= {{Chembox Identifiers | ||
| ImageName1 = Isopentane | |||
⚫ | | |
||
| IUPACName = 2-Methylbutane | |||
⚫ | | UNII = |
||
| OtherNames = Methylbutane | |||
| InChI = 1/C27H46O/c1-18(2)7-6-8-19(3)23-11-12-24-22-10-9-20-17-21(28)13-15-26(20,4)25(22)14-16-27(23,24)5/h9,18-19,21-25,28H,6-8,10-17H2,1-5H3/t19-,21+,22+,23-,24+,25+,26+,27-/m1/s1 | |||
⚫ | | Section1 = {{Chembox Identifiers | ||
| InChIKey = HVYWMOMLDIMFJA-DPAQBDIFBB | |||
| |
| ChEBI_Ref = {{ebicite|correct|EBI}} | ||
| |
| ChEBI = 30362 | ||
| SMILES = CC(C)CC | |||
⚫ | | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ||
⚫ | | ChemSpiderID = 6308 | ||
⚫ | | UNII_Ref = {{fdacite|correct|FDA}} | ||
⚫ | | UNII = ZH67814I0O | ||
| InChI = 1/C5H12/c1-4-5(2)3/h5H,4H2,1-3H3 | |||
| InChIKey = QWTDNUCVQCZILF-UHFFFAOYAE | |||
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} | | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | ||
| StdInChI = 1S/C5H12/c1-4-5(2)3/h5H,4H2,1-3H3 | |||
| StdInChI = 1S/C27H46O/c1-18(2)7-6-8-19(3)23-11-12-24-22-10-9-20-17-21(28)13-15-26(20,4)25(22)14-16-27(23,24)5/h9,18-19,21-25,28H,6-8,10-17H2,1-5H3/t19-,21+,22+,23-,24+,25+,26+,27-/m1/s1 | |||
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | ||
| StdInChIKey = |
| StdInChIKey = QWTDNUCVQCZILF-UHFFFAOYSA-N | ||
| CASNo= |
| CASNo = 78-78-4 | ||
| CASNo_Ref = {{cascite|correct|CAS}} | | CASNo_Ref = {{cascite|correct|CAS}} | ||
| RTECS = EK4430000 | |||
⚫ | | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ||
⚫ | | ChemSpiderID = |
||
| PubChem=5997 | |||
| KEGG_Ref = {{keggcite|correct|kegg}} | |||
| KEGG = D00040 | |||
| ChEBI_Ref = {{ebicite|correct|EBI}} | |||
| ChEBI = 16113 | |||
| SMILES = C(CCCC(C)C)1CC21(CC32CC=C43(CC(C4)O)C)C | |||
⚫ | }} | ||
⚫ | | |
||
⚫ | | Formula=C<sub> |
||
⚫ | | MolarMass= |
||
| Appearance= white crystalline powder<ref name=MSDS>{{cite web |url=http://physchem.ox.ac.uk/MSDS/CH/cholesterol.html |title=Safety (MSDS) data for cholesterol |accessdate=2007-10-20 |work=}}</ref> | |||
| Density= 1.052 g/cm<sup>3</sup> | |||
⚫ | | MeltingPt= |
||
| BoilingPt=360 °C (decomposes) | |||
| Solubility=0.095 mg/L (30 °C) | |||
| SolubleOther = soluble in ], ], ], ], ], ], ], ] | |||
}} | }} | ||
| |
| Section2 = {{Chembox Properties | ||
⚫ | | Formula = C<sub>5</sub>H<sub>12</sub> | ||
| MainHazards= | |||
⚫ | | MolarMass = 72.15 g/mol | ||
⚫ | | |
||
| Appearance = colorless liquid | |||
⚫ | | Autoignition= | ||
| Density = 0.616 g/ml, liquid<ref name="Wei"/> | |||
| Solubility = Immiscible | |||
⚫ | | MeltingPt = −159.9 °C (113.3 K)<ref name="Wei"/> | ||
| BoilingPt = 27.7 °C (300.9 K)<ref name="Wei"> | |||
James Wei (1999), ''Molecular Symmetry, Rotational Entropy, and Elevated Melting Points''. Ind. Eng. Chem. Res., volume 38 issue 12, pp. 5019–5027 {{doi:10.1021/ie990588m}} | |||
</ref> | |||
⚫ | }} | ||
| Section4 = {{Chembox Thermochemistry | |||
| DeltaHf = −179 kJ/mol | |||
| DeltaHc = −3504 kJ/mol | |||
| Entropy = 260.7 J·K<sup>−1</sup>·mol<sup>−1</sup> | |||
}} | |||
⚫ | | Section7 = {{Chembox Hazards | ||
| ExternalMSDS = | |||
| EUClass = Highly flammable ('''F+''')<br />Harmful ('''Xn''')<br />Dangerous for<br />the environment ('''N''') | |||
| NFPA-H = 1 | |||
| NFPA-F = 4 | |||
⚫ | | NFPA-R = | ||
| RPhrases = {{R12}}, {{R51/53}}, {{R65}},<br />{{R66}}, {{R67}} | |||
| SPhrases = {{S2}}, {{S9}}, {{S16}}, {{S29}},<br />{{S33}}, {{S61}}, {{S62}} | |||
| FlashPt = <−51 °C | |||
⚫ | | Autoignition = 420 °C | ||
| ExploLimits = 1.4–7.6% | |||
}} | |||
| Section8 = {{Chembox Related | |||
| Function = ] | |||
| OtherFunctn = ]<br />]<br />] | |||
| OtherCpds = ]<br />] | |||
}} | }} | ||
}} | }} |
Revision as of 15:14, 6 December 2011
This page contains a copy of the infobox ({{chembox}}) taken from revid 464377212 of page Isopentane with values updated to verified values. |
Names | |
---|---|
IUPAC name 2-Methylbutane | |
Other names Methylbutane | |
Identifiers | |
CAS Number | |
3D model (JSmol) | |
ChEBI | |
ChemSpider | |
RTECS number |
|
UNII | |
InChI
| |
SMILES
| |
Properties | |
Chemical formula | C5H12 |
Molar mass | 72.15 g/mol |
Appearance | colorless liquid |
Density | 0.616 g/ml, liquid |
Melting point | −159.9 °C (113.3 K) |
Boiling point | 27.7 °C (300.9 K) |
Solubility in water | Immiscible |
Thermochemistry | |
Std molar entropy (S298) |
260.7 J·K·mol |
Std enthalpy of formation (ΔfH298) |
−179 kJ/mol |
Std enthalpy of combustion (ΔcH298) |
−3504 kJ/mol |
Hazards | |
NFPA 704 (fire diamond) | 1 4 |
Flash point | <−51 °C |
Explosive limits | 1.4–7.6% |
Related compounds | |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C , 100 kPa). Y verify (what is ?) Infobox references |
Chemical compound