| Revision as of 16:02, 6 December 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,084 edits Saving copy of the {{chembox}} taken from revid 458777410 of page Solamargine for the Chem/Drugbox validation project (updated: 'CASNo').← Previous edit |
Revision as of 16:02, 6 December 2011 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,084 edits Saving copy of the {{drugbox}} taken from revid 460514779 of page Solanezumab for the Chem/Drugbox validation project (updated: 'CAS_number').Next edit → |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{Chembox |
|
{{Drugbox |
|
| Verifiedfields = changed |
|
| Verifiedfields = changed |
|
| verifiedrevid = 458776543 |
|
| verifiedrevid = 450329408 |
|
|
| image = |
|
| ImageFile = Solamargine.svg |
|
|
|
|
|
| ImageSize = 200px |
|
|
|
<!--Monoclonal antibody data--> |
|
| IUPACName = (3β,22α,25''R'')-Spirosol-5-en-3-yl 6-deoxy-α-<small>L</small>-mannopyranosyl-(1→2)--β-<small>D</small>-glucopyranoside |
|
|
| IUPACName_hidden = yes |
|
| type = mab |
|
|
| mab_type = mab |
|
| OtherNames = Solamargin; δ-Solanigrine |
|
|
|
| source = zu |
|
| Section1 = {{Chembox Identifiers |
|
|
|
| target = ] |
| ⚫ |
| CASNo = <!-- blanked - oldvalue: 20311-51-7 --> |
|
|
|
|
| ⚫ |
| CASNo_Ref = {{cascite|changed|??}} |
|
|
|
<!--Clinical data--> |
|
| PubChem = 73611 |
|
|
|
| tradename = |
| ⚫ |
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
|
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| ChEMBL = 443114 |
|
|
|
| pregnancy_US = <!-- A / B / C / D / X --> |
| ⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
|
| pregnancy_category = |
| ⚫ |
| ChemSpiderID = 66278 |
|
|
|
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
|
| SMILES = O(8(O5C/C4=C/C36C2O1(NC(C)CC1)(C)26(C)CC34(C)CC5)O(CO)(O7O(C)(O)(O)7O)8O)9O((O)(O)9O)C |
|
|
|
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
| InChI = 1/C45H73NO15/c1-19-9-14-45(46-17-19)20(2)30-28(61-45)16-27-25-8-7-23-15-24(10-12-43(23,5)26(25)11-13-44(27,30)6)57-42-39(60-41-36(53)34(51)32(49)22(4)56-41)37(54)38(29(18-47)58-42)59-40-35(52)33(50)31(48)21(3)55-40/h7,19-22,24-42,46-54H,8-18H2,1-6H3/t19-,20+,21+,22+,24+,25-,26+,27+,28+,29-,30+,31+,32+,33-,34-,35-,36-,37+,38-,39-,40+,41+,42-,43+,44+,45-/m1/s1 |
|
|
|
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
|
| InChIKey = MBWUSSKCCUMJHO-ZGXDEBHDBL |
|
|
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
|
|
| legal_status = |
|
| StdInChI = 1S/C45H73NO15/c1-19-9-14-45(46-17-19)20(2)30-28(61-45)16-27-25-8-7-23-15-24(10-12-43(23,5)26(25)11-13-44(27,30)6)57-42-39(60-41-36(53)34(51)32(49)22(4)56-41)37(54)38(29(18-47)58-42)59-40-35(52)33(50)31(48)21(3)55-40/h7,19-22,24-42,46-54H,8-18H2,1-6H3/t19-,20+,21+,22+,24+,25-,26+,27+,28+,29-,30+,31+,32+,33-,34-,35-,36-,37+,38-,39-,40+,41+,42-,43+,44+,45-/m1/s1 |
|
|
|
| routes_of_administration = |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
|
|
|
|
| StdInChIKey = MBWUSSKCCUMJHO-ZGXDEBHDSA-N |
|
|
|
<!--Pharmacokinetic data--> |
|
}} |
|
|
|
| bioavailability = |
|
| Section2 = {{Chembox Properties |
|
|
|
| protein_bound = |
|
| C=45|H=73|N=1|O=15 |
|
|
| Appearance = |
|
| metabolism = |
|
|
| elimination_half-life = |
|
| Density = |
|
|
| MeltingPt = |
|
| excretion = |
|
|
|
|
| BoilingPt = |
|
|
|
<!--Identifiers--> |
|
| Solubility = |
|
|
⚫ |
| CAS_number_Ref = {{cascite|correct|??}} |
|
}} |
|
|
⚫ |
| CAS_number = <!-- blanked - oldvalue: 955085-14-0 --> |
|
| Section3 = {{Chembox Hazards |
|
|
| MainHazards = |
|
| ATC_prefix = none |
|
| FlashPt = |
|
| ATC_suffix = |
|
| Autoignition = |
|
| PubChem = |
|
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
}} |
|
|
|
| DrugBank = |
|
⚫ |
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = 5D6PWO0333 |
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
⚫ |
| ChemSpiderID = NA |
|
|
|
|
|
<!--Chemical data--> |
|
|
| C=6396 | H=9922 | N=1712 | O=1996 | S=42 |
|
|
| molecular_weight = 144.1 ] |
|
}} |
|
}} |
