Misplaced Pages

:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions - Misplaced Pages

Article snapshot taken from[REDACTED] with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
< Misplaced Pages:WikiProject Chemicals | Chembox validation Browse history interactively← Previous editNext edit →Content deleted Content addedVisualWikitext
Revision as of 16:09, 6 December 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,084 edits Saving copy of the {{drugbox}} taken from revid 457099546 of page Sparfloxacin for the Chem/Drugbox validation project (updated: 'DrugBank').← Previous edit Revision as of 16:10, 6 December 2011 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,084 edits Saving copy of the {{drugbox}} taken from revid 456911436 of page Sparteine for the Chem/Drugbox validation project (updated: 'ChEMBL').Next edit →
Line 1: Line 1:
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} {{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}}
{{Drugbox {{Drugbox
| Verifiedfields = changed | Verifiedfields = changed
| verifiedrevid = 432040445 | verifiedrevid = 400850032
| IUPAC_name = (7α,9α)-sparteine
| IUPAC_name = 5-amino-1-cyclopropyl-7--6,8-difluoro-4-oxo-quinoline-3-carboxylic acid
| image = Sparfloxacin.svg | image = (−)-Sparteine.svg


<!--Clinical data--> <!--Clinical data-->
| tradename = | tradename =
| Drugs.com = {{drugs.com|CONS|sparfloxacin}} | Drugs.com = {{drugs.com|international|sparteine}}
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| MedlinePlus = a600002
| pregnancy_US = C | pregnancy_US = <!-- A / B / C / D / X -->
| pregnancy_category =
| legal_US = Rx-only
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S8 -->
⚫ | routes_of_administration = Oral
| legal_UK = <!-- GSL / P / POM / CD -->
| legal_US = <!-- OTC / Rx-only -->
| legal_status =
⚫ | routes_of_administration =


<!--Pharmacokinetic data--> <!--Pharmacokinetic data-->
| bioavailability = 92% | bioavailability =
| protein_bound = 45% | protein_bound =
| metabolism =
| metabolism = ] ]<br> ] system not involved
| elimination_half-life = 16 to 30 hours | elimination_half-life =
| excretion = Fecal (50%) and ] (50%) | excretion =


<!--Identifiers--> <!--Identifiers-->
| CASNo_Ref = {{cascite|correct|CAS}}
| CAS_number_Ref = {{cascite|correct|??}} | CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 110871-86-8 | CAS_number = 90-39-1
| ATC_prefix = J01 | ATC_prefix = C01
| ATC_suffix = MA09 | ATC_suffix = BA04
| PubChem = 60464 | PubChem = 644020
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} | DrugBank_Ref = {{drugbankcite|changed|drugbank}}
| DrugBank = DB01208 | DrugBank = DB06727
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 54517 | ChemSpiderID = 559096
| UNII_Ref = {{fdacite|correct|FDA}} | UNII_Ref = {{fdacite|changed|FDA}}
| UNII = Q90AGA787L | UNII = 298897D62S
| KEGG_Ref = {{keggcite|correct|kegg}} | KEGG_Ref = {{keggcite|changed|kegg}}
| KEGG = D00590 | KEGG = D01041
| ChEBI_Ref = {{ebicite|changed|EBI}} | ChEBI_Ref = {{ebicite|changed|EBI}}
| ChEBI = 9212 | ChEBI = 28827
| ChEMBL_Ref = {{ebicite|correct|EBI}} | ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 850 | ChEMBL = <!-- blanked - oldvalue: 44625 -->
⚫ | C=15 | H=26 | N=2

⚫ | molecular_weight = 234.380 g/mol
<!--Chemical data-->
| smiles = C1CCN2C3C(2C1)CN43CCCC4
⚫ | C=19 | H=22 | F=2 | N=4 | O=3
| InChI = 1/C15H26N2/c1-3-7-16-11-13-9-12(14(16)5-1)10-17-8-4-2-6-15(13)17/h12-15H,1-11H2/t12-,13-,14-,15+/m0/s1
⚫ | molecular_weight = 392.41 g/mol
| InChIKey = SLRCCWJSBJZJBV-ZQDZILKHBW
| smiles = C1CN(C(N1)C)c2c(c(c3c(c2F)n(cc(c3=O)C(=O)O)C4CC4)N)F
| InChI = 1/C19H22F2N4O3/c1-8-5-24(6-9(2)23-8)17-13(20)15(22)12-16(14(17)21)25(10-3-4-10)7-11(18(12)26)19(27)28/h7-10,23H,3-6,22H2,1-2H3,(H,27,28)/t8-,9+
| InChIKey = DZZWHBIBMUVIIW-DTORHVGOBM
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C19H22F2N4O3/c1-8-5-24(6-9(2)23-8)17-13(20)15(22)12-16(14(17)21)25(10-3-4-10)7-11(18(12)26)19(27)28/h7-10,23H,3-6,22H2,1-2H3,(H,27,28)/t8-,9+ | StdInChI = 1S/C15H26N2/c1-3-7-16-11-13-9-12(14(16)5-1)10-17-8-4-2-6-15(13)17/h12-15H,1-11H2/t12-,13-,14-,15+/m0/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = DZZWHBIBMUVIIW-DTORHVGOSA-N | StdInChIKey = SLRCCWJSBJZJBV-ZQDZILKHSA-N
| synonyms = (6''R'',8''S'',10''R'',12''S'')-7,15-diazatetracycloheptadecane
}} }}

Revision as of 16:10, 6 December 2011

This page contains a copy of the infobox ({{drugbox}}) taken from revid 456911436 of page Sparteine with values updated to verified values.
WikiProject Chemicals/Chembox validation/VerifiedDataSandbox
Clinical data
Other names(6R,8S,10R,12S)-7,15-diazatetracycloheptadecane
AHFS/Drugs.comInternational Drug Names
ATC code
Identifiers
IUPAC name
  • (7α,9α)-sparteine
CAS Number
PubChem CID
DrugBank
ChemSpider
UNII
KEGG
ChEBI
Chemical and physical data
FormulaC15H26N2
Molar mass234.380 g/mol g·mol
3D model (JSmol)
SMILES
  • C1CCN2C3C(2C1)CN43CCCC4
InChI
  • InChI=1S/C15H26N2/c1-3-7-16-11-13-9-12(14(16)5-1)10-17-8-4-2-6-15(13)17/h12-15H,1-11H2/t12-,13-,14-,15+/m0/s1
  • Key:SLRCCWJSBJZJBV-ZQDZILKHSA-N
  (what is this?)  (verify)
Misplaced Pages:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions Add topic