Revision as of 17:55, 9 January 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 467405690 of page Stannane for the Chem/Drugbox validation project (updated: 'CASNo').← Previous edit |
Revision as of 17:55, 9 January 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 470275954 of page Stanozolol for the Chem/Drugbox validation project (updated: 'ChEMBL', 'CAS_number').Next edit → |
Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{chembox |
|
{{Drugbox |
|
|
|
⚫ |
| verifiedrevid = 444117370 |
|
|
|
| Verifiedfields = changed |
|
| Name = Stannane |
|
|
⚫ |
| verifiedrevid = 458282542 |
|
| ImageFile = Stannane-CRC-IR-Raman-dimensions-2D.png |
|
|
|
| image = stanozolol.svg |
|
| ImageSize = 160px |
|
|
|
| IUPAC_name = (1S,3aS,3bR,5aS,10aS,10bS,12aS)-1,10a,12a-trimethyl-1,2,3,3a,3b,4,5,5a,6,7,10,10a,10b,11,12,12a-hexadecahydrocyclopentanaphthoindazol-1-ol |
|
| ImageName = Structure and dimensions of the stannane molecule |
|
|
|
|
|
| ImageFileL1 = Stannane-from-xtal-3D-balls.png |
|
|
|
|
|
| ImageSizeL1 = 110px |
|
|
|
<!--Clinical data--> |
|
| ImageNameL1 = Ball-and-stick model of the stannane molecule |
|
|
|
| tradename = |
|
| ImageFileR1 = Stannane-3D-vdW.png |
|
|
|
| Drugs.com = {{drugs.com|MTM|winstrol}} |
|
| ImageSizeR1 = 110px |
|
|
|
| pregnancy_category = X |
|
| ImageNameR1 = Space-filling model of the stannane molecule |
|
|
|
| legal_status = Prescription only <br> (]) |
|
| IUPACName = Stannane |
|
|
|
| routes_of_administration = ], ] |
|
| OtherNames = tin tetrahydride<br />tin hydride<br />stannane |
|
|
|
|
|
| Section1 = {{Chembox Identifiers |
|
|
|
<!--Pharmacokinetic data--> |
⚫ |
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
|
|
| bioavailability = ? |
|
| ChEBI = 30419 |
|
|
| SMILES = |
|
| metabolism = ] |
|
|
| elimination_half-life = 1 day |
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
|
| excretion = ]: 84% |
⚫ |
| ChemSpiderID = 109776 |
|
|
|
|
|
| InChI = 1/Sn.4H/rH4Sn/h1H4 |
|
|
|
<!--Identifiers--> |
|
| InChIKey = KXCAEQNNTZANTK-GVMKXMNPAM |
|
|
⚫ |
| CAS_number_Ref = {{cascite|changed|??}} |
|
⚫ |
| CAS_number = <!-- blanked - oldvalue: 10418-03-8 --> |
|
|
| ATC_prefix = A14 |
|
|
| ATC_suffix = AA02 |
|
|
| PubChem = 25249 |
|
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
|
| DrugBank = DB06718 |
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
⚫ |
| ChemSpiderID = 23582 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = 4R1VB9P8V3 |
|
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
|
| KEGG = D00444 |
|
⚫ |
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEMBL = <!-- blanked - oldvalue: 1200324 --> |
|
|
| C=21 | H=32 | N=2 | O=1 |
|
|
| molecular_weight = 328.49 |
|
|
| smiles = O5(C)CC43(2(Cc1c(nnc1)C2CC3)C)CC45C |
|
|
| InChI = 1/C21H32N2O/c1-19-11-13-12-22-23-18(13)10-14(19)4-5-15-16(19)6-8-20(2)17(15)7-9-21(20,3)24/h12,14-17,24H,4-11H2,1-3H3,(H,22,23)/t14-,15+,16-,17-,19-,20-,21-/m0/s1 |
|
|
| InChIKey = LKAJKIOFIWVMDJ-IYRCEVNGBP |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
|
| StdInChI = 1S/C21H32N2O/c1-19-11-13-12-22-23-18(13)10-14(19)4-5-15-16(19)6-8-20(2)17(15)7-9-21(20,3)24/h12,14-17,24H,4-11H2,1-3H3,(H,22,23)/t14-,15+,16-,17-,19-,20-,21-/m0/s1 |
|
| StdInChI = 1S/Sn.4H |
|
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = KXCAEQNNTZANTK-UHFFFAOYSA-N |
|
| StdInChIKey = LKAJKIOFIWVMDJ-IYRCEVNGSA-N |
⚫ |
| CASNo_Ref = {{cascite|correct|??}} |
|
⚫ |
| CASNo = <!-- blanked - oldvalue: 2406-52-2 --> |
|
|
| RTECS = |
|
|
}} |
|
|
| Section2 = {{Chembox Properties |
|
|
| Formula = {{tin}}{{hydrogen|4}} |
|
|
| MolarMass = 122.71 g mol<sup>−1</sup> |
|
|
| Appearance = colourless gas |
|
|
| Density = 5.4 g dm<sup>−3</sup>, gas |
|
|
| Solubility = ? g/100 ml (?°C) |
|
|
| MeltingPt = −146 °C (127.15 K) |
|
|
| BoilingPt = −52 °C (221.15 K) |
|
|
| pKa = |
|
|
| pKb = |
|
|
| Viscosity = |
|
|
}} |
|
|
| Section3 = {{Chembox Structure |
|
|
| MolShape = |
|
|
| Coordination = |
|
|
| CrystalStruct = |
|
|
| Dipole = |
|
|
}} |
|
|
| Section7 = {{Chembox Hazards |
|
|
| ExternalMSDS = |
|
|
| MainHazards = |
|
|
| FlashPt = |
|
|
| RPhrases = |
|
|
| SPhrases = |
|
|
}} |
|
|
| Section8 = {{Chembox Related |
|
|
| Function = ]s |
|
|
| OtherFunctn = ], ], Bu<sub>3</sub>SnH |
|
|
}} |
|
|
}} |
|
}} |