Revision as of 17:55, 9 January 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 470275954 of page Stanozolol for the Chem/Drugbox validation project (updated: 'ChEMBL', 'CAS_number').← Previous edit |
Revision as of 17:55, 9 January 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 464461804 of page Staphyloxanthin for the Chem/Drugbox validation project (updated: 'CASNo').Next edit → |
Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{Drugbox |
|
{{chembox |
|
⚫ |
| verifiedrevid = 449645463 |
|
|
|
|
|
| Name = Staphyloxanthin |
|
| Verifiedfields = changed |
|
|
|
| ImageFile = Staphyloxanthin.svg |
⚫ |
| verifiedrevid = 458282542 |
|
|
|
| ImageSize = 350px |
|
| image = stanozolol.svg |
|
|
|
| ImageName = Chemical structure of staphyloxanthin |
|
| IUPAC_name = (1S,3aS,3bR,5aS,10aS,10bS,12aS)-1,10a,12a-trimethyl-1,2,3,3a,3b,4,5,5a,6,7,10,10a,10b,11,12,12a-hexadecahydrocyclopentanaphthoindazol-1-ol |
|
|
|
| ImageAlt = Chemical structure of staphyloxanthin |
|
|
|
|
|
| IUPACName = <nowiki> [(2S,3R,4S,5S,6R)-3,4, |
|
|
|
|
|
5-trihydroxy-6-oxymethyl]oxan-2-yl](2E,4E,6E,8E,10E,12E,14E,16E,18E)-2,6,10,15,19,23-hexamethyltetracosa-2,4,6,8,10,12,14,16,18,22-decaenoate</nowiki> |
|
<!--Clinical data--> |
|
|
| tradename = |
|
| OtherNames = <!-- <br> --> |
|
|
|Section1= {{Chembox Identifiers |
|
| Drugs.com = {{drugs.com|MTM|winstrol}} |
|
|
| pregnancy_category = X |
|
|
| legal_status = Prescription only <br> (]) |
|
|
| routes_of_administration = ], ] |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
|
| bioavailability = ? |
|
|
| metabolism = ] |
|
|
| elimination_half-life = 1 day |
|
|
| excretion = ]: 84% |
|
|
|
|
|
<!--Identifiers--> |
|
⚫ |
| CAS_number_Ref = {{cascite|changed|??}} |
|
⚫ |
| CAS_number = <!-- blanked - oldvalue: 10418-03-8 --> |
|
|
| ATC_prefix = A14 |
|
|
| ATC_suffix = AA02 |
|
⚫ |
| PubChem = 25249 |
|
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
|
| DrugBank = DB06718 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 23582 |
|
| ChemSpiderID = 4947803 |
|
|
| InChI1 = 1/C51H78O8/c1-10-39(4)25-16-14-12-11-13-15-17-33-44(36-52)51(9,35-23-32-43(8)49(57)59-50-48(56)47(55)46(54)45(37-53)58-50)34-19-18-26-40(5)28-21-30-42(7)31-22-29-41(6)27-20-24-38(2)3/h17-19,21-24,26,28-33,35-36,39,44-48,50,53-56H,10-16,20,25,27,34,37H2,1-9H3/b19-18+,28-21+,31-22+,33-17-,35-23+,40-26+,41-29+,42-30+,43-32+/t39?,44?,45-,46-,47+,48-,50-,51?/m1/s1 |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
|
| InChIKey1 = ZGBLADNGFNFPBV-OQMOJWPEBF |
|
| UNII = 4R1VB9P8V3 |
|
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
|
| KEGG = D00444 |
|
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEMBL = <!-- blanked - oldvalue: 1200324 --> |
|
|
| C=21 | H=32 | N=2 | O=1 |
|
|
| molecular_weight = 328.49 |
|
|
| smiles = O5(C)CC43(2(Cc1c(nnc1)C2CC3)C)CC45C |
|
|
| InChI = 1/C21H32N2O/c1-19-11-13-12-22-23-18(13)10-14(19)4-5-15-16(19)6-8-20(2)17(15)7-9-21(20,3)24/h12,14-17,24H,4-11H2,1-3H3,(H,22,23)/t14-,15+,16-,17-,19-,20-,21-/m0/s1 |
|
|
| InChIKey = LKAJKIOFIWVMDJ-IYRCEVNGBP |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C21H32N2O/c1-19-11-13-12-22-23-18(13)10-14(19)4-5-15-16(19)6-8-20(2)17(15)7-9-21(20,3)24/h12,14-17,24H,4-11H2,1-3H3,(H,22,23)/t14-,15+,16-,17-,19-,20-,21-/m0/s1 |
|
| StdInChI = 1S/C51H78O8/c1-10-39(4)25-16-14-12-11-13-15-17-33-44(36-52)51(9,35-23-32-43(8)49(57)59-50-48(56)47(55)46(54)45(37-53)58-50)34-19-18-26-40(5)28-21-30-42(7)31-22-29-41(6)27-20-24-38(2)3/h17-19,21-24,26,28-33,35-36,39,44-48,50,53-56H,10-16,20,25,27,34,37H2,1-9H3/b19-18+,28-21+,31-22+,33-17-,35-23+,40-26+,41-29+,42-30+,43-32+/t39?,44?,45-,46-,47+,48-,50-,51?/m1/s1 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = LKAJKIOFIWVMDJ-IYRCEVNGSA-N |
|
| StdInChIKey = ZGBLADNGFNFPBV-OQMOJWPESA-N |
|
⚫ |
| CASNo = <!-- blanked - oldvalue: 71869-01-7 --> |
|
⚫ |
| CASNo_Ref = {{cascite|correct|??}}= |
|
|
| CASOther = |
|
⚫ |
| PubChem = 24892781 |
|
|
| SMILES = O=C(O1O((O)(O)1O)CO)\C(=C\C=C\C(C)(C\C=C\C=C(\C=C\C=C(\C=C\C=C(/C)CC\C=C(/C)C)C)C)C(\C=C/CCCCCCCC(C)CC)C=O)C |
|
|
| InChI = |
|
|
| MeSHName = |
|
|
}} |
|
|
|Section2= {{Chembox Properties |
|
|
| Formula = C<sub>51</sub>H<sub>78</sub>O<sub>8</sub> |
|
|
| MolarMass = 819.16 g/mol |
|
|
| ExactMass = 818.569669 u |
|
|
| Appearance = |
|
|
| Density = |
|
|
| MeltingPt = <!-- °C --> |
|
|
| BoilingPt = <!-- °C --> |
|
|
| Solubility = |
|
|
}} |
|
}} |
|
}} |