Misplaced Pages

:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions - Misplaced Pages

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
< Misplaced Pages:WikiProject Chemicals | Chembox validation Browse history interactively← Previous editNext edit →Content deleted Content addedVisualWikitext
Revision as of 18:12, 9 January 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 447911783 of page Sulfalene for the Chem/Drugbox validation project (updated: '').← Previous edit Revision as of 18:12, 9 January 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 456759095 of page Sulfamerazine for the Chem/Drugbox validation project (updated: '').Next edit →
Line 1: Line 1:
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} {{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}}
{{Drugbox {{Drugbox
| Verifiedfields = changed
| Watchedfields = changed | Watchedfields = changed
| verifiedrevid = 444121406 | verifiedrevid = 409963594
| IUPAC_name = 4-Amino-''N''-(3-methoxypyrazinyl)benzenesulfonamide | IUPAC_name = 4-amino-''N''-(4-methylpyrimidin-2-yl)<br>benzenesulfonamide
| image = sulfalene.png | image = Sulfamerazine_Structural_Formulae_V.1.svg‎
| width =
| alt =
| image2 =
| width2 =
| imagename = <!-- else may use drug_name -->
| drug_name = <!-- else may use imagename -->
| caption =


<!--Clinical data--> <!--Clinical data-->
| tradename = | tradename =
| Drugs.com = {{drugs.com|international|sulfametopyrazine}} | Drugs.com = {{drugs.com|international|sulfamerazine}}
| licence_EU = <!-- EMA requires brand name -->
| licence_US = <!-- FDA may use generic name -->
| DailyMedID = <!-- preference to licence_US -->
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> | pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_US = <!-- A / B / C / D / X --> | pregnancy_US = <!-- A / B / C / D / X -->
| pregnancy_category = | pregnancy_category =
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> | legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 -->
| legal_CA = <!-- OTC, Rx-only, Schedule I, II, III, IV, V, VI, VII, VIII --> | legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_UK = <!-- GSL, P, POM, CD, CD Lic, CD POM, CD No Reg POM, CD (Benz) POM, CD (Anab) POM or CD Inv POM --> | legal_UK = <!-- GSL / P / POM / CD / Class A, B, C -->
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> | legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
| legal_status = | legal_status =
| routes_of_administration =
| dependency_liability =
| routes_of_administration = Oral<ref name="MIMS">{{cite web | url = http://www.cimsasia.com/USA/drug/info/sulfalene/?q = Sulphonamides&type = full | title = Sulfalene | work = MIMS Drug Information System | accessdate = 26 August 2011}}</ref>


<!--Pharmacokinetic data--> <!--Pharmacokinetic data-->
| bioavailability = | bioavailability =
| protein_bound = 60 to 80%<ref name="MIMS"/> | protein_bound =
| metabolism = | metabolism =
| elimination_half-life = 60 to 65 hours<ref name="MIMS"/> | elimination_half-life =
| excretion = ]<ref name="MIMS"/> | excretion =


<!--Identifiers--> <!--Identifiers-->
| CASNo_Ref = {{cascite|correct|CAS}}
| CAS_number = 152-47-6
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_supplemental =
| ATCvet = | CAS_number = 127-79-7
| ATC_prefix = J01 | ATC_prefix = J01
| ATC_suffix = ED02 | ATC_suffix = ED07
⚫ | PubChem = 5325
| ATC_supplemental =
⚫ | DrugBank_Ref = {{drugbankcite|changed|drugbank}}
⚫ | PubChem = 9047
⚫ | DrugBank = DB01581
| PubChemSubstance =
| IUPHAR_ligand =
⚫ | DrugBank_Ref = {{drugbankcite|correct|drugbank}}
⚫ | DrugBank = DB00664
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 8695 | ChemSpiderID = 5134
| UNII_Ref = {{fdacite|correct|FDA}} | UNII_Ref = {{fdacite|correct|FDA}}
| UNII = T6BL4ZC15G | UNII = UR1SAB295F
| KEGG_Ref = {{keggcite|correct|kegg}} | KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D01216 | KEGG = D02435
| ChEBI_Ref = {{ebicite|correct|EBI}} | ChEBI_Ref = {{ebicite|changed|EBI}}
| ChEBI = 102130
| ChEMBL_Ref = {{ebicite|correct|EBI}} | ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 438


<!--Chemical data--> <!--Chemical data-->
| C=11 | H=12 | N=4 | O=3 | S=1 | C=11 | H=12 | N=4 | O=2 | S=1
| molecular_weight = 280.304 g/mol | molecular_weight = 264.305 g/mol
| smiles = O=S(=O)(Nc1nccnc1OC)c2ccc(N)cc2 | smiles = O=S(=O)(Nc1nc(ccn1)C)c2ccc(N)cc2
| InChI = 1/C11H12N4O3S/c1-18-11-10(13-6-7-14-11)15-19(16,17)9-4-2-8(12)3-5-9/h2-7H,12H2,1H3,(H,13,15) | InChI = 1/C11H12N4O2S/c1-8-6-7-13-11(14-8)15-18(16,17)10-4-2-9(12)3-5-10/h2-7H,12H2,1H3,(H,13,14,15)
| InChIKey = KXRZBTAEDBELFD-UHFFFAOYAH | InChIKey = QPPBRPIAZZHUNT-UHFFFAOYAN
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C11H12N4O3S/c1-18-11-10(13-6-7-14-11)15-19(16,17)9-4-2-8(12)3-5-9/h2-7H,12H2,1H3,(H,13,15) | StdInChI = 1S/C11H12N4O2S/c1-8-6-7-13-11(14-8)15-18(16,17)10-4-2-9(12)3-5-10/h2-7H,12H2,1H3,(H,13,14,15)
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = KXRZBTAEDBELFD-UHFFFAOYSA-N | StdInChIKey = QPPBRPIAZZHUNT-UHFFFAOYSA-N
| synonyms = Sulfametopyrazine
| density =
| melting_point =
| melting_high =
| melting_notes =
| boiling_point =
| boiling_notes =
| solubility =
| specific_rotation =
| sec_combustion =
}} }}

Revision as of 18:12, 9 January 2012

This page contains a copy of the infobox ({{drugbox}}) taken from revid 456759095 of page Sulfamerazine with values updated to verified values.
WikiProject Chemicals/Chembox validation/VerifiedDataSandbox
Clinical data
AHFS/Drugs.comInternational Drug Names
ATC code
Identifiers
IUPAC name
  • 4-amino-N-(4-methylpyrimidin-2-yl)
    benzenesulfonamide
CAS Number
PubChem CID
DrugBank
ChemSpider
UNII
KEGG
ChEBI
ChEMBL
Chemical and physical data
FormulaC11H12N4O2S
Molar mass264.305 g/mol g·mol
3D model (JSmol)
SMILES
  • O=S(=O)(Nc1nc(ccn1)C)c2ccc(N)cc2
InChI
  • InChI=1S/C11H12N4O2S/c1-8-6-7-13-11(14-8)15-18(16,17)10-4-2-9(12)3-5-10/h2-7H,12H2,1H3,(H,13,14,15)
  • Key:QPPBRPIAZZHUNT-UHFFFAOYSA-N
  (what is this?)  (verify)