Revision as of 18:12, 9 January 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 447911783 of page Sulfalene for the Chem/Drugbox validation project (updated: '').← Previous edit |
Revision as of 18:12, 9 January 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 456759095 of page Sulfamerazine for the Chem/Drugbox validation project (updated: '').Next edit → |
Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{Drugbox |
|
{{Drugbox |
|
|
| Verifiedfields = changed |
|
| Watchedfields = changed |
|
| Watchedfields = changed |
|
| verifiedrevid = 444121406 |
|
| verifiedrevid = 409963594 |
|
| IUPAC_name = 4-Amino-''N''-(3-methoxypyrazinyl)benzenesulfonamide |
|
| IUPAC_name = 4-amino-''N''-(4-methylpyrimidin-2-yl)<br>benzenesulfonamide |
|
| image = sulfalene.png |
|
| image = Sulfamerazine_Structural_Formulae_V.1.svg |
|
| width = |
|
|
| alt = |
|
|
| image2 = |
|
|
| width2 = |
|
|
| imagename = <!-- else may use drug_name --> |
|
|
| drug_name = <!-- else may use imagename --> |
|
|
| caption = |
|
|
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
|
| tradename = |
|
| tradename = |
|
| Drugs.com = {{drugs.com|international|sulfametopyrazine}} |
|
| Drugs.com = {{drugs.com|international|sulfamerazine}} |
|
| licence_EU = <!-- EMA requires brand name --> |
|
|
| licence_US = <!-- FDA may use generic name --> |
|
|
| DailyMedID = <!-- preference to licence_US --> |
|
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| pregnancy_category = |
|
| pregnancy_category = |
|
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
|
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
|
| legal_CA = <!-- OTC, Rx-only, Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
| legal_UK = <!-- GSL, P, POM, CD, CD Lic, CD POM, CD No Reg POM, CD (Benz) POM, CD (Anab) POM or CD Inv POM --> |
|
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> |
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| legal_status = |
|
| legal_status = |
|
|
| routes_of_administration = |
|
| dependency_liability = |
|
|
| routes_of_administration = Oral<ref name="MIMS">{{cite web | url = http://www.cimsasia.com/USA/drug/info/sulfalene/?q = Sulphonamides&type = full | title = Sulfalene | work = MIMS Drug Information System | accessdate = 26 August 2011}}</ref> |
|
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
<!--Pharmacokinetic data--> |
|
| bioavailability = |
|
| bioavailability = |
|
| protein_bound = 60 to 80%<ref name="MIMS"/> |
|
| protein_bound = |
|
| metabolism = |
|
| metabolism = |
|
| elimination_half-life = 60 to 65 hours<ref name="MIMS"/> |
|
| elimination_half-life = |
|
| excretion = ]<ref name="MIMS"/> |
|
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CAS_number = 152-47-6 |
|
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_supplemental = |
|
|
| ATCvet = |
|
| CAS_number = 127-79-7 |
|
| ATC_prefix = J01 |
|
| ATC_prefix = J01 |
|
| ATC_suffix = ED02 |
|
| ATC_suffix = ED07 |
|
⚫ |
| PubChem = 5325 |
|
| ATC_supplemental = |
|
|
⚫ |
| DrugBank_Ref = {{drugbankcite|changed|drugbank}} |
⚫ |
| PubChem = 9047 |
|
|
⚫ |
| DrugBank = DB01581 |
|
| PubChemSubstance = |
|
|
| IUPHAR_ligand = |
|
⚫ |
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
⚫ |
| DrugBank = DB00664 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 8695 |
|
| ChemSpiderID = 5134 |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = T6BL4ZC15G |
|
| UNII = UR1SAB295F |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG = D01216 |
|
| KEGG = D02435 |
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEBI = 102130 |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
|
| ChEMBL = 438 |
|
|
|
|
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| C=11 | H=12 | N=4 | O=3 | S=1 |
|
| C=11 | H=12 | N=4 | O=2 | S=1 |
|
| molecular_weight = 280.304 g/mol |
|
| molecular_weight = 264.305 g/mol |
|
| smiles = O=S(=O)(Nc1nccnc1OC)c2ccc(N)cc2 |
|
| smiles = O=S(=O)(Nc1nc(ccn1)C)c2ccc(N)cc2 |
|
| InChI = 1/C11H12N4O3S/c1-18-11-10(13-6-7-14-11)15-19(16,17)9-4-2-8(12)3-5-9/h2-7H,12H2,1H3,(H,13,15) |
|
| InChI = 1/C11H12N4O2S/c1-8-6-7-13-11(14-8)15-18(16,17)10-4-2-9(12)3-5-10/h2-7H,12H2,1H3,(H,13,14,15) |
|
| InChIKey = KXRZBTAEDBELFD-UHFFFAOYAH |
|
| InChIKey = QPPBRPIAZZHUNT-UHFFFAOYAN |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C11H12N4O3S/c1-18-11-10(13-6-7-14-11)15-19(16,17)9-4-2-8(12)3-5-9/h2-7H,12H2,1H3,(H,13,15) |
|
| StdInChI = 1S/C11H12N4O2S/c1-8-6-7-13-11(14-8)15-18(16,17)10-4-2-9(12)3-5-10/h2-7H,12H2,1H3,(H,13,14,15) |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = KXRZBTAEDBELFD-UHFFFAOYSA-N |
|
| StdInChIKey = QPPBRPIAZZHUNT-UHFFFAOYSA-N |
|
| synonyms = Sulfametopyrazine |
|
|
| density = |
|
|
| melting_point = |
|
|
| melting_high = |
|
|
| melting_notes = |
|
|
| boiling_point = |
|
|
| boiling_notes = |
|
|
| solubility = |
|
|
| specific_rotation = |
|
|
| sec_combustion = |
|
|
}} |
|
}} |