| Revision as of 18:40, 9 January 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 456636230 of page Tandospirone for the Chem/Drugbox validation project (updated: 'CAS_number').← Previous edit |
Revision as of 18:40, 9 January 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 460516063 of page Tanezumab for the Chem/Drugbox validation project (updated: 'CAS_number').Next edit → |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{Drugbox |
|
{{Drugbox |
|
| Verifiedfields = changed |
|
| Verifiedfields = changed |
|
| verifiedrevid = 456484044 |
|
| verifiedrevid = 450329557 |
|
|
| image = |
|
| IUPAC_name = (1''R'',2''R'',6''S'',7''S'')-4-{4-butyl}-4-azatricyclodecane-3,5-dione |
|
|
|
|
|
| image = Tandospirone.svg |
|
|
|
<!--Monoclonal antibody data--> |
|
|
| type = mab |
|
|
| mab_type = mab |
|
|
| source = zu/o |
|
|
| target = ] |
|
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
|
| tradename = |
|
| tradename = |
|
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| Drugs.com = {{drugs.com|international|tandospirone}} |
|
|
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| pregnancy_category = |
|
| pregnancy_category = |
|
|
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
| ⚫ |
| legal_status = Rx-only |
|
|
|
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
| ⚫ |
| routes_of_administration = Oral |
|
|
|
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
|
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
⚫ |
| legal_status = |
|
⚫ |
| routes_of_administration = |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
<!--Pharmacokinetic data--> |
|
| bioavailability = |
|
| bioavailability = |
|
|
| protein_bound = |
|
| metabolism = |
|
| metabolism = |
|
| elimination_half-life = 1.2–1.4 hours |
|
| elimination_half-life = |
|
| excretion = |
|
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
| CAS_number_Ref = {{cascite|changed|??}} |
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
⚫ |
| ChemSpiderID = NA |
| ⚫ |
| CAS_number = <!-- blanked - oldvalue: 112457-95-1 --> |
|
|
⚫ |
| CAS_number_Ref = {{cascite|correct|??}} |
|
⚫ |
| CAS_number = <!-- blanked - oldvalue: 880266-57-9 --> |
|
| ATC_prefix = none |
|
| ATC_prefix = none |
|
| ATC_suffix = |
|
| ATC_suffix = |
|
| PubChem = 91273 |
|
| PubChem = |
|
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| IUPHAR_ligand = 55 |
|
|
|
| DrugBank = |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ⚫ |
| ChemSpiderID = 82421 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = 190230I669 |
|
| UNII = EQL0E9GCX1 |
| ⚫ |
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
|
| ChEMBL = 274047 |
|
|
|
|
|
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| C=21 | H=29 | N=5 | O=2 |
|
| C=6464 | H=9942 | N=1706 | O=2026 | S=46 |
|
| molecular_weight = 383.487 g/mol |
|
| molecular_weight = 145.4 ] |
|
|
| synonyms = RN624 |
|
| smiles = O=C1N(C(=O)312CC3C2)CCCCN5CCN(c4ncccn4)CC5 |
|
|
| InChI = 1/C21H29N5O2/c27-19-17-15-4-5-16(14-15)18(17)20(28)26(19)9-2-1-8-24-10-12-25(13-11-24)21-22-6-3-7-23-21/h3,6-7,15-18H,1-2,4-5,8-14H2/t15-,16+,17+,18- |
|
|
| InChIKey = CEIJFEGBUDEYSX-FZDBZEDMBN |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
|
| StdInChI = 1S/C21H29N5O2/c27-19-17-15-4-5-16(14-15)18(17)20(28)26(19)9-2-1-8-24-10-12-25(13-11-24)21-22-6-3-7-23-21/h3,6-7,15-18H,1-2,4-5,8-14H2/t15-,16+,17+,18- |
|
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
|
| StdInChIKey = CEIJFEGBUDEYSX-FZDBZEDMSA-N |
|
|
}} |
|
}} |
