Revision as of 18:45, 9 January 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 444133032 of page Tautomycin for the Chem/Drugbox validation project (updated: 'ChEMBL', 'StdInChI').← Previous edit |
Revision as of 18:45, 9 January 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 457630615 of page Tazarotene for the Chem/Drugbox validation project (updated: 'DrugBank').Next edit → |
Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{Chembox |
|
{{Drugbox |
|
|
| Verifiedfields = changed |
|
| ImageFile = Tautomycin.png |
|
|
|
| verifiedrevid = 457629611 |
|
| ImageSize = |
|
|
|
| IUPAC_name = ethyl 6-pyridine-3-carboxylate |
|
| IUPACName = -1,7-dioxaspiroundecan-2-yl]-3,7-dihydroxy-1-isopropyl-2-methoxy-6-methyl-5-oxo-undecyl] (3R)-3-hydroxy-3-(4-methyl-2,5-dioxo-3-furyl)propanoate |
|
|
|
| image = Tazarotene.png |
|
| OtherNames = |
|
|
|
|
|
| Section1 = {{Chembox Identifiers |
|
|
|
<!--Clinical data--> |
|
| InChI = 1S/C41H66O13/c1-21(2)36(51-34(47)20-31(45)35-27(8)39(48)52-40(35)49)38(50-10)32(46)19-30(44)26(7)29(43)13-11-24(5)37-25(6)16-18-41(54-37)17-15-23(4)33(53-41)14-12-22(3)28(9)42/h21-26,29,31-33,36-38,43,45-46H,11-20H2,1-10H3/t22-,23+,24+,25-,26-,29-,31+,32+,33-,36+,37-,38+,41+/m0/s1 |
|
|
|
| tradename = Tazorac |
|
| InChIKey1 = RFCWHQNNCOJYTR-IRCAEPKSSA-N |
|
|
|
| Drugs.com = {{drugs.com|monograph|tazarotene}} |
|
| InChI1 = 1S/C41H66O13/c1-21(2)36(51-34(47)20-31(45)35-27(8)39(48)52-40(35)49)38(50-10)32(46)19-30(44)26(7)29(43)13-11-24(5)37-25(6)16-18-41(54-37)17-15-23(4)33(53-41)14-12-22(3)28(9)42/h21-26,29,31-33,36-38,43,45-46H,11-20H2,1-10H3/t22-,23+,24+,25-,26-,29-,31+,32+,33-,36+,37-,38+,41+/m0/s1 |
|
|
|
| pregnancy_category = X <small>(])</small> |
|
| CASNo = |
|
|
|
| legal_status = Prescription Only |
⚫ |
| ChEMBL = 505512 |
|
|
|
| routes_of_administration = ] |
⚫ |
| PubChem = 440646 |
|
|
|
|
⚫ |
| ChemSpiderID = 389529 |
|
|
|
<!--Pharmacokinetic data--> |
⚫ |
| StdInChIKey = RFCWHQNNCOJYTR-IRCAEPKSSA-N |
|
|
|
| bioavailability = |
|
| SMILES = O=C\1OC(=O)/C(=C/1C)(O)CC(=O)O(C(C)C)(OC)(O)CC(=O)(C)(O)CC(3O2(O((C)CC2)CC(C(=O)C)C)CC3C)C |
|
|
|
| protein_bound = >99% |
|
| StdInChI = 1S/C41H66O13/c1-21(2)36(51-34(47)20-31(45)35-27(8)39(48)52-40(35)49)38(50-10)32(46)19-30(44)26(7)29(43)13-11-24(5)37-25(6)16-18-41(54-37)17-15-23(4)33(53-41)14-12-22(3)28(9)42/h21-26,29,31-33,36-38,43,45-46H,11-20H2,1-10H3/t22-,23+,24+,25-,26-,29-,31+,32+,33-,36+,37-,38+,41+/m0/s1 |
|
|
|
| metabolism = |
|
}} |
|
|
|
| elimination_half-life = 19 Hours |
|
| Section2 = {{Chembox Properties |
|
|
|
|
|
| Formula = C41H66O13 |
|
|
|
<!--Identifiers--> |
|
| MolarMass = 766.95 |
|
|
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| Appearance = |
|
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| Density = |
|
|
|
| CAS_number = 118292-40-3 |
|
| MeltingPt = |
|
|
| BoilingPt = |
|
| ATC_prefix = D05 |
|
|
| ATC_suffix = AX05 |
|
| Solubility = |
|
|
|
| ATC_supplemental = |
|
}} |
|
|
⚫ |
| PubChem = 5381 |
|
| Section3 = {{Chembox Hazards |
|
|
|
| DrugBank_Ref = {{drugbankcite|changed|drugbank}} |
|
| MainHazards = |
|
|
| FlashPt = |
|
| DrugBank = DB00799 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| Autoignition = |
|
|
⚫ |
| ChemSpiderID = 5188 |
|
}} |
|
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = 81BDR9Y8PS |
|
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
|
| KEGG = D01132 |
|
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
|
| ChEBI = 32184 |
|
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
⚫ |
| ChEMBL = 1657 |
|
|
|
|
|
<!--Chemical data--> |
|
|
| C=21 | H=21 | N=1 | O=2 | S=1 |
|
|
| molecular_weight = 351.463 g/mol |
|
|
| smiles = O=C(OCC)c1ccc(nc1)C#Cc3ccc2SCCC(c2c3)(C)C |
|
|
| InChI = 1/C21H21NO2S/c1-4-24-20(23)16-7-9-17(22-14-16)8-5-15-6-10-19-18(13-15)21(2,3)11-12-25-19/h6-7,9-10,13-14H,4,11-12H2,1-3H3 |
|
|
| InChIKey = OGQICQVSFDPSEI-UHFFFAOYAD |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
|
| StdInChI = 1S/C21H21NO2S/c1-4-24-20(23)16-7-9-17(22-14-16)8-5-15-6-10-19-18(13-15)21(2,3)11-12-25-19/h6-7,9-10,13-14H,4,11-12H2,1-3H3 |
|
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
⚫ |
| StdInChIKey = OGQICQVSFDPSEI-UHFFFAOYSA-N |
|
}} |
|
}} |