| Revision as of 18:45, 9 January 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 456844955 of page Tazobactam for the Chem/Drugbox validation project (updated: 'DrugBank').← Previous edit |
Revision as of 18:46, 9 January 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 460516979 of page Technetium_(99mTc)_albumin_aggregated for the Chem/Drugbox validation project (updated: '').Next edit → |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{Drugbox |
|
{{Drugbox |
|
| Verifiedfields = changed |
|
| Verifiedfields = changed |
|
| verifiedrevid = 430486404 |
|
| verifiedrevid = 447908672 |
|
|
| IUPAC_name = |
|
| IUPAC_name = (2''S'',3''S'',5''R'')-3-methyl-7-oxo-3-(1''H''-1,2,3-triazol-1-ylmethyl)-4-thia-1-azabicycloheptane-2-carboxylic acid 4,4-dioxide |
|
|
| image = Tazobactam.svg |
|
| image = |
|
|
| alt = |
|
|
| caption = |
|
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
|
| tradename = |
|
| tradename = |
|
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| Drugs.com = {{drugs.com|international|tazobactam}} |
|
|
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| pregnancy_category = |
|
| pregnancy_category = |
|
|
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
|
|
| legal_CA = <!-- OTC, Rx-only, Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
|
| legal_UK = <!-- GSL, P, POM, CD, CD Lic, CD POM, CD No Reg POM, CD (Benz) POM, CD (Anab) POM or CD Inv POM --> |
|
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| legal_status = |
|
| legal_status = |
|
| routes_of_administration = |
|
| routes_of_administration = |
| Line 18: |
Line 25: |
|
| metabolism = |
|
| metabolism = |
|
| elimination_half-life = |
|
| elimination_half-life = |
|
|
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
|
⚫ |
| ChemSpiderID = NA |
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number = 89786-04-9 |
|
| CAS_number = |
|
| ATC_prefix = J01 |
|
| ATCvet = |
|
| ATC_suffix = CG02 |
|
| ATC_prefix = V09 |
|
|
| ATC_suffix = GA04 |
|
| ATC_supplemental = |
|
|
| PubChem = 123630 |
|
| PubChem = |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank = DB01606 |
|
| DrugBank = |
| ⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ⚫ |
| ChemSpiderID = 110216 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = SE10G96M8W |
|
|
| KEGG_Ref = {{keggcite|changed|kegg}} |
|
|
| KEGG = D00660 |
|
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
|
| ChEMBL = 404 |
|
|
|
|
|
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
|
| chemical_formula = |
|
| C=10 | H=12 | N=4 | O=5 | S=1 |
|
|
|
|
|
| molecular_weight = 300.289 g/mol |
|
| molecular_weight = |
|
| smiles = O=S2(=O)((N1C(=O)C12)C(=O)O)(Cn3nncc3)C |
|
|
| InChI = 1/C10H12N4O5S/c1-10(5-13-3-2-11-12-13)8(9(16)17)14-6(15)4-7(14)20(10,18)19/h2-3,7-8H,4-5H2,1H3,(H,16,17)/t7-,8+,10+/m1/s1 |
|
|
| InChIKey = LPQZKKCYTLCDGQ-WEDXCCLWBT |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
|
| StdInChI = 1S/C10H12N4O5S/c1-10(5-13-3-2-11-12-13)8(9(16)17)14-6(15)4-7(14)20(10,18)19/h2-3,7-8H,4-5H2,1H3,(H,16,17)/t7-,8+,10+/m1/s1 |
|
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
|
| StdInChIKey = LPQZKKCYTLCDGQ-WEDXCCLWSA-N |
|
|
}} |
|
}} |
