| Revision as of 12:21, 10 January 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,084 edits Saving copy of the {{drugbox}} taken from revid 451564362 of page Terbequinil for the Chem/Drugbox validation project (updated: 'CAS_number').← Previous edit |
Revision as of 12:22, 10 January 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,084 edits Saving copy of the {{chembox}} taken from revid 451335555 of page Terbogrel for the Chem/Drugbox validation project (updated: 'ChEMBL', 'CASNo').Next edit → |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{Drugbox |
|
{{chembox |
|
| verifiedrevid = 451335956 |
|
|
| IUPAC_name = 1-(methoxymethyl)-4-oxo-N-propylquinoline-3-carboxamide |
|
|
| image = Terbequinil_structure.png |
|
|
| width = 200 |
|
|
|
|
|
<!--Clinical data--> |
|
|
| tradename = |
|
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
|
| pregnancy_category = |
|
|
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
|
|
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
|
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> |
|
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
|
| legal_status = |
|
|
| routes_of_administration = |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
|
| bioavailability = |
|
|
| protein_bound = |
|
|
| metabolism = |
|
|
| elimination_half-life = |
|
|
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
| ⚫ |
| CAS_number = <!-- blanked - oldvalue: 113079-82-6 --> |
|
|
| ATC_prefix = none |
|
| ⚫ |
| PubChem = 65916 |
|
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
|
| DrugBank = |
|
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ⚫ |
| ChemSpiderID = 59325 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = 0DH9WUS03O |
|
| UNII = 5Z4KWQ5OGN |
|
|
| ImageFile = Terbogrel structure.png |
|
|
|
|
|
| ImageSize = |
|
<!--Chemical data--> |
|
|
|
| IUPACName = (5E)-6-{3-phenyl}-6-pyridin-3-ylhex-5-enoic acid |
|
| C=15 | H=18 | N=2 | O=3 |
|
|
|
| OtherNames = |
|
| molecular_weight = 274.315 g/mol |
|
|
|
| Section1 = {{Chembox Identifiers |
|
| smiles = CCCNC(=O)C1=CN(C2=CC=CC=C2C1=O)COC |
|
|
⚫ |
| CASNo = <!-- blanked - oldvalue: 149979-74-8 --> |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
|
|
| ChEMBL = 281398 |
|
| StdInChI = 1S/C15H18N2O3/c1-3-8-16-15(19)12-9-17(10-20-2)13-7-5-4-6-11(13)14(12)18/h4-7,9H,3,8,10H2,1-2H3,(H,16,19) |
|
|
⚫ |
| PubChem = 6449876 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
|
⚫ |
| ChemSpiderID = 4952549 |
| ⚫ |
| StdInChIKey = RIPDGZHPNKQLDC-UHFFFAOYSA-N |
|
|
|
| KEGG = D06077 |
|
|
| StdInChI = 1S/C23H27N5O2/c1-23(2,3)28-22(26-16-24)27-19-10-6-8-17(14-19)20(11-4-5-12-21(29)30)18-9-7-13-25-15-18/h6-11,13-15H,4-5,12H2,1-3H3,(H,29,30)(H2,26,27,28)/b20-11+ |
|
⚫ |
| StdInChIKey = XUTLOCQNGLJNSA-RGVLZGJSSA-N |
|
|
| SMILES = N#CN\C(=N/C(C)(C)C)Nc2cccc(C(=C/CCCC(=O)O)\c1cccnc1)c2 |
|
|
| InChI = InChI=1S/C23H27N5O2/c1-23(2,3)28-22(26-16-24)27-19-10-6-8-17(14-19)20(11-4-5-12-21(29)30)18-9-7-13-25-15-18/h6-11,13-15H,4-5,12H2,1-3H3,(H,29,30)(H2,26,27,28)/b20-11+ |
|
|
}} |
|
|
| Section2 = {{Chembox Properties |
|
|
| Formula = C23H27N5O2 |
|
|
| MolarMass = 405.49 |
|
|
| Appearance = |
|
|
| Density = |
|
|
| MeltingPt = |
|
|
| BoilingPt = |
|
|
| Solubility = |
|
|
}} |
|
|
| Section3 = {{Chembox Hazards |
|
|
| MainHazards = |
|
|
| FlashPt = |
|
|
| Autoignition = |
|
|
}} |
|
}} |
|
}} |
