Misplaced Pages

:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions - Misplaced Pages

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
< Misplaced Pages:WikiProject Chemicals | Chembox validation Browse history interactively← Previous editNext edit →Content deleted Content addedVisualWikitext
Revision as of 12:22, 10 January 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 467575253 of page Terbutaline for the Chem/Drugbox validation project (updated: '').← Previous edit Revision as of 12:22, 10 January 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 444217414 of page Terbuthylazine for the Chem/Drugbox validation project (updated: '').Next edit →
Line 1: Line 1:
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} {{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}}
{{drugbox {{chembox
⚫ | verifiedrevid = 444216267
| Verifiedfields = changed
|ImageFile=Terbuthylazine.png
⚫ | verifiedrevid = 415868394
|ImageSize=
| IUPAC_name = (''RS'')-5-benzene-1,3-diol
|IUPACName=N-tert-butyl-6-chloro-N'-ethyl-1,3,5-triazine-2,4-diamine
| image = Terbutaline.png
|OtherNames=
| width = 200px
|Section1={{Chembox Identifiers
| imagename = 1 : 1 mixture (racemate)
⚫ | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| drug_name = Terbutaline
⚫ | ChemSpiderID = 20848

| InChI = 1/C9H16ClN5/c1-5-11-7-12-6(10)13-8(14-7)15-9(2,3)4/h5H2,1-4H3,(H2,11,12,13,14,15)
<!--Clinical data-->
| InChIKey = FZXISNSWEXTPMF-UHFFFAOYAN
| Drugs.com = {{drugs.com|monograph|terbutaline-sulfate}}
| MedlinePlus = a682144
| pregnancy_category = B
| legal_AU =
| legal_CA =
| legal_UK = POM
| legal_US =
| legal_status =
| routes_of_administration = SQ, Oral, Inhaled

<!--Pharmacokinetic data-->
| bioavailability =
| protein_bound =
| metabolism = GI tract (oral), liver; CYP450: unknown
| elimination_half-life = 3-4h
| excretion = urine 90% (60% unchanged), bile/faeces

<!--Identifiers-->
⚫ | CASNo_Ref = {{cascite|correct|CAS}}
⚫ | CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 23031-25-6
| ATC_prefix = R03
| ATC_suffix = AC03
| ATC_supplemental = {{ATC|R03|CC03}}
⚫ | PubChem = 5403
| IUPHAR_ligand = 560
| DrugBank_Ref = {{drugbankcite|changed|drugbank}}
| DrugBank = DB00871
⚫ | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
⚫ | ChemSpiderID = 5210
⚫ | UNII_Ref = {{fdacite|correct|FDA}}
| UNII = N8ONU3L3PG
| KEGG_Ref = {{keggcite|correct|kegg}}
⚫ | KEGG = D08570
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 1760

<!--Chemical data-->
| C=12 | H=19 | N=1 | O=3
| molecular_weight = 225.284 g/mol
| smiles = Oc1cc(cc(O)c1)C(O)CNC(C)(C)C
| InChI = 1/C12H19NO3/c1-12(2,3)13-7-11(16)8-4-9(14)6-10(15)5-8/h4-6,11,13-16H,7H2,1-3H3
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C12H19NO3/c1-12(2,3)13-7-11(16)8-4-9(14)6-10(15)5-8/h4-6,11,13-16H,7H2,1-3H3 | StdInChI = 1S/C9H16ClN5/c1-5-11-7-12-6(10)13-8(14-7)15-9(2,3)4/h5H2,1-4H3,(H2,11,12,13,14,15)
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = XWTYSIMOBUGWOL-UHFFFAOYSA-N | StdInChIKey = FZXISNSWEXTPMF-UHFFFAOYSA-N
⚫ | CASNo_Ref = {{cascite|correct|CAS}}
| CASNo=5915-41-3
⚫ | PubChem=22206
⚫ | KEGG_Ref = {{keggcite|correct|kegg}}
⚫ | KEGG = C18810
⚫ | ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 30263
| SMILES = Clc1nc(nc(n1)NC(C)(C)C)NCC
}}
|Section2={{Chembox Properties
| Formula=C<sub>9</sub>H<sub>16</sub>ClN<sub>5</sub>
| MolarMass=229.710 g/mol
| Appearance=
| Density=
| MeltingPt=
| BoilingPt=
| Solubility=
}}
|Section3={{Chembox Hazards
| MainHazards=
| FlashPt=
| Autoignition=
}}
}} }}

Revision as of 12:22, 10 January 2012

This page contains a copy of the infobox ({{chembox}}) taken from revid 444217414 of page Terbuthylazine with values updated to verified values.
WikiProject Chemicals/Chembox validation/VerifiedDataSandbox
Names
IUPAC name N-tert-butyl-6-chloro-N'-ethyl-1,3,5-triazine-2,4-diamine
Identifiers
CAS Number
3D model (JSmol)
ChEBI
ChemSpider
KEGG
PubChem CID
InChI
  • InChI=1S/C9H16ClN5/c1-5-11-7-12-6(10)13-8(14-7)15-9(2,3)4/h5H2,1-4H3,(H2,11,12,13,14,15)Key: FZXISNSWEXTPMF-UHFFFAOYSA-N
  • InChI=1/C9H16ClN5/c1-5-11-7-12-6(10)13-8(14-7)15-9(2,3)4/h5H2,1-4H3,(H2,11,12,13,14,15)Key: FZXISNSWEXTPMF-UHFFFAOYAN
SMILES
  • Clc1nc(nc(n1)NC(C)(C)C)NCC
Properties
Chemical formula C9H16ClN5
Molar mass 229.710 g/mol
Except where otherwise noted, data are given for materials in their standard state (at 25 °C , 100 kPa). checkY verify (what is  ?) Infobox references
Chemical compound